Merge remote-tracking branch 'origin/dev'

.travis_linux.sh

@@ -1,11 +1,11 @@
 #!/bin/bash
 project_dir=$(pwd)
 
-# Install qt5.7
+# Install qt5.9
 sudo add-apt-repository ppa:george-edison55/cmake-3.x -y
-sudo add-apt-repository ppa:beineri/opt-qt571-trusty -y
+sudo add-apt-repository ppa:beineri/opt-qt591-trusty -y
 sudo apt-get update -qq
-sudo apt-get -y install qt57base qt57webengine qt57webchannel qt57svg qt57location qt57tools qt57translations
+sudo apt-get -y install qt59base qt59webengine qt59webchannel qt59svg qt59location qt59tools qt59translations
 source /opt/qt*/bin/qt*-env.sh
 
 # Compile newer version fcitx-qt5
@@ -34,7 +34,7 @@ make -j$(nproc) && sudo make install
 sudo cp /usr/local/lib/libFcitxQt5DBusAddons.so* /opt/qt*/lib/
 sudo cp /usr/local/lib/libFcitxQt5WidgetsAddons.so* /opt/qt*/lib/
 
-tree /opt/qt57/lib/
+tree /opt/qt59/lib/
 
 cd ${project_dir}
 mkdir build
@@ -53,9 +53,9 @@ INSTALL_ROOT=${project_dir}/build/dist make install ; tree dist/
 mkdir -p ./dist/usr/plugins/iconengines
 mkdir -p ./dist/usr/plugins/imageformats
 mkdir -p ./dist/usr/plugins/platforminputcontexts
-cp /opt/qt57/plugins/iconengines/* ./dist/usr/plugins/iconengines/
+cp /opt/qt59/plugins/iconengines/* ./dist/usr/plugins/iconengines/
-cp /opt/qt57/plugins/imageformats/* ./dist/usr/plugins/imageformats/
+cp /opt/qt59/plugins/imageformats/* ./dist/usr/plugins/imageformats/
-cp /opt/qt57/plugins/platforminputcontexts/* ./dist/usr/plugins/platforminputcontexts/
+cp /opt/qt59/plugins/platforminputcontexts/* ./dist/usr/plugins/platforminputcontexts/
 
 # Copy other project files
 cp "${project_dir}/README.md" "dist/README.md"
@@ -70,7 +70,7 @@ unset QTDIR; unset QT_PLUGIN_PATH ; unset LD_LIBRARY_PATH
 ./linuxdeployqt*.AppImage ./dist/usr/share/applications/*.desktop -bundle-non-qt-libs
 
 # Copy translations
-cp /opt/qt57/translations/*_zh_CN.qm ./dist/usr/translations/
+cp /opt/qt59/translations/*_zh_CN.qm ./dist/usr/translations/
 
 # Package it for the second time.
 ./linuxdeployqt*.AppImage ./dist/usr/share/applications/*.desktop -appimage

.travis_macos.sh

@@ -2,8 +2,8 @@
 project_dir=$(pwd)
 
 brew update > /dev/null
-brew install qt@5.7
+brew install qt@5.9
-QTDIR="/usr/local/opt/qt@5.7"
+QTDIR="/usr/local/opt/qt@5.9"
 PATH="$QTDIR/bin:$PATH"
 LDFLAGS=-L$QTDIR/lib
 CPPFLAGS=-I$QTDIR/include

README.md

@@ -54,7 +54,8 @@ Utilizing Qt, VNote could run on **Linux**, **Windows**, and **macOS** (due to t
 - Supports infinite levels of folders;
 - Supports multiple tabs and splitting windows;
 - Supports [Mermaid](http://knsv.github.io/mermaid/), [Flowchart.js](http://flowchart.js.org/), and [MathJax](https://www.mathjax.org/);
-- Supports HiDPI.
+- Supports HiDPI;
+- Supports attachments of notes.
 
 ![VNote Edit](screenshots/vnote_edit.gif)
 
@@ -136,7 +137,7 @@ VNote also supports many other features, like:
 - Auto indent and auto list;
 
 # Build & Development
-VNote needs Qt 5.7 or above to build.
+VNote needs Qt 5.9.1 or above to build.
 
 1. Clone & Init
     ```
@@ -145,15 +146,15 @@ VNote needs Qt 5.7 or above to build.
     git submodule update --init
     ```
 2. Download Qt & Have Fun  
-Download [Qt 5.7.0](http://info.qt.io/download-qt-for-application-development) and open `VNote.pro` as a project.
+Download [Qt 5.9.1](http://info.qt.io/download-qt-for-application-development) and open `VNote.pro` as a project.
 
 ## Linux
-If your distribution does not have Qt 5.7 or above, you need to add it from other sources. In Ubuntu, you could do this:
+If your distribution does not have Qt 5.9.1 or above, you need to add it from other sources. In Ubuntu, you could do this:
 
 ```
-sudo add-apt-repository ppa:beineri/opt-qt571-trusty -y
+sudo add-apt-repository ppa:beineri/opt-qt591-trusty -y
 sudo apt-get update -qq
-sudo apt-get -y install qt57base qt57webengine qt57webchannel qt57svg qt57location qt57tools qt57translations
+sudo apt-get -y install qt59base qt59webengine qt59webchannel qt59svg qt59location qt59tools qt59translations
 source /opt/qt*/bin/qt*-env.sh
 ```
 
@@ -174,13 +175,13 @@ For details, you could reference [.travis_linux.sh](.travis_linux.sh) in the sou
 If you prefer command line on macOS, you could follow these steps.
 
 1. Install Xcode and Homebrew;
-2. Install Qt5.7 via Homebrew:
+2. Install Qt 5.9.1 via Homebrew:
     ```
-    brew install qt@5.7
+    brew install qt@5.9.1
     ```
 3. In the project directory, create `build_macos.sh` like this:
     ```sh
-    QTDIR="/usr/local/opt/qt@5.7"
+    QTDIR="/usr/local/opt/qt@5.9.1"
     PATH="$QTDIR/bin:$PATH"
     LDFLAGS=-L$QTDIR/lib
     CPPFLAGS=-I$QTDIR/include
@@ -199,7 +200,7 @@ If you prefer command line on macOS, you could follow these steps.
 5. Now you got the bundle `path/to/project/build/src/VNote.app`. Enjoy yourself!
 
 # Dependencies
-- [Qt 5.7](http://qt-project.org) (L-GPL v3)
+- [Qt 5.9](http://qt-project.org) (L-GPL v3)
 - [PEG Markdown Highlight](http://hasseg.org/peg-markdown-highlight/) (MIT License)
 - [Hoedown 3.0.7](https://github.com/hoedown/hoedown/) (ISC License)
 - [Marked](https://github.com/chjj/marked) (MIT License)
@@ -212,6 +213,7 @@ If you prefer command line on macOS, you could follow these steps.
 - [MathJax](https://www.mathjax.org/) (Apache-2.0)
 - [showdown](https://github.com/showdownjs/showdown) (Unknown)
 - [flowchart.js](https://github.com/adrai/flowchart.js) (MIT License)
+- Icons made by a326703305@qq.com
 
 # License
 VNote is licensed under the [MIT license](http://opensource.org/licenses/MIT).

README_zh.md

@@ -54,8 +54,9 @@ VNote不是一个简单的Markdown编辑器。通过提供笔记管理功能，V
 - 支持Vim模式以及一系列强大的快捷键；
 - 支持无限层级的文件夹；
 - 支持多个标签页和窗口分割；
-- 支持[Mermaid](http://knsv.github.io/mermaid/), [Flowchart.js](http://flowchart.js.org/) 和 [MathJax](https://www.mathjax.org/);
+- 支持[Mermaid](http://knsv.github.io/mermaid/), [Flowchart.js](http://flowchart.js.org/) 和 [MathJax](https://www.mathjax.org/)；
 - 支持高分辨率；
+- 支持笔记附件。
 
 ![VNote Edit](screenshots/vnote_edit.gif)
 
@@ -137,7 +138,7 @@ VNote还支持其他很多的功能，比如：
 - 自动缩进和自动列表；
 
 # 构建与开发
-VNote需要5.7版本以上的Qt进行构建。
+VNote需要5.9.1版本以上的Qt进行构建。
 
 1. 克隆代码仓库
     ```
@@ -146,15 +147,15 @@ VNote需要5.7版本以上的Qt进行构建。
     git submodule update --init
     ```
 2. 下载Qt  
-下载[Qt 5.7.0](http://info.qt.io/download-qt-for-application-development)，导入`VNote.pro`创建一个工程。
+下载[Qt 5.9.1](http://info.qt.io/download-qt-for-application-development)，导入`VNote.pro`创建一个工程。
 
 ## Linux
-如果您的Linux发行版不提供5.7以上版本的Qt，那么您需要从其他来源获取Qt。在Ubuntu中，您可以执行以下步骤：
+如果您的Linux发行版不提供5.9.1以上版本的Qt，那么您需要从其他来源获取Qt。在Ubuntu中，您可以执行以下步骤：
 
 ```
-sudo add-apt-repository ppa:beineri/opt-qt571-trusty -y
+sudo add-apt-repository ppa:beineri/opt-qt591-trusty -y
 sudo apt-get update -qq
-sudo apt-get -y install qt57base qt57webengine qt57webchannel qt57svg qt57location qt57tools qt57translations
+sudo apt-get -y install qt59base qt59webengine qt59webchannel qt59svg qt59location qt59tools qt59translations
 source /opt/qt*/bin/qt*-env.sh
 ```
 
@@ -175,15 +176,15 @@ sudo make install
 在macOS下，您可以执行以下步骤来编译：
 
 1. 安装Xcode和Homebrew：
-2. 通过Homebrew安装Qt5.7：
+2. 通过Homebrew安装Qt5.9.1：
 
     ```
-    brew install qt@5.7
+    brew install qt@5.9.1
     ```
 3. 在VNote源码根目录下，新建一个文件`build_macos.sh`：
 
     ```sh
-    QTDIR="/usr/local/opt/qt@5.7"
+    QTDIR="/usr/local/opt/qt@5.9.1"
     PATH="$QTDIR/bin:$PATH"
     LDFLAGS=-L$QTDIR/lib
     CPPFLAGS=-I$QTDIR/include
@@ -203,7 +204,7 @@ sudo make install
 5. 此时得到VNote的Bundle `path/to/project/build/src/VNote.app`，打开即可。
 
 # 依赖
-- [Qt 5.7](http://qt-project.org) (L-GPL v3)
+- [Qt 5.9](http://qt-project.org) (L-GPL v3)
 - [PEG Markdown Highlight](http://hasseg.org/peg-markdown-highlight/) (MIT License)
 - [Hoedown 3.0.7](https://github.com/hoedown/hoedown/) (ISC License)
 - [Marked](https://github.com/chjj/marked) (MIT License)
@@ -216,6 +217,7 @@ sudo make install
 - [MathJax](https://www.mathjax.org/) (Apache-2.0)
 - [showdown](https://github.com/showdownjs/showdown) (Unknown)
 - [flowchart.js](https://github.com/adrai/flowchart.js) (MIT License)
+- 图标由九梦岛主(a326703305@qq.com)制作
 
 # 代码许可
 VNote使用[MIT许可](http://opensource.org/licenses/MIT)。

appveyor.yml

@@ -11,9 +11,9 @@ environment:
     VSVER: 14
 
     matrix:
-        - QT: C:\Qt\5.7\msvc2015_64
+        - QT: C:\Qt\5.9.1\msvc2015_64
           PLATFORM: amd64
-        - QT: C:\Qt\5.7\msvc2015
+        - QT: C:\Qt\5.9.1\msvc2015
           PLATFORM: x86
 
 clone_depth: 1
@@ -29,8 +29,8 @@ before_build:
     # After calling vcvarsall.bat, %PLATFORM% will be X64 or x86
     - mkdir build
     - cd build
-    - if "%PLATFORM%" EQU "X64" (qmake -r -spec win32-msvc2015 CONFIG+=x86_64 CONFIG-=debug CONFIG+=release ../VNote.pro)
+    - if "%PLATFORM%" EQU "X64" (qmake -r -spec win32-msvc CONFIG+=x86_64 CONFIG-=debug CONFIG+=release ../VNote.pro)
-    - if "%PLATFORM%" EQU "x86" (qmake -r -spec win32-msvc2015 CONFIG+=Win32 CONFIG-=debug CONFIG+=release ../VNote.pro)
+    - if "%PLATFORM%" EQU "x86" (qmake -r -spec win32-msvc CONFIG+=Win32 CONFIG-=debug CONFIG+=release ../VNote.pro)
 
 # custom build scripts
 build_script:

src/dialog/vdirinfodialog.cpp

@@ -2,6 +2,7 @@
 #include "vdirinfodialog.h"
 #include "vdirectory.h"
 #include "vconfigmanager.h"
+#include "vlineedit.h"
 #include "utils/vutils.h"
 
 extern VConfigManager *g_config;
@@ -16,7 +17,7 @@ VDirInfoDialog::VDirInfoDialog(const QString &title,
 {
     setupUI();
 
-    connect(nameEdit, &QLineEdit::textChanged, this, &VDirInfoDialog::handleInputChanged);
+    connect(m_nameEdit, &QLineEdit::textChanged, this, &VDirInfoDialog::handleInputChanged);
 
     handleInputChanged();
 }
@@ -28,15 +29,18 @@ void VDirInfoDialog::setupUI()
         infoLabel = new QLabel(info);
     }
 
-    nameEdit = new QLineEdit(m_directory->getName());
+    m_nameEdit = new VLineEdit(m_directory->getName());
-    nameEdit->selectAll();
+    QValidator *validator = new QRegExpValidator(QRegExp(VUtils::c_fileNameRegExp),
+                                                 m_nameEdit);
+    m_nameEdit->setValidator(validator);
+    m_nameEdit->selectAll();
 
     // Created time.
     QString createdTimeStr = VUtils::displayDateTime(m_directory->getCreatedTimeUtc().toLocalTime());
     QLabel *createdTimeLabel = new QLabel(createdTimeStr);
 
     QFormLayout *topLayout = new QFormLayout();
-    topLayout->addRow(tr("Folder &name:"), nameEdit);
+    topLayout->addRow(tr("Folder &name:"), m_nameEdit);
     topLayout->addRow(tr("Created time:"), createdTimeLabel);
 
     m_warnLabel = new QLabel();
@@ -49,7 +53,7 @@ void VDirInfoDialog::setupUI()
     connect(m_btnBox, &QDialogButtonBox::rejected, this, &QDialog::reject);
 
     QPushButton *okBtn = m_btnBox->button(QDialogButtonBox::Ok);
-    nameEdit->setMinimumWidth(okBtn->sizeHint().width() * 3);
+    m_nameEdit->setMinimumWidth(okBtn->sizeHint().width() * 3);
 
     QVBoxLayout *mainLayout = new QVBoxLayout();
     if (infoLabel) {
@@ -67,19 +71,35 @@ void VDirInfoDialog::setupUI()
 void VDirInfoDialog::handleInputChanged()
 {
     bool showWarnLabel = false;
-    QString name = nameEdit->text();
+    QString name = m_nameEdit->getEvaluatedText();
     bool nameOk = !name.isEmpty();
     if (nameOk && name != m_directory->getName()) {
         // Check if the name conflicts with existing directory name.
         // Case-insensitive when creating note.
         const VDirectory *directory = m_parentDirectory->findSubDirectory(name, false);
+        QString warnText;
         if (directory && directory != m_directory) {
             nameOk = false;
-            showWarnLabel = true;
+            warnText = tr("<span style=\"%1\">WARNING</span>: "
-            QString nameConflictText = tr("<span style=\"%1\">WARNING</span>: Name (case-insensitive) already exists. "
+                          "Name (case-insensitive) <span style=\"%2\">%3</span> already exists. "
                           "Please choose another name.")
-                                          .arg(g_config->c_warningTextStyle);
+                         .arg(g_config->c_warningTextStyle)
-            m_warnLabel->setText(nameConflictText);
+                         .arg(g_config->c_dataTextStyle)
+                         .arg(name);
+        } else if (!VUtils::checkFileNameLegal(name)) {
+            // Check if evaluated name contains illegal characters.
+            nameOk = false;
+            warnText = tr("<span style=\"%1\">WARNING</span>: "
+                          "Name <span style=\"%2\">%3</span> contains illegal characters "
+                          "(after magic word evaluation).")
+                         .arg(g_config->c_warningTextStyle)
+                         .arg(g_config->c_dataTextStyle)
+                         .arg(name);
+        }
+
+        if (!nameOk) {
+            showWarnLabel = true;
+            m_warnLabel->setText(warnText);
         }
     }
 
@@ -91,5 +111,5 @@ void VDirInfoDialog::handleInputChanged()
 
 QString VDirInfoDialog::getNameInput() const
 {
-    return nameEdit->text();
+    return m_nameEdit->getEvaluatedText();
 }

src/dialog/vdirinfodialog.h

@@ -4,7 +4,7 @@
 #include <QDialog>
 
 class QLabel;
-class QLineEdit;
+class VLineEdit;
 class QDialogButtonBox;
 class QString;
 class VDirectory;
@@ -27,7 +27,7 @@ private slots:
 private:
     void setupUI();
 
-    QLineEdit *nameEdit;
+    VLineEdit *m_nameEdit;
     QLabel *m_warnLabel;
     QDialogButtonBox *m_btnBox;
 

src/dialog/vfileinfodialog.cpp

@@ -4,6 +4,7 @@
 #include "vnotefile.h"
 #include "vconfigmanager.h"
 #include "utils/vutils.h"
+#include "vlineedit.h"
 
 extern VConfigManager *g_config;
 
@@ -16,7 +17,7 @@ VFileInfoDialog::VFileInfoDialog(const QString &title,
 {
     setupUI(title, info);
 
-    connect(nameEdit, &QLineEdit::textChanged, this, &VFileInfoDialog::handleInputChanged);
+    connect(m_nameEdit, &QLineEdit::textChanged, this, &VFileInfoDialog::handleInputChanged);
 
     handleInputChanged();
 }
@@ -30,7 +31,10 @@ void VFileInfoDialog::setupUI(const QString &p_title, const QString &p_info)
 
     // File name.
     QString name = m_file->getName();
-    nameEdit = new QLineEdit(name);
+    m_nameEdit = new VLineEdit(name);
+    QValidator *validator = new QRegExpValidator(QRegExp(VUtils::c_fileNameRegExp),
+                                                 m_nameEdit);
+    m_nameEdit->setValidator(validator);
     int baseStart = 0, baseLength = name.size();
     int dotIdx = name.lastIndexOf('.');
     if (dotIdx != -1) {
@@ -38,7 +42,7 @@ void VFileInfoDialog::setupUI(const QString &p_title, const QString &p_info)
     }
 
     // Select without suffix.
-    nameEdit->setSelection(baseStart, baseLength);
+    m_nameEdit->setSelection(baseStart, baseLength);
 
     // Attachment folder.
     QLineEdit *attachmentFolderEdit = new QLineEdit(m_file->getAttachmentFolder());
@@ -56,7 +60,7 @@ void VFileInfoDialog::setupUI(const QString &p_title, const QString &p_info)
     modifiedTimeLabel->setToolTip(tr("Last modified time within VNote"));
 
     QFormLayout *topLayout = new QFormLayout();
-    topLayout->addRow(tr("Note &name:"), nameEdit);
+    topLayout->addRow(tr("Note &name:"), m_nameEdit);
     topLayout->addRow(tr("Attachment folder:"), attachmentFolderEdit);
     topLayout->addRow(tr("Created time:"), createdTimeLabel);
     topLayout->addRow(tr("Modified time:"), modifiedTimeLabel);
@@ -71,7 +75,7 @@ void VFileInfoDialog::setupUI(const QString &p_title, const QString &p_info)
     connect(m_btnBox, &QDialogButtonBox::rejected, this, &QDialog::reject);
 
     QPushButton *okBtn = m_btnBox->button(QDialogButtonBox::Ok);
-    nameEdit->setMinimumWidth(okBtn->sizeHint().width() * 3);
+    m_nameEdit->setMinimumWidth(okBtn->sizeHint().width() * 3);
 
     QVBoxLayout *mainLayout = new QVBoxLayout();
     if (infoLabel) {
@@ -90,28 +94,43 @@ void VFileInfoDialog::setupUI(const QString &p_title, const QString &p_info)
 void VFileInfoDialog::handleInputChanged()
 {
     bool showWarnLabel = false;
-    QString name = nameEdit->text();
+    QString name = m_nameEdit->getEvaluatedText();
     bool nameOk = !name.isEmpty();
     if (nameOk && name != m_file->getName()) {
         // Check if the name conflicts with existing note name.
         // Case-insensitive when creating note.
         const VNoteFile *file = m_directory->findFile(name, false);
+        QString warnText;
         if (file && file != m_file) {
             nameOk = false;
-            showWarnLabel = true;
+            warnText = tr("<span style=\"%1\">WARNING</span>: "
-            QString nameConflictText = tr("<span style=\"%1\">WARNING</span>: Name (case-insensitive) already exists. "
+                          "Name (case-insensitive) <span style=\"%2\">%3</span> already exists. "
                           "Please choose another name.")
-                                          .arg(g_config->c_warningTextStyle);
+                         .arg(g_config->c_warningTextStyle)
-            m_warnLabel->setText(nameConflictText);
+                         .arg(g_config->c_dataTextStyle)
+                         .arg(name);
         } else if (m_file->getDocType() != DocType::Unknown
                    && VUtils::docTypeFromName(name) != m_file->getDocType()) {
             // Check if the name change the doc type.
             nameOk = false;
-            showWarnLabel = true;
+            warnText = tr("<span style=\"%1\">WARNING</span>: "
-            QString nameConflictText = tr("<span style=\"%1\">WARNING</span>: Changing type of the note is not supported. "
+                          "Changing type of the note is not supported. "
                           "Please use the same suffix as the old one.")
                          .arg(g_config->c_warningTextStyle);
-            m_warnLabel->setText(nameConflictText);
+        } else if (!VUtils::checkFileNameLegal(name)) {
+            // Check if evaluated name contains illegal characters.
+            nameOk = false;
+            warnText = tr("<span style=\"%1\">WARNING</span>: "
+                          "Name <span style=\"%2\">%3</span> contains illegal characters "
+                          "(after magic word evaluation).")
+                         .arg(g_config->c_warningTextStyle)
+                         .arg(g_config->c_dataTextStyle)
+                         .arg(name);
+        }
+
+        if (!nameOk) {
+            showWarnLabel = true;
+            m_warnLabel->setText(warnText);
         }
     }
 
@@ -123,5 +142,5 @@ void VFileInfoDialog::handleInputChanged()
 
 QString VFileInfoDialog::getNameInput() const
 {
-    return nameEdit->text();
+    return m_nameEdit->getEvaluatedText();
 }

src/dialog/vfileinfodialog.h

@@ -4,7 +4,7 @@
 #include <QDialog>
 
 class QLabel;
-class QLineEdit;
+class VLineEdit;
 class QDialogButtonBox;
 class QString;
 class VDirectory;
@@ -29,7 +29,7 @@ private slots:
 private:
     void setupUI(const QString &p_title, const QString &p_info);
 
-    QLineEdit *nameEdit;
+    VLineEdit *m_nameEdit;
     QLabel *m_warnLabel;
     QDialogButtonBox *m_btnBox;
 

src/dialog/vinsertimagedialog.cpp

@@ -3,6 +3,7 @@
 #include <QRegExp>
 #include "vinsertimagedialog.h"
 #include "utils/vutils.h"
+#include "vlineedit.h"
 
 VInsertImageDialog::VInsertImageDialog(const QString &title, const QString &defaultImageTitle,
                                        const QString &defaultPath, QWidget *parent)
@@ -11,11 +12,14 @@ VInsertImageDialog::VInsertImageDialog(const QString &title, const QString &defa
 {
     setupUI();
 
-    connect(imageTitleEdit, &QLineEdit::textChanged, this, &VInsertImageDialog::enableOkButton);
+    connect(m_imageTitleEdit, &QLineEdit::textChanged,
-    connect(pathEdit, &QLineEdit::textChanged, this, &VInsertImageDialog::enableOkButton);
+            this, &VInsertImageDialog::handleInputChanged);
-    connect(browseBtn, &QPushButton::clicked, this, &VInsertImageDialog::handleBrowseBtnClicked);
+    connect(pathEdit, &QLineEdit::textChanged,
+            this, &VInsertImageDialog::handleInputChanged);
+    connect(browseBtn, &QPushButton::clicked,
+            this, &VInsertImageDialog::handleBrowseBtnClicked);
 
-    enableOkButton();
+    handleInputChanged();
 }
 
 VInsertImageDialog::~VInsertImageDialog()
@@ -34,19 +38,19 @@ void VInsertImageDialog::setupUI()
     browseBtn = new QPushButton(tr("&Browse"));
 
     imageTitleLabel = new QLabel(tr("&Image title:"));
-    imageTitleEdit = new QLineEdit(defaultImageTitle);
+    m_imageTitleEdit = new VLineEdit(defaultImageTitle);
-    imageTitleEdit->selectAll();
+    m_imageTitleEdit->selectAll();
-    imageTitleLabel->setBuddy(imageTitleEdit);
+    imageTitleLabel->setBuddy(m_imageTitleEdit);
-    QRegExp regExp("[\\w\\(\\)@#%\\*\\-\\+=\\?<>\\,\\.\\s]+");
+    QValidator *validator = new QRegExpValidator(QRegExp(VUtils::c_imageTitleRegExp),
-    QValidator *validator = new QRegExpValidator(regExp, this);
+                                                 m_imageTitleEdit);
-    imageTitleEdit->setValidator(validator);
+    m_imageTitleEdit->setValidator(validator);
 
     QGridLayout *topLayout = new QGridLayout();
     topLayout->addWidget(pathLabel, 0, 0);
     topLayout->addWidget(pathEdit, 0, 1);
     topLayout->addWidget(browseBtn, 0, 2);
     topLayout->addWidget(imageTitleLabel, 1, 0);
-    topLayout->addWidget(imageTitleEdit, 1, 1, 1, 2);
+    topLayout->addWidget(m_imageTitleEdit, 1, 1, 1, 2);
     topLayout->setColumnStretch(0, 0);
     topLayout->setColumnStretch(1, 1);
     topLayout->setColumnStretch(2, 0);
@@ -67,22 +71,31 @@ void VInsertImageDialog::setupUI()
     mainLayout->setSizeConstraint(QLayout::SetFixedSize);
     setWindowTitle(title);
 
-    imageTitleEdit->setFocus();
+    m_imageTitleEdit->setFocus();
 }
 
-void VInsertImageDialog::enableOkButton()
+void VInsertImageDialog::handleInputChanged()
 {
-    bool enabled = true;
+    bool pathOk = true;
-    if (imageTitleEdit->text().isEmpty() || !image) {
+    if (pathEdit->isVisible() && !pathEdit->isReadOnly()) {
-        enabled = false;
+        QString path = pathEdit->text();
+        if (path.isEmpty()
+            || !VUtils::checkPathLegal(path)) {
+            pathOk = false;
         }
+    }
+
+    QString title = m_imageTitleEdit->getEvaluatedText();
+    QRegExp reg(VUtils::c_imageTitleRegExp);
+    bool titleOk = reg.exactMatch(title);
+
     QPushButton *okBtn = m_btnBox->button(QDialogButtonBox::Ok);
-    okBtn->setEnabled(enabled);
+    okBtn->setEnabled(pathOk && titleOk);
 }
 
 QString VInsertImageDialog::getImageTitleInput() const
 {
-    return imageTitleEdit->text();
+    return m_imageTitleEdit->getEvaluatedText();
 }
 
 QString VInsertImageDialog::getPathInput() const
@@ -130,7 +143,8 @@ void VInsertImageDialog::setImage(const QImage &image)
 
     imagePreviewLabel->setPixmap(pixmap);
     imagePreviewLabel->setVisible(true);
-    enableOkButton();
+
+    handleInputChanged();
 }
 
 void VInsertImageDialog::setBrowseable(bool browseable, bool visible)
@@ -141,6 +155,8 @@ void VInsertImageDialog::setBrowseable(bool browseable, bool visible)
     pathLabel->setVisible(visible);
     pathEdit->setVisible(visible);
     browseBtn->setVisible(visible);
+
+    handleInputChanged();
 }
 
 void VInsertImageDialog::imageDownloaded(const QByteArray &data)

src/dialog/vinsertimagedialog.h

@@ -8,6 +8,7 @@
 
 class QLabel;
 class QLineEdit;
+class VLineEdit;
 class QPushButton;
 class QDialogButtonBox;
 
@@ -30,14 +31,14 @@ public slots:
     void imageDownloaded(const QByteArray &data);
 
 private slots:
-    void enableOkButton();
+    void handleInputChanged();
     void handleBrowseBtnClicked();
 
 private:
     void setupUI();
 
     QLabel *imageTitleLabel;
-    QLineEdit *imageTitleEdit;
+    VLineEdit *m_imageTitleEdit;
     QLabel *pathLabel;
     QLineEdit *pathEdit;
     QPushButton *browseBtn;

src/dialog/vinsertlinkdialog.cpp

@@ -0,0 +1,132 @@
+#include "vinsertlinkdialog.h"
+
+#include <QtWidgets>
+
+#include "vlineedit.h"
+
+VInsertLinkDialog::VInsertLinkDialog(const QString &p_title,
+                                     const QString &p_text,
+                                     const QString &p_info,
+                                     const QString &p_linkText,
+                                     const QString &p_linkUrl,
+                                     QWidget *p_parent)
+    : QDialog(p_parent)
+{
+    setupUI(p_title, p_text, p_info, p_linkText, p_linkUrl);
+
+    fetchLinkFromClipboard();
+
+    handleInputChanged();
+}
+
+void VInsertLinkDialog::setupUI(const QString &p_title,
+                                const QString &p_text,
+                                const QString &p_info,
+                                const QString &p_linkText,
+                                const QString &p_linkUrl)
+{
+    QLabel *textLabel = NULL;
+    if (!p_text.isEmpty()) {
+        textLabel = new QLabel(p_text);
+        textLabel->setWordWrap(true);
+    }
+
+    QLabel *infoLabel = NULL;
+    if (!p_info.isEmpty()) {
+        infoLabel = new QLabel(p_info);
+        infoLabel->setWordWrap(true);
+    }
+
+    m_linkTextEdit = new VLineEdit(p_linkText);
+    m_linkTextEdit->selectAll();
+
+    m_linkUrlEdit = new QLineEdit(p_linkUrl);
+    m_linkUrlEdit->setToolTip(tr("Absolute or relative path of the link"));
+
+    QFormLayout *inputLayout = new QFormLayout();
+    inputLayout->addRow(tr("&Text:"), m_linkTextEdit);
+    inputLayout->addRow(tr("&URL:"), m_linkUrlEdit);
+
+    // Ok is the default button.
+    m_btnBox = new QDialogButtonBox(QDialogButtonBox::Ok | QDialogButtonBox::Cancel);
+    connect(m_btnBox, &QDialogButtonBox::accepted, this, &QDialog::accept);
+    connect(m_btnBox, &QDialogButtonBox::rejected, this, &QDialog::reject);
+
+    QPushButton *okBtn = m_btnBox->button(QDialogButtonBox::Ok);
+    m_linkTextEdit->setMinimumWidth(okBtn->sizeHint().width() * 3);
+
+    QVBoxLayout *mainLayout = new QVBoxLayout;
+    if (textLabel) {
+        mainLayout->addWidget(textLabel);
+    }
+
+    if (infoLabel) {
+        mainLayout->addWidget(infoLabel);
+    }
+
+    mainLayout->addLayout(inputLayout);
+    mainLayout->addWidget(m_btnBox);
+
+    setLayout(mainLayout);
+    setWindowTitle(p_title);
+
+    connect(m_linkTextEdit, &QLineEdit::textChanged,
+            this, &VInsertLinkDialog::handleInputChanged);
+    connect(m_linkUrlEdit, &QLineEdit::textChanged,
+            this, &VInsertLinkDialog::handleInputChanged);
+}
+
+void VInsertLinkDialog::handleInputChanged()
+{
+    bool textOk = true;
+    if (m_linkTextEdit->getEvaluatedText().isEmpty()) {
+        textOk = false;
+    }
+
+    bool urlOk = true;
+    if (m_linkUrlEdit->text().isEmpty()) {
+        urlOk = false;
+    }
+
+    QPushButton *okBtn = m_btnBox->button(QDialogButtonBox::Ok);
+    okBtn->setEnabled(textOk && urlOk);
+}
+
+void VInsertLinkDialog::fetchLinkFromClipboard()
+{
+    if (!m_linkUrlEdit->text().isEmpty()
+        || !m_linkTextEdit->text().isEmpty()) {
+        return;
+    }
+
+    QClipboard *clipboard = QApplication::clipboard();
+    const QMimeData *mimeData = clipboard->mimeData();
+
+    if (!mimeData->hasText()) {
+        return;
+    }
+
+    QString text = mimeData->text();
+    if (text.isEmpty()) {
+        return;
+    }
+
+    QUrl url = QUrl::fromUserInput(text);
+    if (url.isValid()) {
+        if (m_linkUrlEdit->text().isEmpty()) {
+            m_linkUrlEdit->setText(text);
+        }
+    } else if (m_linkTextEdit->text().isEmpty()) {
+        m_linkTextEdit->setText(text);
+    }
+}
+
+QString VInsertLinkDialog::getLinkText() const
+{
+    return m_linkTextEdit->getEvaluatedText();
+}
+
+QString VInsertLinkDialog::getLinkUrl() const
+{
+    return m_linkUrlEdit->text();
+}

src/dialog/vinsertlinkdialog.h

@@ -0,0 +1,46 @@
+#ifndef VINSERTLINKDIALOG_H
+#define VINSERTLINKDIALOG_H
+
+#include <QDialog>
+#include <QString>
+
+class VLineEdit;
+class QLineEdit;
+class QDialogButtonBox;
+
+class VInsertLinkDialog : public QDialog
+{
+    Q_OBJECT
+public:
+    VInsertLinkDialog(const QString &p_title,
+                      const QString &p_text,
+                      const QString &p_info,
+                      const QString &p_linkText,
+                      const QString &p_linkUrl,
+                      QWidget *p_parent = nullptr);
+
+    QString getLinkText() const;
+
+    QString getLinkUrl() const;
+
+private slots:
+    void handleInputChanged();
+
+private:
+    void setupUI(const QString &p_title,
+                 const QString &p_text,
+                 const QString &p_info,
+                 const QString &p_linkText,
+                 const QString &p_linkUrl);
+
+    // Infer link text/url from clipboard only when text and url are both empty.
+    void fetchLinkFromClipboard();
+
+    VLineEdit *m_linkTextEdit;
+
+    QLineEdit *m_linkUrlEdit;
+
+    QDialogButtonBox *m_btnBox;
+};
+
+#endif // VINSERTLINKDIALOG_H

src/dialog/vnewdirdialog.cpp

@@ -2,6 +2,8 @@
 #include "vnewdirdialog.h"
 #include "vdirectory.h"
 #include "vconfigmanager.h"
+#include "vlineedit.h"
+#include "utils/vutils.h"
 
 extern VConfigManager *g_config;
 
@@ -15,7 +17,7 @@ VNewDirDialog::VNewDirDialog(const QString &title,
 {
     setupUI();
 
-    connect(nameEdit, &QLineEdit::textChanged, this, &VNewDirDialog::handleInputChanged);
+    connect(m_nameEdit, &QLineEdit::textChanged, this, &VNewDirDialog::handleInputChanged);
 
     handleInputChanged();
 }
@@ -29,9 +31,12 @@ void VNewDirDialog::setupUI()
     }
 
     QLabel *nameLabel = new QLabel(tr("Folder &name:"));
-    nameEdit = new QLineEdit(defaultName);
+    m_nameEdit = new VLineEdit(defaultName);
-    nameEdit->selectAll();
+    QValidator *validator = new QRegExpValidator(QRegExp(VUtils::c_fileNameRegExp),
-    nameLabel->setBuddy(nameEdit);
+                                                 m_nameEdit);
+    m_nameEdit->setValidator(validator);
+    m_nameEdit->selectAll();
+    nameLabel->setBuddy(m_nameEdit);
 
     m_warnLabel = new QLabel();
     m_warnLabel->setWordWrap(true);
@@ -44,10 +49,10 @@ void VNewDirDialog::setupUI()
 
     QHBoxLayout *topLayout = new QHBoxLayout();
     topLayout->addWidget(nameLabel);
-    topLayout->addWidget(nameEdit);
+    topLayout->addWidget(m_nameEdit);
 
     QPushButton *okBtn = m_btnBox->button(QDialogButtonBox::Ok);
-    nameEdit->setMinimumWidth(okBtn->sizeHint().width() * 3);
+    m_nameEdit->setMinimumWidth(okBtn->sizeHint().width() * 3);
 
     QVBoxLayout *mainLayout = new QVBoxLayout();
     if (infoLabel) {
@@ -64,18 +69,34 @@ void VNewDirDialog::setupUI()
 void VNewDirDialog::handleInputChanged()
 {
     bool showWarnLabel = false;
-    QString name = nameEdit->text();
+    QString name = m_nameEdit->getEvaluatedText();
     bool nameOk = !name.isEmpty();
     if (nameOk) {
         // Check if the name conflicts with existing directory name.
         // Case-insensitive when creating folder.
+        QString warnText;
         if (m_directory->findSubDirectory(name, false)) {
             nameOk = false;
-            showWarnLabel = true;
+            warnText = tr("<span style=\"%1\">WARNING</span>: "
-            QString nameConflictText = tr("<span style=\"%1\">WARNING</span>: Name (case-insensitive) already exists. "
+                          "Name (case-insensitive) <span style=\"%2\">%3</span> already exists. "
                           "Please choose another name.")
-                                          .arg(g_config->c_warningTextStyle);
+                         .arg(g_config->c_warningTextStyle)
-            m_warnLabel->setText(nameConflictText);
+                         .arg(g_config->c_dataTextStyle)
+                         .arg(name);
+        } else if (!VUtils::checkFileNameLegal(name)) {
+            // Check if evaluated name contains illegal characters.
+            nameOk = false;
+            warnText = tr("<span style=\"%1\">WARNING</span>: "
+                          "Name <span style=\"%2\">%3</span> contains illegal characters "
+                          "(after magic word evaluation).")
+                         .arg(g_config->c_warningTextStyle)
+                         .arg(g_config->c_dataTextStyle)
+                         .arg(name);
+        }
+
+        if (!nameOk) {
+            showWarnLabel = true;
+            m_warnLabel->setText(warnText);
         }
     }
 
@@ -87,5 +108,5 @@ void VNewDirDialog::handleInputChanged()
 
 QString VNewDirDialog::getNameInput() const
 {
-    return nameEdit->text();
+    return m_nameEdit->getEvaluatedText();
 }

src/dialog/vnewdirdialog.h

@@ -4,7 +4,7 @@
 #include <QDialog>
 
 class QLabel;
-class QLineEdit;
+class VLineEdit;
 class QDialogButtonBox;
 class QString;
 class VDirectory;
@@ -27,7 +27,7 @@ private slots:
 private:
     void setupUI();
 
-    QLineEdit *nameEdit;
+    VLineEdit *m_nameEdit;
     QDialogButtonBox *m_btnBox;
 
     QLabel *m_warnLabel;

src/dialog/vnewfiledialog.cpp

@@ -2,6 +2,8 @@
 #include "vnewfiledialog.h"
 #include "vconfigmanager.h"
 #include "vdirectory.h"
+#include "vlineedit.h"
+#include "utils/vutils.h"
 
 extern VConfigManager *g_config;
 
@@ -13,7 +15,7 @@ VNewFileDialog::VNewFileDialog(const QString &title, const QString &info,
 {
     setupUI();
 
-    connect(nameEdit, &QLineEdit::textChanged, this, &VNewFileDialog::handleInputChanged);
+    connect(m_nameEdit, &VLineEdit::textChanged, this, &VNewFileDialog::handleInputChanged);
 
     handleInputChanged();
 }
@@ -27,10 +29,13 @@ void VNewFileDialog::setupUI()
 
     // Name.
     QLabel *nameLabel = new QLabel(tr("Note &name:"));
-    nameEdit = new QLineEdit(defaultName);
+    m_nameEdit = new VLineEdit(defaultName);
+    QValidator *validator = new QRegExpValidator(QRegExp(VUtils::c_fileNameRegExp),
+                                                 m_nameEdit);
+    m_nameEdit->setValidator(validator);
     int dotIndex = defaultName.lastIndexOf('.');
-    nameEdit->setSelection(0, (dotIndex == -1) ? defaultName.size() : dotIndex);
+    m_nameEdit->setSelection(0, (dotIndex == -1) ? defaultName.size() : dotIndex);
-    nameLabel->setBuddy(nameEdit);
+    nameLabel->setBuddy(m_nameEdit);
 
     // InsertTitle.
     m_insertTitleCB = new QCheckBox(tr("Insert note name as title (for Markdown only)"));
@@ -42,10 +47,10 @@ void VNewFileDialog::setupUI()
             });
 
     QFormLayout *topLayout = new QFormLayout();
-    topLayout->addRow(nameLabel, nameEdit);
+    topLayout->addRow(nameLabel, m_nameEdit);
     topLayout->addWidget(m_insertTitleCB);
 
-    nameEdit->setMinimumWidth(m_insertTitleCB->sizeHint().width());
+    m_nameEdit->setMinimumWidth(m_insertTitleCB->sizeHint().width());
 
     m_warnLabel = new QLabel();
     m_warnLabel->setWordWrap(true);
@@ -73,18 +78,34 @@ void VNewFileDialog::setupUI()
 void VNewFileDialog::handleInputChanged()
 {
     bool showWarnLabel = false;
-    QString name = nameEdit->text();
+    QString name = m_nameEdit->getEvaluatedText();
     bool nameOk = !name.isEmpty();
     if (nameOk) {
         // Check if the name conflicts with existing note name.
         // Case-insensitive when creating note.
+        QString warnText;
         if (m_directory->findFile(name, false)) {
             nameOk = false;
-            showWarnLabel = true;
+            warnText = tr("<span style=\"%1\">WARNING</span>: "
-            QString nameConflictText = tr("<span style=\"%1\">WARNING</span>: Name (case-insensitive) already exists. "
+                          "Name (case-insensitive) <span style=\"%2\">%3</span> already exists. "
                           "Please choose another name.")
-                                          .arg(g_config->c_warningTextStyle);
+                         .arg(g_config->c_warningTextStyle)
-            m_warnLabel->setText(nameConflictText);
+                         .arg(g_config->c_dataTextStyle)
+                         .arg(name);
+        } else if (!VUtils::checkFileNameLegal(name)) {
+            // Check if evaluated name contains illegal characters.
+            nameOk = false;
+            warnText = tr("<span style=\"%1\">WARNING</span>: "
+                          "Name <span style=\"%2\">%3</span> contains illegal characters "
+                          "(after magic word evaluation).")
+                         .arg(g_config->c_warningTextStyle)
+                         .arg(g_config->c_dataTextStyle)
+                         .arg(name);
+        }
+
+        if (!nameOk) {
+            showWarnLabel = true;
+            m_warnLabel->setText(warnText);
         }
     }
 
@@ -96,7 +117,7 @@ void VNewFileDialog::handleInputChanged()
 
 QString VNewFileDialog::getNameInput() const
 {
-    return nameEdit->text();
+    return m_nameEdit->getEvaluatedText();
 }
 
 bool VNewFileDialog::getInsertTitleInput() const

src/dialog/vnewfiledialog.h

@@ -4,7 +4,7 @@
 #include <QDialog>
 
 class QLabel;
-class QLineEdit;
+class VLineEdit;
 class QDialogButtonBox;
 class QCheckBox;
 class VDirectory;
@@ -27,7 +27,7 @@ private slots:
 private:
     void setupUI();
 
-    QLineEdit *nameEdit;
+    VLineEdit *m_nameEdit;
     QCheckBox *m_insertTitleCB;
 
     QPushButton *okBtn;

src/dialog/vnewnotebookdialog.cpp

@@ -4,6 +4,7 @@
 #include "vconfigmanager.h"
 #include "utils/vutils.h"
 #include "vnotebook.h"
+#include "vlineedit.h"
 
 extern VConfigManager *g_config;
 
@@ -18,7 +19,7 @@ VNewNotebookDialog::VNewNotebookDialog(const QString &title, const QString &info
 {
     setupUI(title, info);
 
-    connect(nameEdit, &QLineEdit::textChanged, this, &VNewNotebookDialog::handleInputChanged);
+    connect(m_nameEdit, &QLineEdit::textChanged, this, &VNewNotebookDialog::handleInputChanged);
     connect(pathEdit, &QLineEdit::textChanged, this, &VNewNotebookDialog::handleInputChanged);
     connect(browseBtn, &QPushButton::clicked, this, &VNewNotebookDialog::handleBrowseBtnClicked);
 
@@ -34,8 +35,11 @@ void VNewNotebookDialog::setupUI(const QString &p_title, const QString &p_info)
     }
 
     QLabel *nameLabel = new QLabel(tr("Notebook &name:"));
-    nameEdit = new QLineEdit(defaultName);
+    m_nameEdit = new VLineEdit(defaultName);
-    nameLabel->setBuddy(nameEdit);
+    QValidator *validator = new QRegExpValidator(QRegExp(VUtils::c_fileNameRegExp),
+                                                 m_nameEdit);
+    m_nameEdit->setValidator(validator);
+    nameLabel->setBuddy(m_nameEdit);
 
     QLabel *pathLabel = new QLabel(tr("Notebook &root folder:"));
     pathEdit = new QLineEdit(defaultPath);
@@ -50,7 +54,7 @@ void VNewNotebookDialog::setupUI(const QString &p_title, const QString &p_info)
     m_imageFolderEdit->setToolTip(tr("Set the name of the folder to hold images of all the notes in this notebook "
                                      "(empty to use global configuration)"));
     imageFolderLabel->setToolTip(m_imageFolderEdit->toolTip());
-    QValidator *validator = new QRegExpValidator(QRegExp(VUtils::c_fileNameRegExp), m_imageFolderEdit);
+    validator = new QRegExpValidator(QRegExp(VUtils::c_fileNameRegExp), m_imageFolderEdit);
     m_imageFolderEdit->setValidator(validator);
 
     QLabel *attachmentFolderLabel = new QLabel(tr("&Attachment folder:"));
@@ -66,7 +70,7 @@ void VNewNotebookDialog::setupUI(const QString &p_title, const QString &p_info)
 
     QGridLayout *topLayout = new QGridLayout();
     topLayout->addWidget(nameLabel, 0, 0);
-    topLayout->addWidget(nameEdit, 0, 1, 1, 2);
+    topLayout->addWidget(m_nameEdit, 0, 1, 1, 2);
     topLayout->addWidget(pathLabel, 1, 0);
     topLayout->addWidget(pathEdit, 1, 1);
     topLayout->addWidget(browseBtn, 1, 2);
@@ -104,7 +108,7 @@ void VNewNotebookDialog::setupUI(const QString &p_title, const QString &p_info)
 
 QString VNewNotebookDialog::getNameInput() const
 {
-    return nameEdit->text();
+    return m_nameEdit->getEvaluatedText();
 }
 
 QString VNewNotebookDialog::getPathInput() const
@@ -142,7 +146,8 @@ void VNewNotebookDialog::handleBrowseBtnClicked()
         }
     }
 
-    QString dirPath = QFileDialog::getExistingDirectory(this, tr("Select Root Folder Of The Notebook"),
+    QString dirPath = QFileDialog::getExistingDirectory(this,
+                                                        tr("Select Root Folder Of The Notebook"),
                                                         defaultPath,
                                                         QFileDialog::ShowDirsOnly | QFileDialog::DontResolveSymlinks);
 
@@ -160,7 +165,7 @@ bool VNewNotebookDialog::isImportExistingNotebook() const
 
 void VNewNotebookDialog::showEvent(QShowEvent *event)
 {
-    nameEdit->setFocus();
+    m_nameEdit->setFocus();
     QDialog::showEvent(event);
 }
 
@@ -182,7 +187,7 @@ void VNewNotebookDialog::handleInputChanged()
         m_manualPath = true;
     }
 
-    if (nameEdit->isModified()) {
+    if (m_nameEdit->isModified()) {
         m_manualName = true;
     }
 
@@ -247,7 +252,7 @@ void VNewNotebookDialog::handleInputChanged()
         }
     }
 
-    QString name = nameEdit->text();
+    QString name = m_nameEdit->getEvaluatedText();
     bool nameOk = !name.isEmpty();
     if (pathOk && nameOk) {
         // Check if the name conflicts with existing notebook name.
@@ -259,13 +264,29 @@ void VNewNotebookDialog::handleInputChanged()
             }
         }
 
+        QString warnText;
         if (idx < m_notebooks.size()) {
             nameOk = false;
-            showWarnLabel = true;
+            warnText = tr("<span style=\"%1\">WARNING</span>: "
-            QString nameConflictText = tr("<span style=\"%1\">WARNING</span>: Name (case-insensitive) already exists. "
+                          "Name (case-insensitive) <span style=\"%2\">%3</span> already exists. "
                           "Please choose another name.")
-                                          .arg(g_config->c_warningTextStyle);
+                         .arg(g_config->c_warningTextStyle)
-            m_warnLabel->setText(nameConflictText);
+                         .arg(g_config->c_dataTextStyle)
+                         .arg(name);
+        } else if (!VUtils::checkFileNameLegal(name)) {
+            // Check if evaluated name contains illegal characters.
+            nameOk = false;
+            warnText = tr("<span style=\"%1\">WARNING</span>: "
+                          "Name <span style=\"%2\">%3</span> contains illegal characters "
+                          "(after magic word evaluation).")
+                         .arg(g_config->c_warningTextStyle)
+                         .arg(g_config->c_dataTextStyle)
+                         .arg(name);
+        }
+
+        if (!nameOk) {
+            showWarnLabel = true;
+            m_warnLabel->setText(warnText);
         }
     }
 
@@ -280,6 +301,8 @@ void VNewNotebookDialog::handleInputChanged()
 
 bool VNewNotebookDialog::autoComplete()
 {
+    QString nameText = m_nameEdit->getEvaluatedText();
+
     if (m_manualPath) {
         if (m_manualName) {
             return false;
@@ -289,8 +312,8 @@ bool VNewNotebookDialog::autoComplete()
         QString pathText = pathEdit->text();
         if (!pathText.isEmpty()) {
             QString autoName = VUtils::directoryNameFromPath(pathText);
-            if (autoName != nameEdit->text()) {
+            if (autoName != nameText) {
-                nameEdit->setText(autoName);
+                m_nameEdit->setText(autoName);
                 return true;
             }
         }
@@ -306,7 +329,6 @@ bool VNewNotebookDialog::autoComplete()
     }
 
     bool ret = false;
-    QString nameText = nameEdit->text();
     if (nameText.isEmpty()) {
         if (m_manualName) {
             return false;
@@ -314,8 +336,8 @@ bool VNewNotebookDialog::autoComplete()
 
         // Get a folder name under vnoteFolder and set it as the name of the notebook.
         QString name = "vnotebook";
-        name = VUtils::getFileNameWithSequence(vnoteFolder, name);
+        name = VUtils::getDirNameWithSequence(vnoteFolder, name);
-        nameEdit->setText(name);
+        m_nameEdit->setText(name);
         ret = true;
     } else {
         // Use the name as the folder name under vnoteFolder.

src/dialog/vnewnotebookdialog.h

@@ -6,6 +6,7 @@
 
 class QLabel;
 class QLineEdit;
+class VLineEdit;
 class QPushButton;
 class QDialogButtonBox;
 class VNotebook;
@@ -52,7 +53,7 @@ private:
     // Returns true if name or path is modified.
     bool autoComplete();
 
-    QLineEdit *nameEdit;
+    VLineEdit *m_nameEdit;
     QLineEdit *pathEdit;
     QPushButton *browseBtn;
     QLabel *m_warnLabel;

src/dialog/vnotebookinfodialog.cpp

@@ -3,6 +3,7 @@
 #include "vnotebook.h"
 #include "utils/vutils.h"
 #include "vconfigmanager.h"
+#include "vlineedit.h"
 
 extern VConfigManager *g_config;
 
@@ -29,7 +30,10 @@ void VNotebookInfoDialog::setupUI(const QString &p_title, const QString &p_info)
         infoLabel = new QLabel(p_info);
     }
 
-    m_nameEdit = new QLineEdit(m_notebook->getName());
+    m_nameEdit = new VLineEdit(m_notebook->getName());
+    QValidator *validator = new QRegExpValidator(QRegExp(VUtils::c_fileNameRegExp),
+                                                 m_nameEdit);
+    m_nameEdit->setValidator(validator);
     m_nameEdit->selectAll();
 
     m_pathEdit = new QLineEdit(m_notebook->getPath());
@@ -41,7 +45,7 @@ void VNotebookInfoDialog::setupUI(const QString &p_title, const QString &p_info)
                                             .arg(g_config->getImageFolder()));
     m_imageFolderEdit->setToolTip(tr("Set the name of the folder to hold images of all the notes in this notebook "
                                      "(empty to use global configuration)"));
-    QValidator *validator = new QRegExpValidator(QRegExp(VUtils::c_fileNameRegExp), m_imageFolderEdit);
+    validator = new QRegExpValidator(QRegExp(VUtils::c_fileNameRegExp), m_imageFolderEdit);
     m_imageFolderEdit->setValidator(validator);
 
     // Attachment folder.
@@ -98,7 +102,7 @@ void VNotebookInfoDialog::setupUI(const QString &p_title, const QString &p_info)
 
 void VNotebookInfoDialog::handleInputChanged()
 {
-    QString name = m_nameEdit->text();
+    QString name = m_nameEdit->getEvaluatedText();
     bool nameOk = !name.isEmpty();
     bool showWarnLabel = false;
 
@@ -112,13 +116,29 @@ void VNotebookInfoDialog::handleInputChanged()
             }
         }
 
+        QString warnText;
         if (idx < m_notebooks.size() && m_notebooks[idx] != m_notebook) {
             nameOk = false;
-            showWarnLabel = true;
+            warnText = tr("<span style=\"%1\">WARNING</span>: "
-            QString nameConflictText = tr("<span style=\"%1\">WARNING</span>: Name (case-insensitive) already exists. "
+                          "Name (case-insensitive) <span style=\"%2\">%3</span> already exists. "
                           "Please choose another name.")
-                                          .arg(g_config->c_warningTextStyle);
+                         .arg(g_config->c_warningTextStyle)
-            m_warnLabel->setText(nameConflictText);
+                         .arg(g_config->c_dataTextStyle)
+                         .arg(name);
+        } else if (!VUtils::checkFileNameLegal(name)) {
+            // Check if evaluated name contains illegal characters.
+            nameOk = false;
+            warnText = tr("<span style=\"%1\">WARNING</span>: "
+                          "Name <span style=\"%2\">%3</span> contains illegal characters "
+                          "(after magic word evaluation).")
+                         .arg(g_config->c_warningTextStyle)
+                         .arg(g_config->c_dataTextStyle)
+                         .arg(name);
+        }
+
+        if (!nameOk) {
+            showWarnLabel = true;
+            m_warnLabel->setText(warnText);
         }
     }
 
@@ -130,7 +150,7 @@ void VNotebookInfoDialog::handleInputChanged()
 
 QString VNotebookInfoDialog::getName() const
 {
-    return m_nameEdit->text();
+    return m_nameEdit->getEvaluatedText();
 }
 
 QString VNotebookInfoDialog::getImageFolder() const

src/dialog/vnotebookinfodialog.h

@@ -6,6 +6,7 @@
 
 class QLabel;
 class QLineEdit;
+class VLineEdit;
 class QDialogButtonBox;
 class QString;
 class VNotebook;
@@ -38,7 +39,7 @@ private:
 
     const VNotebook *m_notebook;
 
-    QLineEdit *m_nameEdit;
+    VLineEdit *m_nameEdit;
     QLineEdit *m_pathEdit;
     QLineEdit *m_imageFolderEdit;
     // Read-only.

src/dialog/vorphanfileinfodialog.cpp

@@ -25,7 +25,6 @@ void VOrphanFileInfoDialog::setupUI()
     QLabel *fileLabel = new QLabel(m_file->fetchPath());
     topLayout->addRow(tr("File:"), fileLabel);
 
-    QLabel *imageFolderLabel = new QLabel(tr("Image folder:"));
     m_imageFolderEdit = new QLineEdit(m_file->getImageFolder());
     m_imageFolderEdit->setPlaceholderText(tr("Use global configuration (%1)")
                                             .arg(g_config->getImageFolderExt()));
@@ -33,9 +32,8 @@ void VOrphanFileInfoDialog::setupUI()
                               "of this file.\nIf absolute path is used, "
                               "VNote will not manage those images."
                               "(empty to use global configuration)");
-    imageFolderLabel->setToolTip(imgFolderTip);
     m_imageFolderEdit->setToolTip(imgFolderTip);
-    topLayout->addRow(imageFolderLabel, m_imageFolderEdit);
+    topLayout->addRow(tr("&Image folder:"), m_imageFolderEdit);
 
     // Ok is the default button.
     m_btnBox = new QDialogButtonBox(QDialogButtonBox::Ok | QDialogButtonBox::Cancel);

src/dialog/vsettingsdialog.cpp

@@ -169,9 +169,6 @@ VGeneralTab::VGeneralTab(QWidget *p_parent)
         m_langCombo->addItem(lang.second, lang.first);
     }
 
-    QLabel *langLabel = new QLabel(tr("Language:"), this);
-    langLabel->setToolTip(m_langCombo->toolTip());
-
     // System tray checkbox.
     m_systemTray = new QCheckBox(tr("System tray"), this);
     m_systemTray->setToolTip(tr("Minimized to the system tray after closing VNote"
@@ -181,9 +178,13 @@ VGeneralTab::VGeneralTab(QWidget *p_parent)
     m_systemTray->setEnabled(false);
 #endif
 
+    // Startup pages.
+    QLayout *startupLayout = setupStartupPagesLayout();
+
     QFormLayout *optionLayout = new QFormLayout();
-    optionLayout->addRow(langLabel, m_langCombo);
+    optionLayout->addRow(tr("Language:"), m_langCombo);
     optionLayout->addRow(m_systemTray);
+    optionLayout->addRow(tr("Startup pages:"), startupLayout);
 
     QVBoxLayout *mainLayout = new QVBoxLayout();
     mainLayout->addLayout(optionLayout);
@@ -191,6 +192,60 @@ VGeneralTab::VGeneralTab(QWidget *p_parent)
     setLayout(mainLayout);
 }
 
+QLayout *VGeneralTab::setupStartupPagesLayout()
+{
+    m_startupPageTypeCombo = new QComboBox(this);
+    m_startupPageTypeCombo->setToolTip(tr("Restore tabs or open specific notes on startup"));
+    m_startupPageTypeCombo->addItem(tr("None"), (int)StartupPageType::None);
+    m_startupPageTypeCombo->addItem(tr("Continue where you left off"), (int)StartupPageType::ContinueLeftOff);
+    m_startupPageTypeCombo->addItem(tr("Open specific pages"), (int)StartupPageType::SpecificPages);
+    connect(m_startupPageTypeCombo, static_cast<void(QComboBox::*)(int)>(&QComboBox::activated),
+            this, [this](int p_index) {
+                int type = m_startupPageTypeCombo->itemData(p_index).toInt();
+                bool pagesEditVisible = type == (int)StartupPageType::SpecificPages;
+                m_startupPagesEdit->setVisible(pagesEditVisible);
+                m_startupPagesAddBtn->setVisible(pagesEditVisible);
+            });
+
+    m_startupPagesEdit = new QPlainTextEdit(this);
+    m_startupPagesEdit->setToolTip(tr("Absolute path of the notes to open on startup (one note per line)"));
+
+    m_startupPagesAddBtn = new QPushButton(tr("Browse"), this);
+    m_startupPagesAddBtn->setToolTip(tr("Select files to add as startup pages"));
+    connect(m_startupPagesAddBtn, &QPushButton::clicked,
+            this, [this]() {
+                static QString lastPath = QDir::homePath();
+                QStringList files = QFileDialog::getOpenFileNames(this,
+                                                                  tr("Select Files As Startup Pages"),
+                                                                  lastPath);
+                if (files.isEmpty()) {
+                    return;
+                }
+
+                // Update lastPath
+                lastPath = QFileInfo(files[0]).path();
+
+                m_startupPagesEdit->appendPlainText(files.join("\n"));
+            });
+
+    QHBoxLayout *startupPagesBtnLayout = new QHBoxLayout();
+    startupPagesBtnLayout->addStretch();
+    startupPagesBtnLayout->addWidget(m_startupPagesAddBtn);
+
+    QVBoxLayout *startupPagesLayout = new QVBoxLayout();
+    startupPagesLayout->addWidget(m_startupPagesEdit);
+    startupPagesLayout->addLayout(startupPagesBtnLayout);
+
+    QVBoxLayout *startupLayout = new QVBoxLayout();
+    startupLayout->addWidget(m_startupPageTypeCombo);
+    startupLayout->addLayout(startupPagesLayout);
+
+    m_startupPagesEdit->hide();
+    m_startupPagesAddBtn->hide();
+
+    return startupLayout;
+}
+
 bool VGeneralTab::loadConfiguration()
 {
     if (!loadLanguage()) {
@@ -201,6 +256,10 @@ bool VGeneralTab::loadConfiguration()
         return false;
     }
 
+    if (!loadStartupPageType()) {
+        return false;
+    }
+
     return true;
 }
 
@@ -214,6 +273,10 @@ bool VGeneralTab::saveConfiguration()
         return false;
     }
 
+    if (!saveStartupPageType()) {
+        return false;
+    }
+
     return true;
 }
 
@@ -264,6 +327,42 @@ bool VGeneralTab::saveSystemTray()
     return true;
 }
 
+bool VGeneralTab::loadStartupPageType()
+{
+    StartupPageType type = g_config->getStartupPageType();
+    bool found = false;
+    for (int i = 0; i < m_startupPageTypeCombo->count(); ++i) {
+        if (m_startupPageTypeCombo->itemData(i).toInt() == (int)type) {
+            found = true;
+            m_startupPageTypeCombo->setCurrentIndex(i);
+        }
+    }
+
+    Q_ASSERT(found);
+
+    const QStringList &pages = g_config->getStartupPages();
+    m_startupPagesEdit->setPlainText(pages.join("\n"));
+
+    bool pagesEditVisible = type == StartupPageType::SpecificPages;
+    m_startupPagesEdit->setVisible(pagesEditVisible);
+    m_startupPagesAddBtn->setVisible(pagesEditVisible);
+
+    return true;
+}
+
+bool VGeneralTab::saveStartupPageType()
+{
+    StartupPageType type = (StartupPageType)m_startupPageTypeCombo->currentData().toInt();
+    g_config->setStartupPageType(type);
+
+    if (type == StartupPageType::SpecificPages) {
+        QStringList pages = m_startupPagesEdit->toPlainText().split("\n");
+        g_config->setStartupPages(pages);
+    }
+
+    return true;
+}
+
 VReadEditTab::VReadEditTab(QWidget *p_parent)
     : QWidget(p_parent)
 {
@@ -504,28 +603,34 @@ VMarkdownTab::VMarkdownTab(QWidget *p_parent)
     m_openModeCombo->addItem(tr("Read Mode"), (int)OpenFileMode::Read);
     m_openModeCombo->addItem(tr("Edit Mode"), (int)OpenFileMode::Edit);
 
-    QLabel *openModeLabel = new QLabel(tr("Note open mode:"));
-    openModeLabel->setToolTip(m_openModeCombo->toolTip());
-
     // Heading sequence.
-    m_headingSequence = new QCheckBox(tr("Heading sequence"));
+    m_headingSequenceTypeCombo = new QComboBox();
-    m_headingSequence->setToolTip(tr("Enable auto sequence for all headings (in the form like 1.2.3.4.)"));
+    m_headingSequenceTypeCombo->setToolTip(tr("Enable auto sequence for all headings (in the form like 1.2.3.4.)"));
-    m_headingSequenceCombo = new QComboBox();
+    m_headingSequenceTypeCombo->addItem(tr("Disabled"), (int)HeadingSequenceType::Disabled);
-    m_headingSequenceCombo->setToolTip(tr("Base level to start heading sequence"));
+    m_headingSequenceTypeCombo->addItem(tr("Enabled"), (int)HeadingSequenceType::Enabled);
-    m_headingSequenceCombo->addItem(tr("1"), 1);
+    m_headingSequenceTypeCombo->addItem(tr("Enabled for notes only"), (int)HeadingSequenceType::EnabledNoteOnly);
-    m_headingSequenceCombo->addItem(tr("2"), 2);
+
-    m_headingSequenceCombo->addItem(tr("3"), 3);
+    m_headingSequenceLevelCombo = new QComboBox();
-    m_headingSequenceCombo->addItem(tr("4"), 4);
+    m_headingSequenceLevelCombo->setToolTip(tr("Base level to start heading sequence"));
-    m_headingSequenceCombo->addItem(tr("5"), 5);
+    m_headingSequenceLevelCombo->addItem(tr("1"), 1);
-    m_headingSequenceCombo->addItem(tr("6"), 6);
+    m_headingSequenceLevelCombo->addItem(tr("2"), 2);
-    m_headingSequenceCombo->setEnabled(false);
+    m_headingSequenceLevelCombo->addItem(tr("3"), 3);
-    connect(m_headingSequence, &QCheckBox::stateChanged,
+    m_headingSequenceLevelCombo->addItem(tr("4"), 4);
-            this, [this](int p_state){
+    m_headingSequenceLevelCombo->addItem(tr("5"), 5);
-                this->m_headingSequenceCombo->setEnabled(p_state == Qt::Checked);
+    m_headingSequenceLevelCombo->addItem(tr("6"), 6);
+    m_headingSequenceLevelCombo->setEnabled(false);
+
+    connect(m_headingSequenceTypeCombo, static_cast<void(QComboBox::*)(int)>(&QComboBox::activated),
+            this, [this](int p_index){
+                if (p_index > -1) {
+                    HeadingSequenceType type = (HeadingSequenceType)m_headingSequenceTypeCombo->itemData(p_index).toInt();
+                    m_headingSequenceLevelCombo->setEnabled(type != HeadingSequenceType::Disabled);
+                }
             });
+
     QHBoxLayout *headingSequenceLayout = new QHBoxLayout();
-    headingSequenceLayout->addWidget(m_headingSequence);
+    headingSequenceLayout->addWidget(m_headingSequenceTypeCombo);
-    headingSequenceLayout->addWidget(m_headingSequenceCombo);
+    headingSequenceLayout->addWidget(m_headingSequenceLevelCombo);
 
     // Web Zoom Factor.
     m_customWebZoom = new QCheckBox(tr("Custom Web zoom factor"), this);
@@ -553,8 +658,8 @@ VMarkdownTab::VMarkdownTab(QWidget *p_parent)
     colorColumnLabel->setToolTip(m_colorColumnEdit->toolTip());
 
     QFormLayout *mainLayout = new QFormLayout();
-    mainLayout->addRow(openModeLabel, m_openModeCombo);
+    mainLayout->addRow(tr("Note open mode:"), m_openModeCombo);
-    mainLayout->addRow(headingSequenceLayout);
+    mainLayout->addRow(tr("Heading sequence:"), headingSequenceLayout);
     mainLayout->addRow(zoomFactorLayout);
     mainLayout->addRow(colorColumnLabel, m_colorColumnEdit);
 
@@ -628,21 +733,28 @@ bool VMarkdownTab::saveOpenMode()
 
 bool VMarkdownTab::loadHeadingSequence()
 {
-    bool enabled = g_config->getEnableHeadingSequence();
+    HeadingSequenceType type = g_config->getHeadingSequenceType();
     int level = g_config->getHeadingSequenceBaseLevel();
     if (level < 1 || level > 6) {
         level = 1;
     }
 
-    m_headingSequence->setChecked(enabled);
+    int idx = m_headingSequenceTypeCombo->findData((int)type);
-    m_headingSequenceCombo->setCurrentIndex(level - 1);
+    Q_ASSERT(idx > -1);
+    m_headingSequenceTypeCombo->setCurrentIndex(idx);
+    m_headingSequenceLevelCombo->setCurrentIndex(level - 1);
+    m_headingSequenceLevelCombo->setEnabled(type != HeadingSequenceType::Disabled);
+
     return true;
 }
 
 bool VMarkdownTab::saveHeadingSequence()
 {
-    g_config->setEnableHeadingSequence(m_headingSequence->isChecked());
+    QVariant typeData = m_headingSequenceTypeCombo->currentData();
-    g_config->setHeadingSequenceBaseLevel(m_headingSequenceCombo->currentData().toInt());
+    Q_ASSERT(typeData.isValid());
+    g_config->setHeadingSequenceType((HeadingSequenceType)typeData.toInt());
+    g_config->setHeadingSequenceBaseLevel(m_headingSequenceLevelCombo->currentData().toInt());
+
     return true;
 }
 

src/dialog/vsettingsdialog.h

@@ -13,6 +13,8 @@ class QCheckBox;
 class QLineEdit;
 class QStackedLayout;
 class QListWidget;
+class QPlainTextEdit;
+class QVBoxLayout;
 
 class VGeneralTab : public QWidget
 {
@@ -23,18 +25,32 @@ public:
     bool saveConfiguration();
 
 private:
+    QLayout *setupStartupPagesLayout();
+
     bool loadLanguage();
     bool saveLanguage();
 
     bool loadSystemTray();
     bool saveSystemTray();
 
+    bool loadStartupPageType();
+    bool saveStartupPageType();
+
     // Language
     QComboBox *m_langCombo;
 
     // System tray
     QCheckBox *m_systemTray;
 
+    // Startup page type.
+    QComboBox *m_startupPageTypeCombo;
+
+    // Startup pages.
+    QPlainTextEdit *m_startupPagesEdit;
+
+    // Startup pages add files button.
+    QPushButton *m_startupPagesAddBtn;
+
     static const QVector<QString> c_availableLangs;
 };
 
@@ -101,8 +117,8 @@ public:
     QComboBox *m_openModeCombo;
 
     // Whether enable heading sequence.
-    QCheckBox *m_headingSequence;
+    QComboBox *m_headingSequenceTypeCombo;
-    QComboBox *m_headingSequenceCombo;
+    QComboBox *m_headingSequenceLevelCombo;
 
     // Web zoom factor.
     QCheckBox *m_customWebZoom;

src/main.cpp

@@ -13,7 +13,6 @@
 #include "vconfigmanager.h"
 
 VConfigManager *g_config;
-VMainWindow *g_mainWin;
 
 #if defined(QT_NO_DEBUG)
 QFile g_logFile;
@@ -116,22 +115,10 @@ int main(int argc, char *argv[])
     QApplication app(argc, argv);
 
     // The file path passed via command line arguments.
-    QStringList filePaths;
+    QStringList filePaths = VUtils::filterFilePathsToOpen(app.arguments().mid(1));
-    QStringList args = app.arguments();
-    for (int i = 1; i < args.size(); ++i) {
-        if (QFileInfo::exists(args[i])) {
-            QString filePath = args[i];
-            QFileInfo fi(filePath);
-            if (fi.isFile()) {
-                // Need to use absolute path here since VNote may be launched
-                // in different working directory.
-                filePath = QDir::cleanPath(fi.absoluteFilePath());
-                filePaths.append(filePath);
-            }
-        }
-    }
 
-    qDebug() << "command line arguments" << args;
+    qDebug() << "command line arguments" << app.arguments();
+    qDebug() << "files to open from arguments" << filePaths;
 
     if (!canRun) {
         // Ask another instance to open files passed in.
@@ -169,7 +156,6 @@ int main(int argc, char *argv[])
     }
 
     VMainWindow w(&guard);
-    g_mainWin = &w;
     QString style = VUtils::readFileFromDisk(":/resources/vnote.qss");
     if (!style.isEmpty()) {
         VUtils::processStyle(style, w.getPalette());
@@ -178,7 +164,11 @@ int main(int argc, char *argv[])
 
     w.show();
 
-    w.openExternalFiles(filePaths);
+    w.openStartupPages();
+
+    w.openFiles(filePaths);
+
+    w.promptNewNotebookIfEmpty();
 
     return app.exec();
 }

src/resources/docs/shortcuts_en.md

@@ -49,13 +49,17 @@ Save current changes and exit edit mode.
 
 #### Text Editing
 - `Ctrl+B`  
-Insert bold. Press `Ctrl+B` again to exit. Current selected text will be changed to bold if exist.
+Insert bold. Press `Ctrl+B` again to exit. Current selected text will be changed to bold if exists.
 - `Ctrl+I`  
-Insert italic. Press `Ctrl+I` again to exit. Current selected text will be changed to italic if exist.
+Insert italic. Press `Ctrl+I` again to exit. Current selected text will be changed to italic if exists.
 - `Ctrl+D`  
-Insert strikethrought. Press `Ctrl+D` again to exit. Current selected text will be changed to strikethrough if exist.
+Insert strikethrought. Press `Ctrl+D` again to exit. Current selected text will be changed to strikethrough if exists.
 - `Ctrl+O`  
-Insert inline code. Press `Ctrl+O` again to exit. Current selected text will be changed to inline code if exist.
+Insert inline code. Press `Ctrl+O` again to exit. Current selected text will be changed to inline code if exists.
+- `Ctrl+M`  
+Insert fenced code block. Press `Ctrl+M` again to exit. Current selected text will be wrapped into a code block if exists.
+- `Ctrl+L`  
+Insert link.
 - `Ctrl+H`  
 Backspace. Delete a character backward.
 - `Ctrl+W`  
@@ -63,7 +67,7 @@ Delete all the characters from current cursor to the first space backward.
 - `Ctrl+U`  
 Delete all the characters from current cursor to the beginning of current line.
 - `Ctrl+<Num>`  
-Insert title at level `<Num>`. `<Num>` should be 1 to 6. Current selected text will be changed to title if exist.
+Insert title at level `<Num>`. `<Num>` should be 1 to 6. Current selected text will be changed to title if exists.
 - `Tab`/`Shift+Tab`  
 Increase or decrease the indentation. If any text is selected, the indentation will operate on all these selected lines.
 - `Shift+Enter`  
@@ -80,42 +84,102 @@ Expand the selection to the beginning or end of current line.
 Expand the selection to the beginning or end of current note.
 
 ## Custom Shortcuts
-VNote supports customing some standard shortcuts, though it is not recommended. VNote stores shortcuts' configuration information in the `[shortcuts]` section of user configuration file `vnote.ini`.
+VNote supports customing some standard shortcuts, though it is not recommended. VNote stores shortcuts' configuration information in the `[shortcuts]` and `[captain_mode_shortcuts]` sections of user configuration file `vnote.ini`.
 
 For example, the default configruation may look like this:
 
 ```ini
 [shortcuts]
-1\operation=NewNote
+; Define shortcuts here, with each item in the form "operation=keysequence".
-1\keysequence=Ctrl+N
+; Leave keysequence empty to disable the shortcut of an operation.
-2\operation=SaveNote
+; Custom shortcuts may conflict with some key bindings in edit mode or Vim mode.
-2\keysequence=Ctrl+S
+; Ctrl+Q is reserved for quitting VNote.
-3\operation=SaveAndRead
+
-3\keysequence=Ctrl+T
+; Leader key of Captain mode
-4\operation=EditNote
+CaptainMode=Ctrl+E
-4\keysequence=Ctrl+W
+; Create a note in current folder
-5\operation=CloseNote
+NewNote=Ctrl+Alt+N
-5\keysequence=
+; Save current note
-6\operation=Find
+SaveNote=Ctrl+S
-6\keysequence=Ctrl+F
+; Save changes and enter read mode
-7\operation=FindNext
+SaveAndRead=Ctrl+T
-7\keysequence=F3
+; Edit current note
-8\operation=FindPrevious
+EditNote=Ctrl+W
-8\keysequence=Shift+F3
+; Close current note
-size=8
+CloseNote=
+; Open file/replace dialog
+Find=Ctrl+F
+; Find next occurence
+FindNext=F3
+; Find previous occurence
+FindPrevious=Shift+F3
+
+[captain_mode_shortcuts]
+; Define shortcuts in Captain mode here.
+; There shortcuts are the sub-sequence after the CaptainMode key sequence
+; in [shortcuts].
+
+; Enter Navigation mode
+NavigationMode=W
+; Show attachment list of current note
+AttachmentList=A
+; Locate to the folder of current note
+LocateCurrentFile=D
+; Toggle Expand mode
+ExpandMode=E
+; Alternate one/two panels view
+OnePanelView=P
+; Discard changes and enter read mode
+DiscardAndRead=Q
+; Toggle Tools dock widget
+ToolsDock=T
+; Close current note
+CloseNote=X
+; Show shortcuts help document
+ShortcutsHelp=?
+; Flush the log file
+FlushLogFile=";"
+; Show opened files list
+OpenedFileList=F
+; Activate the ith tab
+ActivateTab1=1
+ActivateTab2=2
+ActivateTab3=3
+ActivateTab4=4
+ActivateTab5=5
+ActivateTab6=6
+ActivateTab7=7
+ActivateTab8=8
+ActivateTab9=9
+; Alternate between current and last tab
+AlternateTab=0
+; Activate next tab
+ActivateNextTab=J
+; Activate previous tab
+ActivatePreviousTab=K
+; Activate the window split on the left
+ActivateSplitLeft=H
+; Activate the window split on the right
+ActivateSplitRight=L
+; Move current tab one split left
+MoveTabSplitLeft=Shift+H
+; Move current tab one split right
+MoveTabSplitRight=Shift+L
+; Create a vertical split
+VerticalSplit=V
+; Remove current split
+RemoveSplit=R
 ```
 
-`size=8` tells VNote that there are 8 shotcuts defined here, with each beginning with the number sequence. You could change the `keysequence` value to change the default key sequence of a specified operation. Leave the `keysequence` empty (`keysequence=`) to disable shortcut for that operation.
+Each item is in the form `operation=keysequence`, with `keysequence` empty to disable shortcuts for that operation.
 
-Pay attention that `Ctrl+E` is reserved for *Captain Mode* and `Ctrl+Q` is reserved for quitting VNote.
+Pay attention that `Ctrl+Q` is reserved for quitting VNote.
 
 # Captain Mode
 To efficiently utilize the shortcuts, VNote supports the **Captain Mode**.
 
 Press the leader key `Ctrl+E`, then VNote will enter the Captain Mode, within which VNote supports more efficient shortcuts.
 
-By the way, in this mode, `Ctrl+W` and `W` is equivalent, thus pressing `Ctrl+E+W` equals to `Ctrl+E W`.
-
 - `E`   
 Toggle expanding the edit area.
 - `P`   

src/resources/docs/shortcuts_zh.md

@@ -56,6 +56,10 @@
 插入删除线；再次按`Ctrl+D`退出。如果已经选择文本，则将当前选择文本改为删除线。
 - `Ctrl+O`  
 插入行内代码；再次按`Ctrl+O`退出。如果已经选择文本，则将当前选择文本改为行内代码。
+- `Ctrl+M`  
+插入代码块；再次按`Ctrl+M`退出。如果已经选择文本，则将当前选择文本嵌入到代码块中。
+- `Ctrl+L`  
+插入链接。
 - `Ctrl+H`  
 退格键，向前删除一个字符。
 - `Ctrl+W`  
@@ -80,43 +84,103 @@
 扩展选定到笔记开始或结尾处。
 
 ## 自定义快捷键
-VNote支持自定义部分标准快捷键（但并不建议这么做）。VNote将快捷键信息保存在用户配置文件`vnote.ini`中的`[shortcuts]`小节。
+VNote支持自定义部分标准快捷键（但并不建议这么做）。VNote将快捷键信息保存在用户配置文件`vnote.ini`中的`[shortcuts]`和`[captain_mode_shortcuts]`两个小节。
 
 例如，默认的配置可能是这样子的：
 
 
 ```ini
 [shortcuts]
-1\operation=NewNote
+; Define shortcuts here, with each item in the form "operation=keysequence".
-1\keysequence=Ctrl+N
+; Leave keysequence empty to disable the shortcut of an operation.
-2\operation=SaveNote
+; Custom shortcuts may conflict with some key bindings in edit mode or Vim mode.
-2\keysequence=Ctrl+S
+; Ctrl+Q is reserved for quitting VNote.
-3\operation=SaveAndRead
+
-3\keysequence=Ctrl+T
+; Leader key of Captain mode
-4\operation=EditNote
+CaptainMode=Ctrl+E
-4\keysequence=Ctrl+W
+; Create a note in current folder
-5\operation=CloseNote
+NewNote=Ctrl+Alt+N
-5\keysequence=
+; Save current note
-6\operation=Find
+SaveNote=Ctrl+S
-6\keysequence=Ctrl+F
+; Save changes and enter read mode
-7\operation=FindNext
+SaveAndRead=Ctrl+T
-7\keysequence=F3
+; Edit current note
-8\operation=FindPrevious
+EditNote=Ctrl+W
-8\keysequence=Shift+F3
+; Close current note
-size=8
+CloseNote=
+; Open file/replace dialog
+Find=Ctrl+F
+; Find next occurence
+FindNext=F3
+; Find previous occurence
+FindPrevious=Shift+F3
+
+[captain_mode_shortcuts]
+; Define shortcuts in Captain mode here.
+; There shortcuts are the sub-sequence after the CaptainMode key sequence
+; in [shortcuts].
+
+; Enter Navigation mode
+NavigationMode=W
+; Show attachment list of current note
+AttachmentList=A
+; Locate to the folder of current note
+LocateCurrentFile=D
+; Toggle Expand mode
+ExpandMode=E
+; Alternate one/two panels view
+OnePanelView=P
+; Discard changes and enter read mode
+DiscardAndRead=Q
+; Toggle Tools dock widget
+ToolsDock=T
+; Close current note
+CloseNote=X
+; Show shortcuts help document
+ShortcutsHelp=?
+; Flush the log file
+FlushLogFile=";"
+; Show opened files list
+OpenedFileList=F
+; Activate the ith tab
+ActivateTab1=1
+ActivateTab2=2
+ActivateTab3=3
+ActivateTab4=4
+ActivateTab5=5
+ActivateTab6=6
+ActivateTab7=7
+ActivateTab8=8
+ActivateTab9=9
+; Alternate between current and last tab
+AlternateTab=0
+; Activate next tab
+ActivateNextTab=J
+; Activate previous tab
+ActivatePreviousTab=K
+; Activate the window split on the left
+ActivateSplitLeft=H
+; Activate the window split on the right
+ActivateSplitRight=L
+; Move current tab one split left
+MoveTabSplitLeft=Shift+H
+; Move current tab one split right
+MoveTabSplitRight=Shift+L
+; Create a vertical split
+VerticalSplit=V
+; Remove current split
+RemoveSplit=R
 ```
 
-`size=8` 告诉VNote这里定义了8组快捷键，每组快捷键都以一个数字序号开始。通过改变每组快捷键中`keysequence`的值来改变某个操作的默认快捷键。将`keysequence`设置为空（`keysequence=`）则会禁用该操作的任何快捷键。
+每一项配置的形式为`操作=按键序列`。如果`按键序列`为空，则表示禁用该操作的快捷键。
 
-注意，`Ctrl+E`保留作为*舰长模式*的前导键，`Ctrl+Q`保留为退出VNote。
+注意，`Ctrl+Q`保留为退出VNote。
 
 # 舰长模式
 为了更有效地利用快捷键，VNote支持 **舰长模式**。
 
 按前导键`Ctrl+E`后，VNote会进入舰长模式。在舰长模式中，VNote会支持更多高效的快捷操作。
 
-另外，在该模式中，`Ctrl+W`和`W`是等效的，因此，可以`Ctrl+E+W`来实现`Ctrl+E W`的操作。
-
 - `E`   
 是否扩展编辑区域。
 - `P`   

src/resources/icons/code_block.svg

@@ -0,0 +1,6 @@
+<svg width="512" height="512" xmlns="http://www.w3.org/2000/svg" xmlns:svg="http://www.w3.org/2000/svg">
+ <g>
+  <title>Layer 1</title>
+  <text style="cursor: move;" fill="#000000" stroke-width="0" x="-146.75684" y="248.49038" id="svg_4" font-size="24" font-family="serif" text-anchor="middle" xml:space="preserve" font-weight="bold" transform="matrix(16.72881317138672,0,0,16.72881317138672,2707.567729830742,-3759.186347961426) " stroke="#000000">#</text>
+ </g>
+</svg>

src/resources/icons/compact_mode.svg

@@ -0,0 +1,10 @@
+<svg width="512" height="512" xmlns="http://www.w3.org/2000/svg" xmlns:svg="http://www.w3.org/2000/svg">
+ <!-- Created with SVG-edit - http://svg-edit.googlecode.com/ -->
+ <title>one_panel</title>
+ <g>
+  <title>Layer 1</title>
+  <rect fill="none" stroke="#000000" stroke-width="40" x="58" y="57" width="395" height="395" id="svg_1"/>
+  <line fill="none" stroke="#000000" stroke-width="40" stroke-dasharray="null" stroke-linejoin="null" stroke-linecap="null" x1="193" y1="61" x2="193" y2="455" id="svg_4"/>
+  <line stroke="#000000" transform="rotate(-90 125.49999237060548,220.1999969482422) " id="svg_2" fill="none" stroke-width="40" stroke-dasharray="null" stroke-linejoin="null" stroke-linecap="null" x1="125.49999" y1="169.7" x2="125.49999" y2="270.7"/>
+ </g>
+</svg>

src/resources/icons/heading_sequence.svg

@@ -0,0 +1,7 @@
+<svg width="512" height="512" xmlns="http://www.w3.org/2000/svg" xmlns:svg="http://www.w3.org/2000/svg">
+ <!-- Created with SVG-edit - http://svg-edit.googlecode.com/ -->
+ <g>
+  <title>Layer 2</title>
+  <text stroke="#000000" transform="matrix(11.892995768998892,0,0,12.532065948318316,-399.2455647895517,-874.5950374851516) " xml:space="preserve" text-anchor="middle" font-family="Sans-serif" font-size="24" id="svg_1" y="98.48198" x="55.1146" stroke-width="0" fill="#000000">1.2.</text>
+ </g>
+</svg>

src/resources/icons/link.svg

@@ -0,0 +1,15 @@
+<?xml version="1.0" encoding="utf-8"?>
+<!-- Generator: Adobe Illustrator 16.2.1, SVG Export Plug-In . SVG Version: 6.00 Build 0)  -->
+<!DOCTYPE svg PUBLIC "-//W3C//DTD SVG 1.1//EN" "http://www.w3.org/Graphics/SVG/1.1/DTD/svg11.dtd">
+<svg version="1.1" id="Layer_1" xmlns="http://www.w3.org/2000/svg" xmlns:xlink="http://www.w3.org/1999/xlink" x="0px" y="0px"
+	 width="512px" height="512px" viewBox="0 0 512 512" style="enable-background:new 0 0 512 512;" xml:space="preserve">
+<g>
+	<path d="M256.5,208H256v0C256.2,208,256.3,208,256.5,208z"/>
+	<path d="M368.5,160H320c0,0,26,17,31.6,48H368h0.5c17.6,0,31.5,13.9,31.5,31.5v32c0,17.6-13.9,32.5-31.5,32.5h-112
+		c-17.6,0-32.5-14.9-32.5-32.5V240h-48v31.5c0,11.5,2.5,22.5,6.9,32.5c12.6,28.2,40.9,48,73.6,48h112c44.2,0,79.5-36.3,79.5-80.5
+		v-32C448,195.3,412.7,160,368.5,160z"/>
+	<path d="M329.6,208c-12.1-28.3-40.1-48-73.1-48h-112c-44.2,0-80.5,35.3-80.5,79.5v32c0,44.2,36.3,80.5,80.5,80.5H192
+		c0,0-25.8-17-32.1-48h-15.4c-17.6,0-32.5-14.9-32.5-32.5v-32c0-17.6,14.9-31.5,32.5-31.5H256h0.5c17.6,0,31.5,13.9,31.5,31.5v32
+		c0,0.2,0,0.3,0,0.5h48c0-0.2,0-0.3,0-0.5v-32C336,228.3,333.7,217.6,329.6,208z"/>
+</g>
+</svg>

src/resources/icons/vnote.svg

@@ -1,17 +1 @@
-<?xml version="1.0"?>
+<svg xmlns="http://www.w3.org/2000/svg" viewBox="0 0 82 82"><title>vnote</title><g id="图层_2" data-name="图层 2"><g id="图层_1-2" data-name="图层 1"><rect width="82" height="82" rx="11.76" ry="11.76" fill="#f2f2f2"/><path d="M50.29,12.74a1.52,1.52,0,0,1,1.52-1.52H62.73a.54.54,0,0,1,.38.92L51.21,24a.54.54,0,0,1-.92-.38Z" fill="#4d4d4d"/><path d="M19.23,28.27a1.52,1.52,0,0,1,1.52-1.52H31.66a.54.54,0,0,1,.38.92l-11.9,11.9a.54.54,0,0,1-.92-.38Z" fill="#4d4d4d"/><path d="M19.23,42.6a1.52,1.52,0,0,1,.45-1.08L32.79,28.41a.54.54,0,0,1,.92.38V40.9A1.52,1.52,0,0,1,33.26,42L20.15,55.1a.54.54,0,0,1-.92-.38Z" fill="#4d4d4d"/><rect x="19.23" y="11.21" width="14.48" height="14.48" rx="1.44" ry="1.44" fill="#c69c6d"/><path d="M34.76,43.8a1.52,1.52,0,0,1,1.52-1.52H62.73a.54.54,0,0,1,.38.92L35.68,70.63a.54.54,0,0,1-.92-.38Z" fill="#4d4d4d"/><path d="M36.8,41.23a.54.54,0,0,1-.38-.92L63.85,12.88a.54.54,0,0,1,.92.38V39.7a1.52,1.52,0,0,1-1.52,1.52Z" fill="#4d4d4d"/><path d="M20.52,58.36a1.52,1.52,0,0,1,0-2.16L32.79,43.94a.54.54,0,0,1,.92.38V70.25a.54.54,0,0,1-.92.38Z" fill="#4d4d4d"/></g></g></svg>
-<svg width="704" height="704" xmlns="http://www.w3.org/2000/svg" xmlns:svg="http://www.w3.org/2000/svg">
- <!-- Created with SVG-edit - http://svg-edit.googlecode.com/ -->
- <title>vnote</title>
- <g>
-  <title>Layer 3</title>
-  <rect stroke="#000000" id="svg_11" fill="#d6eace" stroke-width="5" stroke-dasharray="null" stroke-linejoin="null" stroke-linecap="null" x="-0.242409" y="-0.033089" width="704.290516" height="704.010575" stroke-opacity="0" rx="40" ry="40"/>
- </g>
- <g>
-  <title>Layer 1</title>
-  <path id="svg_7" d="m160.375009,100.656259l-0.250009,389.843741l129.9375,129.9375l260.15625,-260.4375l0,-259.875l-260.15625,259.875l0,-259.59375l-129.687491,0.250009z" stroke-opacity="0" stroke-linecap="null" stroke-linejoin="null" stroke-dasharray="null" stroke-width="null" stroke="#000000" fill="#15ae67"/>
- </g>
- <g>
-  <title>Layer 2</title>
-  <path id="svg_8" d="m550.43365,100.304726l-130.205135,-0.003944l0,130.042969" stroke-opacity="0" stroke-linecap="null" stroke-linejoin="null" stroke-dasharray="null" stroke-width="null" stroke="#000000" fill="#75c5b5"/>
- </g>
-</svg>

src/resources/icons/vnote_update.svg

@@ -1,17 +1 @@
-<?xml version="1.0"?>
+<svg xmlns="http://www.w3.org/2000/svg" viewBox="0 0 142 142"><title>vnote_cube</title><g id="图层_2" data-name="图层 2"><g id="图层_1-2" data-name="图层 1"><rect width="142" height="142" rx="11.76" ry="11.76" fill="#f2f2f2"/><path d="M12.6,13.8a1.88,1.88,0,0,1,1.88-1.87H64.66A1.87,1.87,0,0,1,66,15.12L15.8,65.31A1.88,1.88,0,0,1,12.6,64Z" fill="#4d4d4d"/><path d="M75.59,14.3a1.27,1.27,0,0,1,.9-2.18h48.42a1.27,1.27,0,0,1,.9,2.18L103.14,37a3.45,3.45,0,0,1-4.87,0Z" fill="#4d4d4d"/><path d="M42.1,46.41a1.27,1.27,0,0,1,2.18-.9L67,68.18a3.45,3.45,0,0,1,0,4.87L44.28,95.73a1.27,1.27,0,0,1-2.18-.9Z" fill="#4d4d4d"/><path d="M12.6,72.56a3.45,3.45,0,0,1,1-2.44L38.13,45.62a1.27,1.27,0,0,1,2.18.9V98.58a3.45,3.45,0,0,1-1,2.44L14.78,125.53a1.27,1.27,0,0,1-2.18-.9Z" fill="#4d4d4d"/><rect x="50.8" y="20.92" width="40" height="40" rx="3.45" ry="3.45" transform="translate(-8.2 62.05) rotate(-45)" fill="#c69c6d"/><path d="M17.09,128.92a1.27,1.27,0,0,1-.9-2.18L68.56,74.38a3.45,3.45,0,0,1,4.87,0l52.37,52.37a1.27,1.27,0,0,1-.9,2.18Z" fill="#4d4d4d"/><path d="M74.85,73a3.45,3.45,0,0,1,0-4.87l52.37-52.37a1.27,1.27,0,0,1,2.18.9V124.43a1.27,1.27,0,0,1-2.18.9Z" fill="#4d4d4d"/></g></g></svg>
-<svg width="704" height="704" xmlns="http://www.w3.org/2000/svg" xmlns:svg="http://www.w3.org/2000/svg">
- <!-- Created with SVG-edit - http://svg-edit.googlecode.com/ -->
- <title>vnote</title>
- <g>
-  <title>Layer 3</title>
-  <rect ry="40" rx="40" stroke-opacity="0" height="704.010575" width="704.290516" y="-0.033089" x="-0.242409" stroke-linecap="null" stroke-linejoin="null" stroke-dasharray="null" stroke-width="5" fill="#d6eace" id="svg_11" stroke="#000000"/>
- </g>
- <g>
-  <title>Layer 1</title>
-  <path fill="#15ae67" stroke="#000000" stroke-width="null" stroke-dasharray="null" stroke-linejoin="null" stroke-linecap="null" stroke-opacity="0" d="m160.37501,100.65626l-0.25001,389.84374l129.9375,129.9375l260.15625,-260.4375l0,-259.875l-260.15625,259.875l0,-259.59375l-129.68749,0.25001z" id="svg_7"/>
- </g>
- <g>
-  <title>Layer 2</title>
-  <path fill="#ffffff" stroke="#000000" stroke-width="null" stroke-dasharray="null" stroke-linejoin="null" stroke-linecap="null" stroke-opacity="0" d="m550.43365,100.30473l-130.20514,-0.00395l0,130.04297" id="svg_8"/>
- </g>
-</svg>

src/resources/vnote.ini

@@ -97,7 +97,8 @@ insert_title_from_note_name=true
 note_open_mode=0
 
 ; Whether auto generate heading sequence
-enable_heading_sequence=false
+; 0 - Disabled, 1 - Enabled, 2 - Enabled only for notes
+heading_sequence_type=0
 
 ; Heading sequence base level
 heading_sequence_base_level=1
@@ -135,13 +136,26 @@ confirm_reload_folder=true
 ; Whether double click on a tab to close it
 double_click_close_tab=true
 
+; Whether put folder and note panel in one vertical column
+enable_compact_mode=false
+
+; Whether enable tools dock widget
+tools_dock_checked=true
+
+; Pages to open on startup
+; 0 - none; 1 - Continue where you left off; 2 - specific pages
+startup_page_type=0
+
+; Specific pages to open on startup when startup_page_type is 2
+; A list of file path separated by ,
+; Notice: should escape \ by \\
+; C:\users\vnote\vnote.md -> C:\\users\\vnote\\vnote.md
+startup_pages=
+
 [web]
 ; Location and configuration for Mathjax
 mathjax_javascript=https://cdnjs.cloudflare.com/ajax/libs/mathjax/2.7.2/MathJax.js?config=TeX-MML-AM_CHTML
 
-[session]
-tools_dock_checked=true
-
 [predefined_colors]
 1\name=White
 1\rgb=EEEEEE
@@ -154,25 +168,84 @@ tools_dock_checked=true
 size=4
 
 [shortcuts]
-; Define shortcuts here, with each item in the form "operation->keysequence".
+; Define shortcuts here, with each item in the form "operation=keysequence".
 ; Leave keysequence empty to disable the shortcut of an operation.
 ; Custom shortcuts may conflict with some key bindings in edit mode or Vim mode.
-; Ctrl+E is reserved for Captain Mode.
 ; Ctrl+Q is reserved for quitting VNote.
-1\operation=NewNote
+
-1\keysequence=Ctrl+Alt+N
+; Leader key of Captain mode
-2\operation=SaveNote
+CaptainMode=Ctrl+E
-2\keysequence=Ctrl+S
+; Create a note in current folder
-3\operation=SaveAndRead
+NewNote=Ctrl+Alt+N
-3\keysequence=Ctrl+T
+; Save current note
-4\operation=EditNote
+SaveNote=Ctrl+S
-4\keysequence=Ctrl+W
+; Save changes and enter read mode
-5\operation=CloseNote
+SaveAndRead=Ctrl+T
-5\keysequence=
+; Edit current note
-6\operation=Find
+EditNote=Ctrl+W
-6\keysequence=Ctrl+F
+; Close current note
-7\operation=FindNext
+CloseNote=
-7\keysequence=F3
+; Open file/replace dialog
-8\operation=FindPrevious
+Find=Ctrl+F
-8\keysequence=Shift+F3
+; Find next occurence
-size=8
+FindNext=F3
+; Find previous occurence
+FindPrevious=Shift+F3
+
+[captain_mode_shortcuts]
+; Define shortcuts in Captain mode here.
+; There shortcuts are the sub-sequence after the CaptainMode key sequence
+; in [shortcuts].
+
+; Enter Navigation mode
+NavigationMode=W
+; Show attachment list of current note
+AttachmentList=A
+; Locate to the folder of current note
+LocateCurrentFile=D
+; Toggle Expand mode
+ExpandMode=E
+; Alternate one/two panels view
+OnePanelView=P
+; Discard changes and enter read mode
+DiscardAndRead=Q
+; Toggle Tools dock widget
+ToolsDock=T
+; Close current note
+CloseNote=X
+; Show shortcuts help document
+ShortcutsHelp=?
+; Flush the log file
+FlushLogFile=";"
+; Show opened files list
+OpenedFileList=F
+; Activate the ith tab
+ActivateTab1=1
+ActivateTab2=2
+ActivateTab3=3
+ActivateTab4=4
+ActivateTab5=5
+ActivateTab6=6
+ActivateTab7=7
+ActivateTab8=8
+ActivateTab9=9
+; Alternate between current and last tab
+AlternateTab=0
+; Activate next tab
+ActivateNextTab=J
+; Activate previous tab
+ActivatePreviousTab=K
+; Activate the window split on the left
+ActivateSplitLeft=H
+; Activate the window split on the right
+ActivateSplitRight=L
+; Move current tab one split left
+MoveTabSplitLeft=Shift+H
+; Move current tab one split right
+MoveTabSplitRight=Shift+L
+; Create a vertical split
+VerticalSplit=V
+; Remove current split
+RemoveSplit=R
+; Evaluate selected text or cursor word as magic words
+MagicWord=M

src/resources/vnote.qss

@@ -9,11 +9,11 @@ QPushButton[CornerBtn="true"]::menu-indicator {
     image: none;
 }
 
-QPushButton[CornerBtn="true"]::hover {
+QPushButton[CornerBtn="true"]:hover {
     background-color: @hover-color;
 }
 
-QPushButton[CornerBtn="true"]::focus {
+QPushButton[CornerBtn="true"]:focus {
     background-color: @focus-color;
 }
 
@@ -25,11 +25,11 @@ QPushButton[StatusBtn="true"] {
     background-color: transparent;
 }
 
-QPushButton[StatusBtn="true"]::hover {
+QPushButton[StatusBtn="true"]:hover {
     background-color: @hover-color;
 }
 
-QPushButton[StatusBtn="true"]::focus {
+QPushButton[StatusBtn="true"]:focus {
     background-color: @focus-color;
 }
 
@@ -40,11 +40,11 @@ QPushButton[FlatBtn="true"] {
     background-color: transparent;
 }
 
-QPushButton[FlatBtn="true"]::hover {
+QPushButton[FlatBtn="true"]:hover {
     background-color: @hover-color;
 }
 
-QPushButton[FlatBtn="true"]::focus {
+QPushButton[FlatBtn="true"]:focus {
     background-color: @focus-color;
 }
 
@@ -56,11 +56,11 @@ QPushButton[SelectionBtn="true"] {
     text-align: left;
 }
 
-QPushButton[SelectionBtn="true"]::hover {
+QPushButton[SelectionBtn="true"]:hover {
     background-color: @hover-color;
 }
 
-QPushButton[SelectionBtn="true"]::focus {
+QPushButton[SelectionBtn="true"]:focus {
     background-color: @focus-color;
 }
 
@@ -71,11 +71,11 @@ QPushButton[TitleBtn="true"] {
     background-color: @base-color;
 }
 
-QPushButton[TitleBtn="true"]::hover {
+QPushButton[TitleBtn="true"]:hover {
     background-color: @hover-color;
 }
 
-QPushButton[TitleBtn="true"]::focus {
+QPushButton[TitleBtn="true"]:focus {
     background-color: @focus-color;
 }
 
@@ -85,7 +85,7 @@ QPushButton[DangerBtn="true"] {
     background-color: #d9534f;
 }
 
-QPushButton[DangerBtn="true"]::hover {
+QPushButton[DangerBtn="true"]:hover {
     color: #fff;
     border-color: #ac2925;
     background-color: #c9302c;
@@ -95,10 +95,14 @@ QToolBar {
     border: none;
 }
 
-QToolButton::hover {
+QToolButton:hover {
     background-color: @hover-color;
 }
 
+/* Override default shift behavior */
+QToolButton::menu-arrow:open {
+}
+
 QMenuBar {
     border: none;
 }
@@ -141,7 +145,7 @@ QComboBox#NotebookSelector {
     icon-size: 30px;
 }
 
-QComboBox#NotebookSelector::focus {
+QComboBox#NotebookSelector:focus {
     background-color: @focus-color;
 }
 

src/src.pro

@@ -44,7 +44,6 @@ SOURCES += main.cpp\
     veditwindow.cpp \
     vedittab.cpp \
     voutline.cpp \
-    vtoc.cpp \
     vsingleinstanceguard.cpp \
     vdirectory.cpp \
     vfile.cpp \
@@ -77,7 +76,12 @@ SOURCES += main.cpp\
     dialog/vconfirmdeletiondialog.cpp \
     vnotefile.cpp \
     vattachmentlist.cpp \
-    dialog/vsortdialog.cpp
+    dialog/vsortdialog.cpp \
+    vfilesessioninfo.cpp \
+    vtableofcontent.cpp \
+    utils/vmetawordmanager.cpp \
+    vlineedit.cpp \
+    dialog/vinsertlinkdialog.cpp
 
 HEADERS  += vmainwindow.h \
     vdirectorytree.h \
@@ -107,7 +111,6 @@ HEADERS  += vmainwindow.h \
     veditwindow.h \
     vedittab.h \
     voutline.h \
-    vtoc.h \
     vsingleinstanceguard.h \
     vdirectory.h \
     vfile.h \
@@ -142,7 +145,12 @@ HEADERS  += vmainwindow.h \
     dialog/vconfirmdeletiondialog.h \
     vnotefile.h \
     vattachmentlist.h \
-    dialog/vsortdialog.h
+    dialog/vsortdialog.h \
+    vfilesessioninfo.h \
+    vtableofcontent.h \
+    utils/vmetawordmanager.h \
+    vlineedit.h \
+    dialog/vinsertlinkdialog.h
 
 RESOURCES += \
     vnote.qrc \

src/utils/veditutils.cpp

@@ -48,7 +48,7 @@ bool VEditUtils::insertBlockWithIndent(QTextCursor &p_cursor)
 {
     V_ASSERT(!p_cursor.hasSelection());
     p_cursor.insertBlock();
-    return indentBlockAsPreviousBlock(p_cursor);
+    return indentBlockAsBlock(p_cursor, false);
 }
 
 bool VEditUtils::insertListMarkAsPreviousBlock(QTextCursor &p_cursor)
@@ -85,21 +85,16 @@ bool VEditUtils::insertListMarkAsPreviousBlock(QTextCursor &p_cursor)
 
 }
 
-bool VEditUtils::indentBlockAsPreviousBlock(QTextCursor &p_cursor)
+bool VEditUtils::indentBlockAsBlock(QTextCursor &p_cursor, bool p_next)
 {
     bool changed = false;
     QTextBlock block = p_cursor.block();
-    if (block.blockNumber() == 0) {
+    QTextBlock refBlock = p_next ? block.next() : block.previous();
-        // The first block.
+    if (!refBlock.isValid()) {
         return false;
     }
 
-    QTextBlock preBlock = block.previous();
+    QString leadingSpaces = fetchIndentSpaces(refBlock);
-    QString text = preBlock.text();
-    QRegExp regExp("(^\\s*)");
-    regExp.indexIn(text);
-    V_ASSERT(regExp.captureCount() == 1);
-    QString leadingSpaces = regExp.capturedTexts()[1];
 
     moveCursorFirstNonSpaceCharacter(p_cursor, QTextCursor::MoveAnchor);
     if (!p_cursor.atBlockStart()) {
@@ -689,3 +684,130 @@ bool VEditUtils::needToCancelAutoIndent(int p_autoIndentPos, const QTextCursor &
 
     return false;
 }
+
+void VEditUtils::insertTitleMark(QTextCursor &p_cursor,
+                                 const QTextBlock &p_block,
+                                 int p_level)
+{
+    if (!p_block.isValid()) {
+        return;
+    }
+
+    Q_ASSERT(p_level >= 1 && p_level <= 6);
+
+    bool needInsert = true;
+
+    p_cursor.setPosition(p_block.position());
+
+    // Test if this block contains title marks.
+    QRegExp headerReg(VUtils::c_headerRegExp);
+    QString text = p_block.text();
+    bool matched = headerReg.exactMatch(text);
+    if (matched) {
+        int level = headerReg.cap(1).length();
+        if (level == p_level) {
+            needInsert = false;
+        } else {
+            // Remove the title mark.
+            p_cursor.movePosition(QTextCursor::NextCharacter,
+                                  QTextCursor::KeepAnchor,
+                                  level);
+            p_cursor.removeSelectedText();
+        }
+    }
+
+    // Insert titleMark + " " at the front of the block.
+    if (needInsert) {
+        // Remove the spaces at front.
+        // insertText() will remove the selection.
+        moveCursorFirstNonSpaceCharacter(p_cursor, QTextCursor::KeepAnchor);
+
+        // Insert.
+        const QString titleMark(p_level, '#');
+        p_cursor.insertText(titleMark + " ");
+    }
+
+    // Go to the end of this block.
+    p_cursor.movePosition(QTextCursor::EndOfBlock);
+}
+
+void VEditUtils::findCurrentWord(QTextCursor p_cursor,
+                                 int &p_start,
+                                 int &p_end)
+{
+    QString text = p_cursor.block().text();
+    int pib = p_cursor.positionInBlock();
+
+    if (pib < text.size() && text[pib].isSpace()) {
+        p_start = p_end = p_cursor.position();
+        return;
+    }
+
+    p_cursor.movePosition(QTextCursor::StartOfWord);
+    p_start = p_cursor.position();
+    p_cursor.movePosition(QTextCursor::EndOfWord);
+    p_end = p_cursor.position();
+}
+
+void VEditUtils::findCurrentWORD(const QTextCursor &p_cursor,
+                                 int &p_start,
+                                 int &p_end)
+{
+    QTextBlock block = p_cursor.block();
+    QString text = block.text();
+    int pib = p_cursor.positionInBlock();
+
+    if (pib < text.size() && text[pib].isSpace()) {
+        p_start = p_end = p_cursor.position();
+        return;
+    }
+
+    // Find the start.
+    p_start = 0;
+    for (int i = pib - 1; i >= 0; --i) {
+        if (text[i].isSpace()) {
+            p_start = i + 1;
+            break;
+        }
+    }
+
+    // Find the end.
+    p_end = block.length() - 1;
+    for (int i = pib; i < text.size(); ++i) {
+        if (text[i].isSpace()) {
+            p_end = i;
+            break;
+        }
+    }
+
+    p_start += block.position();
+    p_end += block.position();
+}
+
+QString VEditUtils::fetchIndentSpaces(const QTextBlock &p_block)
+{
+    QString text = p_block.text();
+    QRegExp regExp("(^\\s*)");
+    regExp.indexIn(text);
+    Q_ASSERT(regExp.captureCount() == 1);
+    return regExp.capturedTexts()[1];
+}
+
+void VEditUtils::insertBlock(QTextCursor &p_cursor,
+                             bool p_above)
+{
+    p_cursor.movePosition(p_above ? QTextCursor::StartOfBlock
+                                  : QTextCursor::EndOfBlock,
+                          QTextCursor::MoveAnchor,
+                          1);
+
+    p_cursor.insertBlock();
+
+    if (p_above) {
+        p_cursor.movePosition(QTextCursor::PreviousBlock,
+                              QTextCursor::MoveAnchor,
+                              1);
+    }
+
+    p_cursor.movePosition(QTextCursor::EndOfBlock);
+}

src/utils/veditutils.h

@@ -24,10 +24,11 @@ public:
     // Need to call setTextCursor() to make it take effect.
     static void moveCursorFirstNonSpaceCharacter(QTextCursor &p_cursor,
                                                  QTextCursor::MoveMode p_mode);
-    // Indent current block as previous block.
+    // Indent current block as next/previous block.
     // Return true if some changes have been made.
     // @p_cursor will be placed at the position after inserting leading spaces.
-    static bool indentBlockAsPreviousBlock(QTextCursor &p_cursor);
+    // @p_next: indent as next block or previous block.
+    static bool indentBlockAsBlock(QTextCursor &p_cursor, bool p_next);
 
     // Returns true if two blocks has the same indent.
     static bool hasSameIndent(const QTextBlock &p_blocka, const QTextBlock &p_blockb);
@@ -132,7 +133,38 @@ public:
 
     // Check if we need to cancel auto indent.
     // @p_autoIndentPos: the position of the cursor after auto indent.
-    static bool needToCancelAutoIndent(int p_autoIndentPos, const QTextCursor &p_cursor);
+    static bool needToCancelAutoIndent(int p_autoIndentPos,
+                                       const QTextCursor &p_cursor);
+
+    // Insert title Mark at level @p_level in front of block @p_block
+    // If there already exists title marks, remove it first.
+    // Move cursor at the end of the block after insertion.
+    static void insertTitleMark(QTextCursor &p_cursor,
+                                const QTextBlock &p_block,
+                                int p_level);
+
+    // Find the start and end of the word @p_cursor locates in (within a single block).
+    // @p_start and @p_end will be the global position of the start and end of the word.
+    // @p_start will equals to @p_end if @p_cursor is a space.
+    static void findCurrentWord(QTextCursor p_cursor,
+                                int &p_start,
+                                int &p_end);
+
+    // Find the start and end of the WORD @p_cursor locates in (within a single block).
+    // @p_start and @p_end will be the global position of the start and end of the WORD.
+    // @p_start will equals to @p_end if @p_cursor is a space.
+    // Attention: www|sss will select www, which is different from findCurrentWord().
+    static void findCurrentWORD(const QTextCursor &p_cursor,
+                                int &p_start,
+                                int &p_end);
+
+    // Return the leading spaces of @p_block.
+    static QString fetchIndentSpaces(const QTextBlock &p_block);
+
+    // Insert a block above/below current block. Move the cursor to the start of
+    // the new block after insertion.
+    static void insertBlock(QTextCursor &p_cursor,
+                            bool p_above);
 
 private:
     VEditUtils() {}

src/utils/vmetawordmanager.cpp

@@ -0,0 +1,596 @@
+#include "vmetawordmanager.h"
+
+#include <QDebug>
+#include <QWidget>
+#include <QApplication>
+#include <QToolTip>
+
+#include "vconfigmanager.h"
+
+extern VConfigManager *g_config;
+
+
+// Used as the function template for some date/time related meta words.
+static QString formattedDateTime(const VMetaWord *p_metaWord,
+                                 const QString &p_format)
+{
+    return p_metaWord->getManager()->getDateTime().toString(p_format);
+}
+
+static QString allMetaWordsInfo(const VMetaWord *p_metaWord)
+{
+    QString msg = QObject::tr("All magic words:");
+
+    const VMetaWordManager *mgr = p_metaWord->getManager();
+    QList<QString> keys = mgr->getAllMetaWords().keys();
+    keys.sort(Qt::CaseInsensitive);
+
+    for (auto const & key : keys) {
+        const VMetaWord *word = mgr->findMetaWord(key);
+        Q_ASSERT(word);
+        msg += QString("\n%1:\t%2").arg(word->getWord()).arg(word->getDefinition());
+    }
+
+    QWidget *focusWid = QApplication::focusWidget();
+    if (focusWid) {
+        QPoint pos = focusWid->mapToGlobal(QPoint(0, focusWid->height()));
+        QToolTip::showText(pos, msg, focusWid);
+    }
+
+    // Just return the same word.
+    return QString("%1help%1").arg(VMetaWordManager::c_delimiter);
+}
+
+const QChar VMetaWordManager::c_delimiter = '%';
+
+VMetaWordManager::VMetaWordManager(QObject *p_parent)
+    : QObject(p_parent)
+{
+}
+
+void VMetaWordManager::init()
+{
+    using namespace std::placeholders;
+
+    // %d%.
+    addMetaWord(MetaWordType::FunctionBased,
+                "d",
+                tr("the day as number without a leading zero (`1` to `31`)"),
+                std::bind(formattedDateTime, _1, "d"));
+
+    // %dd%.
+    addMetaWord(MetaWordType::FunctionBased,
+                "dd",
+                tr("the day as number with a leading zero (`01` to `31`)"),
+                std::bind(formattedDateTime, _1, "dd"));
+
+    // %ddd%.
+    addMetaWord(MetaWordType::FunctionBased,
+                "ddd",
+                tr("the abbreviated localized day name (e.g. `Mon` to `Sun`)"),
+                std::bind(formattedDateTime, _1, "ddd"));
+
+    // %dddd%.
+    addMetaWord(MetaWordType::FunctionBased,
+                "dddd",
+                tr("the long localized day name (e.g. `Monday` to `Sunday`)"),
+                std::bind(formattedDateTime, _1, "dddd"));
+
+    // %M%.
+    addMetaWord(MetaWordType::FunctionBased,
+                "M",
+                tr("the month as number without a leading zero (`1` to `12`)"),
+                std::bind(formattedDateTime, _1, "M"));
+
+    // %MM%.
+    addMetaWord(MetaWordType::FunctionBased,
+                "MM",
+                tr("the month as number with a leading zero (`01` to `12`)"),
+                std::bind(formattedDateTime, _1, "MM"));
+
+    // %MMM%.
+    addMetaWord(MetaWordType::FunctionBased,
+                "MMM",
+                tr("the abbreviated localized month name (e.g. `Jan` to `Dec`)"),
+                std::bind(formattedDateTime, _1, "MMM"));
+
+    // %MMMM%.
+    addMetaWord(MetaWordType::FunctionBased,
+                "MMMM",
+                tr("the long localized month name (e.g. `January` to `December`"),
+                std::bind(formattedDateTime, _1, "MMMM"));
+
+    // %yy%.
+    addMetaWord(MetaWordType::FunctionBased,
+                "yy",
+                tr("the year as two digit number (`00` to `99`)"),
+                std::bind(formattedDateTime, _1, "yy"));
+
+    // %yyyy%.
+    addMetaWord(MetaWordType::FunctionBased,
+                "yyyy",
+                tr("the year as four digit number"),
+                std::bind(formattedDateTime, _1, "yyyy"));
+
+    // %h%.
+    addMetaWord(MetaWordType::FunctionBased,
+                "h",
+                tr("the hour without a leading zero (`0` to `23` or `1` to `12` if AM/PM display"),
+                std::bind(formattedDateTime, _1, "h"));
+
+    // %hh%.
+    addMetaWord(MetaWordType::FunctionBased,
+                "hh",
+                tr("the hour with a leading zero (`00` to `23` or `01` to `12` if AM/PM display"),
+                std::bind(formattedDateTime, _1, "hh"));
+
+    // %H%.
+    addMetaWord(MetaWordType::FunctionBased,
+                "H",
+                tr("the hour without a leading zero (`0` to `23` even with AM/PM display"),
+                std::bind(formattedDateTime, _1, "H"));
+
+    // %HH%.
+    addMetaWord(MetaWordType::FunctionBased,
+                "HH",
+                tr("the hour with a leading zero (`00` to `23` even with AM/PM display"),
+                std::bind(formattedDateTime, _1, "HH"));
+
+    // %m%.
+    addMetaWord(MetaWordType::FunctionBased,
+                "m",
+                tr("the minute without a leading zero (`0` to `59`)"),
+                std::bind(formattedDateTime, _1, "m"));
+
+    // %mm%.
+    addMetaWord(MetaWordType::FunctionBased,
+                "mm",
+                tr("the minute with a leading zero (`00` to `59`)"),
+                std::bind(formattedDateTime, _1, "mm"));
+
+    // %s%.
+    addMetaWord(MetaWordType::FunctionBased,
+                "s",
+                tr("the second without a leading zero (`0` to `59`)"),
+                std::bind(formattedDateTime, _1, "s"));
+
+    // %ss%.
+    addMetaWord(MetaWordType::FunctionBased,
+                "ss",
+                tr("the second with a leading zero (`00` to `59`)"),
+                std::bind(formattedDateTime, _1, "ss"));
+
+    // %z%.
+    addMetaWord(MetaWordType::FunctionBased,
+                "z",
+                tr("the milliseconds without leading zeroes (`0` to `999`)"),
+                std::bind(formattedDateTime, _1, "z"));
+
+    // %zzz%.
+    addMetaWord(MetaWordType::FunctionBased,
+                "zzz",
+                tr("the milliseconds with leading zeroes (`000` to `999`)"),
+                std::bind(formattedDateTime, _1, "zzz"));
+
+    // %AP%.
+    addMetaWord(MetaWordType::FunctionBased,
+                "AP",
+                tr("use AM/PM display (`AM` or `PM`)"),
+                std::bind(formattedDateTime, _1, "AP"));
+
+    // %A%.
+    addMetaWord(MetaWordType::FunctionBased,
+                "A",
+                tr("use AM/PM display (`AM` or `PM`)"),
+                std::bind(formattedDateTime, _1, "A"));
+
+    // %ap%.
+    addMetaWord(MetaWordType::FunctionBased,
+                "ap",
+                tr("use am/pm display (`am` or `pm`)"),
+                std::bind(formattedDateTime, _1, "ap"));
+
+    // %a%.
+    addMetaWord(MetaWordType::FunctionBased,
+                "a",
+                tr("use am/pm display (`am` or `pm`)"),
+                std::bind(formattedDateTime, _1, "a"));
+
+    // %t%.
+    addMetaWord(MetaWordType::FunctionBased,
+                "t",
+                tr("the timezone (e.g. `CEST`)"),
+                std::bind(formattedDateTime, _1, "t"));
+
+    // %random%.
+    addMetaWord(MetaWordType::FunctionBased,
+                "random",
+                tr("a random number"),
+                [](const VMetaWord *) {
+                    return QString::number(qrand());
+                });
+
+    // %random_d%.
+    addMetaWord(MetaWordType::Dynamic,
+                "random_d",
+                tr("dynamic version of `random`"),
+                [](const VMetaWord *) {
+                    return QString::number(qrand());
+                });
+
+    // %date%.
+    addMetaWord(MetaWordType::Compound,
+                "date",
+                QString("%1yyyy%1-%1MM%1-%1dd%1").arg(c_delimiter));
+
+    // %da%.
+    addMetaWord(MetaWordType::Compound,
+                "da",
+                QString("%1yyyy%1%1MM%1%1dd%1").arg(c_delimiter));
+
+    // %time%.
+    addMetaWord(MetaWordType::Compound,
+                "time",
+                QString("%1hh%1:%1mm%1:%1ss%1").arg(c_delimiter));
+
+    // %datetime%.
+    addMetaWord(MetaWordType::Compound,
+                "datetime",
+                QString("%1date%1 %1time%1").arg(c_delimiter));
+
+    // Custom meta words.
+    initCustomMetaWords();
+
+    // %help% to print all metaword info.
+    addMetaWord(MetaWordType::FunctionBased,
+                "help",
+                tr("information about all defined magic words"),
+                allMetaWordsInfo);
+}
+
+void VMetaWordManager::initCustomMetaWords()
+{
+    QVector<VMagicWord> words = g_config->getCustomMagicWords();
+    for (auto const & item : words) {
+        addMetaWord(MetaWordType::Compound,
+                    item.m_name,
+                    item.m_definition);
+    }
+}
+
+QString VMetaWordManager::evaluate(const QString &p_text) const
+{
+    if (p_text.isEmpty()) {
+        return p_text;
+    }
+
+    // Update datetime for later parse.
+    const_cast<VMetaWordManager *>(this)->m_dateTime = QDateTime::currentDateTime();
+
+    // Treat the text as a Compound meta word.
+    const QString tmpWord("vnote_tmp_metaword");
+    Q_ASSERT(!contains(tmpWord));
+    VMetaWord metaWord(this,
+                       MetaWordType::Compound,
+                       tmpWord,
+                       p_text,
+                       nullptr,
+                       true);
+    if (metaWord.isValid()) {
+        return metaWord.evaluate();
+    } else {
+        return p_text;
+    }
+}
+
+bool VMetaWordManager::contains(const QString &p_word) const
+{
+    return m_metaWords.contains(p_word);
+}
+
+const VMetaWord *VMetaWordManager::findMetaWord(const QString &p_word) const
+{
+    auto it = m_metaWords.find(p_word);
+    if (it != m_metaWords.end()) {
+        return &it.value();
+    }
+
+    return NULL;
+}
+
+void VMetaWordManager::addMetaWord(MetaWordType p_type,
+                                   const QString &p_word,
+                                   const QString &p_definition,
+                                   MetaWordFunc p_function)
+{
+    if (p_word.isEmpty() || contains(p_word)) {
+        return;
+    }
+
+    VMetaWord metaWord(this,
+                       p_type,
+                       p_word,
+                       p_definition,
+                       p_function);
+
+    if (metaWord.isValid()) {
+        m_metaWords.insert(p_word, metaWord);
+        qDebug() << QString("MetaWord %1%2%1[%3] added")
+                           .arg(c_delimiter).arg(p_word).arg(p_definition);
+    }
+}
+
+VMetaWord::VMetaWord(const VMetaWordManager *p_manager,
+                     MetaWordType p_type,
+                     const QString &p_word,
+                     const QString &p_definition,
+                     MetaWordFunc p_function,
+                     bool p_allowAllSpaces)
+    : m_manager(p_manager),
+      m_type(p_type),
+      m_word(p_word),
+      m_definition(p_definition),
+      m_valid(false)
+{
+    m_function = p_function;
+
+    if (checkType(MetaWordType::Simple)
+        || checkType(MetaWordType::Compound)) {
+        Q_ASSERT(!m_function);
+    } else {
+        Q_ASSERT(m_function);
+    }
+
+    checkAndParseDefinition(p_allowAllSpaces);
+}
+
+bool VMetaWord::checkType(MetaWordType p_type)
+{
+    return m_type == p_type;
+}
+
+void VMetaWord::checkAndParseDefinition(bool p_allowAllSpaces)
+{
+    if (m_word.contains(VMetaWordManager::c_delimiter)) {
+        m_valid = false;
+        return;
+    }
+
+    m_valid = true;
+    m_tokens.clear();
+
+    // We do not accept \n and \t in the definition.
+    QRegExp defReg("[\\S ]*");
+    if (!defReg.exactMatch(m_definition) && !p_allowAllSpaces) {
+        m_valid = false;
+        return;
+    }
+
+    if (checkType(MetaWordType::FunctionBased)
+        || checkType(MetaWordType::Dynamic)) {
+        if (!m_function) {
+            m_valid = false;
+        }
+    } else if (checkType(MetaWordType::Compound)) {
+        m_tokens = parseToTokens(m_definition);
+        if (m_tokens.isEmpty()) {
+            m_valid = false;
+            return;
+        }
+
+        for (auto const & to : m_tokens) {
+            if (to.isMetaWord()) {
+                if (!m_manager->contains(to.m_value)) {
+                    // Dependency not defined.
+                    m_valid = false;
+                    break;
+                }
+            }
+        }
+    }
+}
+
+bool VMetaWord::isValid() const
+{
+    return m_valid;
+}
+
+QString VMetaWord::evaluate() const
+{
+    Q_ASSERT(m_valid);
+    qDebug() << "evaluate meta word" << m_word;
+    switch (m_type) {
+    case MetaWordType::Simple:
+        return m_definition;
+
+    case MetaWordType::FunctionBased:
+    case MetaWordType::Dynamic:
+        return m_function(this);
+
+    case MetaWordType::Compound:
+    {
+        QHash<QString, QString> cache;
+        return evaluateTokens(m_tokens, cache);
+    }
+
+    default:
+        return "";
+    }
+}
+
+MetaWordType VMetaWord::getType() const
+{
+    return m_type;
+}
+
+const QString &VMetaWord::getWord() const
+{
+    return m_word;
+}
+
+const QString &VMetaWord::getDefinition() const
+{
+    return m_definition;
+}
+
+const VMetaWordManager *VMetaWord::getManager() const
+{
+    return m_manager;
+}
+
+
+QString VMetaWord::toString() const
+{
+    QChar typeChar('U');
+    switch (m_type) {
+    case MetaWordType::Simple:
+        typeChar = 'S';
+        break;
+
+    case MetaWordType::FunctionBased:
+        typeChar = 'F';
+        break;
+
+    case MetaWordType::Dynamic:
+        typeChar = 'D';
+        break;
+
+    case MetaWordType::Compound:
+        typeChar = 'C';
+        break;
+
+    default:
+        break;
+    }
+
+    return QString("%1%2%1[%3]: %4").arg(VMetaWordManager::c_delimiter)
+                                     .arg(m_word)
+                                     .arg(typeChar)
+                                     .arg(m_definition);
+}
+
+QVector<VMetaWord::Token> VMetaWord::parseToTokens(const QString &p_text)
+{
+    QVector<Token> tokens;
+
+    TokenType type = TokenType::Raw;
+    QString value;
+    value.reserve(p_text.size());
+    for (int idx = 0; idx < p_text.size(); ++idx) {
+        const QChar &ch = p_text[idx];
+        if (ch == VMetaWordManager::c_delimiter) {
+            // Check if it is single or double.
+            int next = idx + 1;
+            if (next == p_text.size()
+                || p_text[next] != VMetaWordManager::c_delimiter) {
+                // Single delimiter.
+                if (type == TokenType::Raw) {
+                    // End of a raw token, begin of a MetaWord token.
+                    if (!value.isEmpty()) {
+                        tokens.push_back(Token(type, value));
+                    }
+
+                    type = TokenType::MetaWord;
+                } else {
+                    // End of a MetaWord token, begin of a Raw token.
+                    Q_ASSERT(!value.isEmpty());
+
+                    tokens.push_back(Token(type, value));
+                    type = TokenType::Raw;
+                }
+
+                value.clear();
+            } else {
+                // Double delimiter.
+                // If now is parsing a MetaWord token, treat the first delimiter
+                // as the end of a token.
+                // Otherwise, store one single delimiter in value and skip next char.
+                if (type == TokenType::MetaWord) {
+                    Q_ASSERT(!value.isEmpty());
+                    tokens.push_back(Token(type, value));
+                    type = TokenType::Raw;
+                    value.clear();
+                } else {
+                    value.push_back(ch);
+                    ++idx;
+                }
+            }
+        } else {
+            // Push ch in value.
+            value.push_back(ch);
+        }
+    }
+
+    if (!value.isEmpty()) {
+        if (type == TokenType::Raw) {
+            tokens.push_back(Token(type, value));
+        } else {
+            // An imcomplete metaword token.
+            // Treat it as raw.
+            tokens.push_back(Token(TokenType::Raw, "%" + value));
+        }
+
+        value.clear();
+    }
+
+    return tokens;
+}
+
+QString VMetaWord::evaluateTokens(const QVector<VMetaWord::Token> &p_tokens,
+                                  QHash<QString, QString> &p_cache) const
+{
+    QString val;
+
+    for (auto const & to : p_tokens) {
+        switch (to.m_type) {
+        case TokenType::Raw:
+            val += to.m_value;
+            break;
+
+        case TokenType::MetaWord:
+        {
+            const VMetaWord *metaWord = m_manager->findMetaWord(to.m_value);
+            if (!metaWord) {
+                // Invalid meta word. Treat it as literal value.
+                val += VMetaWordManager::c_delimiter + to.m_value + VMetaWordManager::c_delimiter;
+                break;
+            }
+
+            QString wordVal;
+            switch (metaWord->getType()) {
+            case MetaWordType::FunctionBased:
+            {
+                auto it = p_cache.find(metaWord->getWord());
+                if (it != p_cache.end()) {
+                    // Find it in the cache.
+                    wordVal = it.value();
+                } else {
+                    // First evaluate this meta word.
+                    wordVal = metaWord->evaluate();
+                    p_cache.insert(metaWord->getWord(), wordVal);
+                }
+
+                break;
+            }
+
+            case MetaWordType::Compound:
+                wordVal = evaluateTokens(metaWord->m_tokens, p_cache);
+                break;
+
+            default:
+                wordVal = metaWord->evaluate();
+                break;
+            }
+
+            val += wordVal;
+            break;
+        }
+
+        default:
+            Q_ASSERT(false);
+            break;
+        }
+    }
+
+    return val;
+}

src/utils/vmetawordmanager.h

@@ -0,0 +1,205 @@
+#ifndef VMETAWORDMANAGER_H
+#define VMETAWORDMANAGER_H
+
+#include <functional>
+
+#include <QObject>
+#include <QString>
+#include <QVector>
+#include <QHash>
+#include <QDateTime>
+
+
+enum class MetaWordType
+{
+    // Definition is plain text.
+    Simple = 0,
+
+    // Definition is a function call to get the value.
+    FunctionBased,
+
+    // Like FunctionBased, but should re-evaluate the value for each occurence.
+    Dynamic,
+
+    // Consists of other meta words.
+    Compound,
+
+    Invalid
+};
+
+// We call meta word "magic word" in user interaction.
+struct VMagicWord
+{
+    QString m_name;
+    QString m_definition;
+};
+
+class VMetaWordManager;
+class VMetaWord;
+
+typedef std::function<QString(const VMetaWord *)> MetaWordFunc;
+
+// A Meta Word is surrounded by %.
+// - Use %% for an escaped %;
+// - Built-in or user-defined;
+// - A meta word could contain other meta words as definition.
+class VMetaWord
+{
+public:
+    VMetaWord(const VMetaWordManager *p_manager,
+              MetaWordType p_type,
+              const QString &p_word,
+              const QString &p_definition,
+              MetaWordFunc p_function = nullptr,
+              bool p_allowAllSpaces = false);
+
+    bool isValid() const;
+
+    QString evaluate() const;
+
+    MetaWordType getType() const;
+
+    const QString &getWord() const;
+
+    const QString &getDefinition() const;
+
+    const VMetaWordManager *getManager() const;
+
+    QString toString() const;
+
+    enum class TokenType
+    {
+        Raw = 0,
+        MetaWord
+    };
+
+    struct Token
+    {
+        Token()
+            : m_type(TokenType::Raw)
+        {
+        }
+
+        Token(VMetaWord::TokenType p_type, const QString &p_value)
+            : m_type(p_type),
+              m_value(p_value)
+        {
+        }
+
+        QString toString() const
+        {
+            return QString("token %1[%2]").arg(m_type == TokenType::Raw
+                                              ? "Raw" : "MetaWord")
+                                         .arg(m_value);
+        }
+
+        bool isRaw() const
+        {
+            return m_type == TokenType::Raw;
+        }
+
+        bool isMetaWord() const
+        {
+            return m_type == TokenType::MetaWord;
+        }
+
+        TokenType m_type;
+
+        // For Raw type, m_value is the raw string of this token;
+        // For MetaWord type, m_value is the word of the meta word pointed to by
+        // this token.
+        QString m_value;
+    };
+
+private:
+    // Check if m_type is @p_type.
+    bool checkType(MetaWordType p_type);
+
+    // Parse children word from definition.
+    // Children word MUST be defined in m_manager already.
+    // @p_allowAllSpaces: if true then we allow all spaces including \n and \t
+    // to appear in the definition.
+    void checkAndParseDefinition(bool p_allowAllSpaces);
+
+    // Parse @p_text to a list of tokens.
+    static QVector<VMetaWord::Token> parseToTokens(const QString &p_text);
+
+    // Used for Compound meta word with cache @p_cache.
+    // @p_cache: value cache for FunctionBased Token.
+    // For a meta word occuring more than once, we should evaluate it once for
+    // FunctionBased meta word.
+    QString evaluateTokens(const QVector<VMetaWord::Token> &p_tokens,
+                           QHash<QString, QString> &p_cache) const;
+
+    const VMetaWordManager *m_manager;
+
+    MetaWordType m_type;
+
+    // Word could contains spaces but no %.
+    QString m_word;
+
+    // For Simple/Compound meta word, this contains the definition;
+    // For FunctionBased/Dynamic meta word, this makes no sense and is used
+    // for description.
+    QString m_definition;
+
+    // For FunctionBased and Dynamic meta word.
+    MetaWordFunc m_function;
+
+    bool m_valid;
+
+    // Tokens used for Compound meta word.
+    QVector<Token> m_tokens;
+};
+
+
+// Manager of meta word.
+class VMetaWordManager : public QObject
+{
+    Q_OBJECT
+public:
+    explicit VMetaWordManager(QObject *p_parent = nullptr);
+
+    void init();
+
+    // Expand meta words in @p_text and return the expanded text.
+    QString evaluate(const QString &p_text) const;
+
+    const VMetaWord *findMetaWord(const QString &p_word) const;
+
+    bool contains(const QString &p_word) const;
+
+    const QDateTime &getDateTime() const;
+
+    const QHash<QString, VMetaWord> &getAllMetaWords() const;
+
+    // % by default.
+    static const QChar c_delimiter;
+
+private:
+    void addMetaWord(MetaWordType p_type,
+                     const QString &p_word,
+                     const QString &p_definition,
+                     MetaWordFunc p_function = nullptr);
+
+    void initCustomMetaWords();
+
+    // Map using word as key.
+    QHash<QString, VMetaWord> m_metaWords;
+
+    // Used for data/time related evaluate.
+    // Will be updated before each evaluation.
+    QDateTime m_dateTime;
+};
+
+inline const QDateTime &VMetaWordManager::getDateTime() const
+{
+    return m_dateTime;
+}
+
+inline const QHash<QString, VMetaWord> &VMetaWordManager::getAllMetaWords() const
+{
+    return m_metaWords;
+}
+
+#endif // VMETAWORDMANAGER_H

src/utils/vutils.cpp

@@ -33,6 +33,8 @@ QVector<QPair<QString, QString>> VUtils::s_availableLanguages;
 
 const QString VUtils::c_imageLinkRegExp = QString("\\!\\[([^\\]]*)\\]\\(([^\\)\"]+)\\s*(\"(\\\\.|[^\"\\)])*\")?\\s*\\)");
 
+const QString VUtils::c_imageTitleRegExp = QString("[\\w\\(\\)@#%\\*\\-\\+=\\?<>\\,\\.\\s]*");
+
 const QString VUtils::c_fileNameRegExp = QString("[^\\\\/:\\*\\?\"<>\\|]*");
 
 const QString VUtils::c_fencedCodeBlockStartRegExp = QString("^(\\s*)```([^`\\s]*)\\s*[^`]*$");
@@ -43,7 +45,7 @@ const QString VUtils::c_previewImageBlockRegExp = QString("[\\n|^][ |\\t]*\\xfff
 
 const QString VUtils::c_headerRegExp = QString("^(#{1,6})\\s+(((\\d+\\.)+(?=\\s))?\\s?\\S.*)\\s*$");
 
-const QString VUtils::c_headerPrefixRegExp = QString("^(#{1,6}\\s+((\\d+\\.)+(?=\\s))?\\s?)\\S.*\\s*$");
+const QString VUtils::c_headerPrefixRegExp = QString("^(#{1,6}\\s+((\\d+\\.)+(?=\\s))?\\s?)($|\\S.*\\s*$)");
 
 void VUtils::initAvailableLanguage()
 {
@@ -104,10 +106,10 @@ QRgb VUtils::QRgbFromString(const QString &str)
     return QRgb();
 }
 
-QString VUtils::generateImageFileName(const QString &path, const QString &title,
+QString VUtils::generateImageFileName(const QString &path,
+                                      const QString &title,
                                       const QString &format)
 {
-    Q_ASSERT(!title.isEmpty());
     QRegExp regExp("\\W");
     QString baseName(title.toLower());
 
@@ -117,7 +119,9 @@ QString VUtils::generateImageFileName(const QString &path, const QString &title,
     // Constrain the length of the name.
     baseName.truncate(10);
 
+    if (!baseName.isEmpty()) {
         baseName.prepend('_');
+    }
 
     // Add current time and random number to make the name be most likely unique
     baseName = baseName + '_' + QString::number(QDateTime::currentDateTime().toTime_t());
@@ -377,31 +381,35 @@ int VUtils::showMessage(QMessageBox::Icon p_icon, const QString &p_title, const
     return msgBox.exec();
 }
 
-QString VUtils::generateCopiedFileName(const QString &p_dirPath, const QString &p_fileName)
+QString VUtils::generateCopiedFileName(const QString &p_dirPath,
+                                       const QString &p_fileName,
+                                       bool p_completeBaseName)
 {
-    QString suffix;
+    QDir dir(p_dirPath);
-    QString base = p_fileName;
+    if (!dir.exists() || !dir.exists(p_fileName)) {
-    int dotIdx = p_fileName.lastIndexOf('.');
+        return p_fileName;
-    if (dotIdx != -1) {
-        // .md
-        suffix = p_fileName.right(p_fileName.size() - dotIdx);
-        base = p_fileName.left(dotIdx);
     }
 
-    QDir dir(p_dirPath);
+    QFileInfo fi(p_fileName);
-    QString name = p_fileName;
+    QString baseName = p_completeBaseName ? fi.completeBaseName() : fi.baseName();
+    QString suffix = p_completeBaseName ? fi.suffix() : fi.completeSuffix();
+
     int index = 0;
-    while (dir.exists(name)) {
+    QString fileName;
+    do {
         QString seq;
         if (index > 0) {
-            seq = QString::number(index);
+            seq = QString("%1").arg(QString::number(index), 3, '0');
         }
 
         index++;
-        name = QString("%1_copy%2%3").arg(base).arg(seq).arg(suffix);
+        fileName = QString("%1_copy%2").arg(baseName).arg(seq);
+        if (!suffix.isEmpty()) {
+            fileName = fileName + "." + suffix;
         }
+    } while (fileExists(dir, fileName, true));
 
-    return name;
+    return fileName;
 }
 
 QString VUtils::generateCopiedDirName(const QString &p_parentDirPath, const QString &p_dirName)
@@ -614,7 +622,8 @@ QString VUtils::generateHtmlTemplate(MarkdownConverterType p_conType, bool p_exp
 }
 
 QString VUtils::getFileNameWithSequence(const QString &p_directory,
-                                        const QString &p_baseFileName)
+                                        const QString &p_baseFileName,
+                                        bool p_completeBaseName)
 {
     QDir dir(p_directory);
     if (!dir.exists() || !dir.exists(p_baseFileName)) {
@@ -623,8 +632,8 @@ QString VUtils::getFileNameWithSequence(const QString &p_directory,
 
     // Append a sequence.
     QFileInfo fi(p_baseFileName);
-    QString baseName = fi.baseName();
+    QString baseName = p_completeBaseName ? fi.completeBaseName() : fi.baseName();
-    QString suffix = fi.completeSuffix();
+    QString suffix = p_completeBaseName ? fi.suffix() : fi.completeSuffix();
     int seq = 1;
     QString fileName;
     do {
@@ -637,6 +646,24 @@ QString VUtils::getFileNameWithSequence(const QString &p_directory,
     return fileName;
 }
 
+QString VUtils::getDirNameWithSequence(const QString &p_directory,
+                                       const QString &p_baseDirName)
+{
+    QDir dir(p_directory);
+    if (!dir.exists() || !dir.exists(p_baseDirName)) {
+        return p_baseDirName;
+    }
+
+    // Append a sequence.
+    int seq = 1;
+    QString fileName;
+    do {
+        fileName = QString("%1_%2").arg(p_baseDirName).arg(QString::number(seq++), 3, '0');
+    } while (fileExists(dir, fileName, true));
+
+    return fileName;
+}
+
 QString VUtils::getRandomFileName(const QString &p_directory)
 {
     Q_ASSERT(!p_directory.isEmpty());
@@ -702,6 +729,16 @@ bool VUtils::checkPathLegal(const QString &p_path)
     return ret;
 }
 
+bool VUtils::checkFileNameLegal(const QString &p_name)
+{
+    if (p_name.isEmpty()) {
+        return false;
+    }
+
+    QRegExp exp(c_fileNameRegExp);
+    return exp.exactMatch(p_name);
+}
+
 bool VUtils::equalPath(const QString &p_patha, const QString &p_pathb)
 {
     QString a = QDir::cleanPath(p_patha);
@@ -850,7 +887,8 @@ bool VUtils::deleteFile(const QString &p_recycleBinFolderPath,
     }
 
     QString destName = getFileNameWithSequence(binPath,
-                                               fileNameFromPath(p_path));
+                                               fileNameFromPath(p_path),
+                                               true);
 
     qDebug() << "try to move" << p_path << "to" << binPath << "as" << destName;
     if (!binDir.rename(p_path, binDir.filePath(destName))) {
@@ -935,3 +973,30 @@ void VUtils::addErrMsg(QString *p_msg, const QString &p_str)
         *p_msg = *p_msg + '\n' + p_str;
     }
 }
+
+QStringList VUtils::filterFilePathsToOpen(const QStringList &p_files)
+{
+    QStringList paths;
+    for (int i = 0; i < p_files.size(); ++i) {
+        QString path = validFilePathToOpen(p_files[i]);
+        if (!path.isEmpty()) {
+            paths.append(path);
+        }
+    }
+
+    return paths;
+}
+
+QString VUtils::validFilePathToOpen(const QString &p_file)
+{
+    if (QFileInfo::exists(p_file)) {
+        QFileInfo fi(p_file);
+        if (fi.isFile()) {
+            // Need to use absolute path here since VNote may be launched
+            // in different working directory.
+            return QDir::cleanPath(fi.absoluteFilePath());
+        }
+    }
+
+    return QString();
+}

src/utils/vutils.h

@@ -20,6 +20,32 @@ class VNotebook;
     #define V_ASSERT(cond) ((!(cond)) ? qt_assert(#cond, __FILE__, __LINE__) : qt_noop())
 #endif
 
+// Thanks to CGAL/cgal.
+#ifndef __has_attribute
+    #define __has_attribute(x) 0  // Compatibility with non-clang compilers.
+#endif
+
+#ifndef __has_cpp_attribute
+  #define __has_cpp_attribute(x) 0  // Compatibility with non-supporting compilers.
+#endif
+
+// The fallthrough attribute.
+// See for clang:
+//   http://clang.llvm.org/docs/AttributeReference.html#statement-attributes
+// See for gcc:
+//   https://gcc.gnu.org/onlinedocs/gcc/Warning-Options.html
+#if __has_cpp_attribute(fallthrough)
+#  define V_FALLTHROUGH [[fallthrough]]
+#elif __has_cpp_attribute(gnu::fallthrough)
+#  define V_FALLTHROUGH [[gnu::fallthrough]]
+#elif __has_cpp_attribute(clang::fallthrough)
+#  define V_FALLTHROUGH [[clang::fallthrough]]
+#elif __has_attribute(fallthrough) && ! __clang__
+#  define V_FALLTHROUGH __attribute__ ((fallthrough))
+#else
+#  define V_FALLTHROUGH while(false){}
+#endif
+
 enum class MessageBoxType
 {
     Normal = 0,
@@ -54,9 +80,19 @@ public:
 
     // Given the file name @p_fileName and directory path @p_dirPath, generate
     // a file name based on @p_fileName which does not exist in @p_dirPath.
-    static QString generateCopiedFileName(const QString &p_dirPath, const QString &p_fileName);
+    // @p_completeBaseName: use complete base name or complete suffix. For example,
+    // "abc.tar.gz", if @p_completeBaseName is true, the base name is "abc.tar",
+    // otherwise, it is "abc".
+    static QString generateCopiedFileName(const QString &p_dirPath,
+                                          const QString &p_fileName,
+                                          bool p_completeBaseName = true);
+
+    // Given the directory name @p_dirName and directory path @p_parentDirPath,
+    // generate a directory name based on @p_dirName which does not exist in
+    // @p_parentDirPath.
+    static QString generateCopiedDirName(const QString &p_parentDirPath,
+                                         const QString &p_dirName);
 
-    static QString generateCopiedDirName(const QString &p_parentDirPath, const QString &p_dirName);
     static void processStyle(QString &style, const QVector<QPair<QString, QString> > &varMap);
 
     // Return the last directory name of @p_path.
@@ -122,8 +158,18 @@ public:
     // Get an available file name in @p_directory with base @p_baseFileName.
     // If there already exists a file named @p_baseFileName, try to add sequence
     // suffix to the name, such as _001.
+    // @p_completeBaseName: use complete base name or complete suffix. For example,
+    // "abc.tar.gz", if @p_completeBaseName is true, the base name is "abc.tar",
+    // otherwise, it is "abc".
     static QString getFileNameWithSequence(const QString &p_directory,
-                                           const QString &p_baseFileName);
+                                           const QString &p_baseFileName,
+                                           bool p_completeBaseName = true);
+
+    // Get an available directory name in @p_directory with base @p_baseDirName.
+    // If there already exists a file named @p_baseFileName, try to add sequence
+    // suffix to the name, such as _001.
+    static QString getDirNameWithSequence(const QString &p_directory,
+                                          const QString &p_baseDirName);
 
     // Get an available random file name in @p_directory.
     static QString getRandomFileName(const QString &p_directory);
@@ -131,6 +177,9 @@ public:
     // Try to check if @p_path is legal.
     static bool checkPathLegal(const QString &p_path);
 
+    // Check if file/folder name is legal.
+    static bool checkFileNameLegal(const QString &p_name);
+
     // Returns true if @p_patha and @p_pathb points to the same file/directory.
     static bool equalPath(const QString &p_patha, const QString &p_pathb);
 
@@ -186,6 +235,13 @@ public:
     // Assign @p_str to @p_msg if it is not NULL.
     static void addErrMsg(QString *p_msg, const QString &p_str);
 
+    // Check each file of @p_files and return valid ones for VNote to open.
+    static QStringList filterFilePathsToOpen(const QStringList &p_files);
+
+    // Return the normalized file path of @p_file if it is valid to open.
+    // Return empty if it is not valid.
+    static QString validFilePathToOpen(const QString &p_file);
+
     // Regular expression for image link.
     // ![image title]( http://github.com/tamlok/vnote.jpg "alt \" text" )
     // Captured texts (need to be trimmed):
@@ -195,6 +251,9 @@ public:
     // 4. Unused;
     static const QString c_imageLinkRegExp;
 
+    // Regular expression for image title.
+    static const QString c_imageTitleRegExp;
+
     // Regular expression for file/directory name.
     // Forbidden char: \/:*?"<>|
     static const QString c_fileNameRegExp;

src/utils/vvim.cpp

@@ -18,6 +18,7 @@ extern VConfigManager *g_config;
 const QChar VVim::c_unnamedRegister = QChar('"');
 const QChar VVim::c_blackHoleRegister = QChar('_');
 const QChar VVim::c_selectionRegister = QChar('+');
+QMap<QChar, VVim::Register> VVim::s_registers;
 
 const int VVim::SearchHistory::c_capacity = 50;
 
@@ -170,62 +171,6 @@ static void findCurrentSpace(const QTextCursor &p_cursor, int &p_start, int &p_e
     p_end += block.position();
 }
 
-// Find the start and end of the word @p_cursor locates in (within a single block).
-// @p_start and @p_end will be the global position of the start and end of the word.
-// @p_start will equals to @p_end if @p_cursor is a space.
-static void findCurrentWord(QTextCursor p_cursor, int &p_start, int &p_end)
-{
-    QString text = p_cursor.block().text();
-    int pib = p_cursor.positionInBlock();
-
-    if (pib < text.size() && text[pib].isSpace()) {
-        p_start = p_end = p_cursor.position();
-        return;
-    }
-
-    p_cursor.movePosition(QTextCursor::StartOfWord);
-    p_start = p_cursor.position();
-    p_cursor.movePosition(QTextCursor::EndOfWord);
-    p_end = p_cursor.position();
-}
-
-// Find the start and end of the WORD @p_cursor locates in (within a single block).
-// @p_start and @p_end will be the global position of the start and end of the WORD.
-// @p_start will equals to @p_end if @p_cursor is a space.
-// Attention: www|sss will select www, which is different from findCurrentWord().
-static void findCurrentWORD(const QTextCursor &p_cursor, int &p_start, int &p_end)
-{
-    QTextBlock block = p_cursor.block();
-    QString text = block.text();
-    int pib = p_cursor.positionInBlock();
-
-    if (pib < text.size() && text[pib].isSpace()) {
-        p_start = p_end = p_cursor.position();
-        return;
-    }
-
-    // Find the start.
-    p_start = 0;
-    for (int i = pib - 1; i >= 0; --i) {
-        if (text[i].isSpace()) {
-            p_start = i + 1;
-            break;
-        }
-    }
-
-    // Find the end.
-    p_end = block.length() - 1;
-    for (int i = pib; i < text.size(); ++i) {
-        if (text[i].isSpace()) {
-            p_end = i;
-            break;
-        }
-    }
-
-    p_start += block.position();
-    p_end += block.position();
-}
-
 // Move @p_cursor to skip spaces if current cursor is placed at a space
 // (may move across blocks). It will stop by the empty block on the way.
 // Forward: wwwwsssss|wwww
@@ -351,7 +296,7 @@ static void insertChangeBlockAfterDeletion(QTextCursor &p_cursor, int p_deletion
     }
 
     if (g_config->getAutoIndent()) {
-        VEditUtils::indentBlockAsPreviousBlock(p_cursor);
+        VEditUtils::indentBlockAsBlock(p_cursor, false);
     }
 }
 
@@ -556,7 +501,7 @@ bool VVim::handleKeyPressEvent(int key, int modifiers, int *p_autoIndentPos)
             QChar reg = keyToRegisterName(keyInfo);
             if (!reg.isNull()) {
                 // Insert register content.
-                m_editor->insertPlainText(m_registers[reg].read());
+                m_editor->insertPlainText(getRegister(reg).read());
             }
 
             goto clear_accept;
@@ -602,11 +547,12 @@ bool VVim::handleKeyPressEvent(int key, int modifiers, int *p_autoIndentPos)
         QChar reg = keyToRegisterName(keyInfo);
         if (!reg.isNull()) {
             m_keys.clear();
-            setRegister(reg);
+            setCurrentRegisterName(reg);
-            if (m_registers[reg].isNamedRegister()) {
+            Register &r = getRegister(reg);
-                m_registers[reg].m_append = (modifiers == Qt::ShiftModifier);
+            if (r.isNamedRegister()) {
+                r.m_append = (modifiers == Qt::ShiftModifier);
             } else {
-                Q_ASSERT(!m_registers[reg].m_append);
+                Q_ASSERT(!r.m_append);
             }
 
             goto accept;
@@ -965,7 +911,7 @@ bool VVim::handleKeyPressEvent(int key, int modifiers, int *p_autoIndentPos)
 
                 bool textInserted = false;
                 if (g_config->getAutoIndent()) {
-                    textInserted = VEditUtils::indentBlockAsPreviousBlock(cursor);
+                    textInserted = VEditUtils::indentBlockAsBlock(cursor, false);
                     if (g_config->getAutoList()) {
                         textInserted = VEditUtils::insertListMarkAsPreviousBlock(cursor)
                                        || textInserted;
@@ -1115,6 +1061,8 @@ bool VVim::handleKeyPressEvent(int key, int modifiers, int *p_autoIndentPos)
         } else {
             break;
         }
+
+        V_FALLTHROUGH;
     }
 
     case Qt::Key_PageUp:
@@ -1381,6 +1329,8 @@ bool VVim::handleKeyPressEvent(int key, int modifiers, int *p_autoIndentPos)
         } else {
             break;
         }
+
+        V_FALLTHROUGH;
     }
 
     case Qt::Key_Escape:
@@ -2219,7 +2169,7 @@ void VVim::resetState()
     m_keys.clear();
     m_tokens.clear();
     m_pendingKeys.clear();
-    setRegister(c_unnamedRegister);
+    setCurrentRegisterName(c_unnamedRegister);
     m_resetPositionInBlock = true;
     m_registerPending = false;
 }
@@ -2723,7 +2673,7 @@ bool VVim::processMovement(QTextCursor &p_cursor,
         for (int i = 0; i < p_repeat; ++i) {
             int start, end;
             // [start, end] is current WORD.
-            findCurrentWORD(p_cursor, start, end);
+            VEditUtils::findCurrentWORD(p_cursor, start, end);
 
             // Move cursor to end of current WORD.
             p_cursor.setPosition(end, p_moveMode);
@@ -2773,7 +2723,7 @@ bool VVim::processMovement(QTextCursor &p_cursor,
 
             int start, end;
             // [start, end] is current WORD.
-            findCurrentWORD(p_cursor, start, end);
+            VEditUtils::findCurrentWORD(p_cursor, start, end);
 
             // Move cursor to the end of current WORD.
             p_cursor.setPosition(end, p_moveMode);
@@ -2819,7 +2769,7 @@ bool VVim::processMovement(QTextCursor &p_cursor,
 
             int start, end;
             // [start, end] is current WORD.
-            findCurrentWORD(p_cursor, start, end);
+            VEditUtils::findCurrentWORD(p_cursor, start, end);
 
             // Move cursor to the start of current WORD.
             p_cursor.setPosition(start, p_moveMode);
@@ -2856,7 +2806,7 @@ bool VVim::processMovement(QTextCursor &p_cursor,
 
         for (int i = 0; i < p_repeat; ++i) {
             int start, end;
-            findCurrentWORD(p_cursor, start, end);
+            VEditUtils::findCurrentWORD(p_cursor, start, end);
 
             p_cursor.setPosition(start, p_moveMode);
 
@@ -3045,7 +2995,7 @@ handle_target:
         // Different from Vim:
         // We do not recognize a word as strict as Vim.
         int start, end;
-        findCurrentWord(p_cursor, start, end);
+        VEditUtils::findCurrentWord(p_cursor, start, end);
         if (start == end) {
             // Spaces, find next word.
             QTextCursor cursor = p_cursor;
@@ -3056,7 +3006,7 @@ handle_target:
                 }
 
                 if (!doc->characterAt(cursor.position()).isSpace()) {
-                    findCurrentWord(cursor, start, end);
+                    VEditUtils::findCurrentWord(cursor, start, end);
                     Q_ASSERT(start != end);
                     break;
                 }
@@ -3181,7 +3131,7 @@ bool VVim::selectRange(QTextCursor &p_cursor, const QTextDocument *p_doc,
         Q_ASSERT(p_repeat == -1);
         bool spaces = false;
         int start, end;
-        findCurrentWord(p_cursor, start, end);
+        VEditUtils::findCurrentWord(p_cursor, start, end);
 
         if (start == end) {
             // Select the space between previous word and next word.
@@ -3221,7 +3171,7 @@ bool VVim::selectRange(QTextCursor &p_cursor, const QTextDocument *p_doc,
         findCurrentSpace(p_cursor, start, end);
 
         if (start == end) {
-            findCurrentWORD(p_cursor, start, end);
+            VEditUtils::findCurrentWORD(p_cursor, start, end);
         } else {
             // Select the space between previous WORD and next WORD.
             spaces = true;
@@ -3240,7 +3190,7 @@ bool VVim::selectRange(QTextCursor &p_cursor, const QTextDocument *p_doc,
                         moveCursorAcrossSpaces(p_cursor, moveMode, true);
 
                         // [start, end] is current WORD.
-                        findCurrentWORD(p_cursor, start, end);
+                        VEditUtils::findCurrentWORD(p_cursor, start, end);
 
                         // Move cursor to the end of current WORD.
                         p_cursor.setPosition(end, moveMode);
@@ -3481,6 +3431,8 @@ void VVim::processDeleteAction(QList<Token> &p_tokens)
                 // Fall through.
                 mayCrossBlock = true;
 
+                V_FALLTHROUGH;
+
             case Range::WordAround:
                 // Fall through.
             case Range::WordInner:
@@ -3712,6 +3664,8 @@ void VVim::processCopyAction(QList<Token> &p_tokens)
                 // Fall through.
                 mayCrossBlock = true;
 
+                V_FALLTHROUGH;
+
             case Range::WordAround:
                 // Fall through.
             case Range::WordInner:
@@ -3873,7 +3827,7 @@ void VVim::processPasteAction(QList<Token> &p_tokens, bool p_pasteBefore)
         repeat = to.m_repeat;
     }
 
-    Register &reg = m_registers[m_regName];
+    Register &reg = getRegister(m_regName);
     QString value = reg.read();
     bool isBlock = reg.isBlock();
     if (value.isEmpty()) {
@@ -4847,14 +4801,17 @@ void VVim::expandSelectionToWholeLines(QTextCursor &p_cursor)
 
 void VVim::initRegisters()
 {
-    m_registers.clear();
+    if (!s_registers.isEmpty()) {
-    for (char ch = 'a'; ch <= 'z'; ++ch) {
+        return;
-        m_registers[QChar(ch)] = Register(QChar(ch));
     }
 
-    m_registers[c_unnamedRegister] = Register(c_unnamedRegister);
+    for (char ch = 'a'; ch <= 'z'; ++ch) {
-    m_registers[c_blackHoleRegister] = Register(c_blackHoleRegister);
+        s_registers[QChar(ch)] = Register(QChar(ch));
-    m_registers[c_selectionRegister] = Register(c_selectionRegister);
+    }
+
+    s_registers[c_unnamedRegister] = Register(c_unnamedRegister);
+    s_registers[c_blackHoleRegister] = Register(c_blackHoleRegister);
+    s_registers[c_selectionRegister] = Register(c_selectionRegister);
 }
 
 bool VVim::expectingRegisterName() const
@@ -5137,12 +5094,12 @@ void VVim::saveToRegister(const QString &p_text)
 
     qDebug() << QString("save text(%1) to register(%2)").arg(text).arg(m_regName);
 
-    Register &reg = m_registers[m_regName];
+    Register &reg = getRegister(m_regName);
     reg.update(text);
 
     if (!reg.isBlackHoleRegister() && !reg.isUnnamedRegister()) {
         // Save it to unnamed register.
-        m_registers[c_unnamedRegister].update(reg.m_value);
+        setRegister(c_unnamedRegister, reg.m_value);
     }
 }
 
@@ -5249,7 +5206,7 @@ void VVim::message(const QString &p_msg)
 
 const QMap<QChar, VVim::Register> &VVim::getRegisters() const
 {
-    return m_registers;
+    return s_registers;
 }
 
 const VVim::Marks &VVim::getMarks() const
@@ -5272,7 +5229,7 @@ QString VVim::getPendingKeys() const
     return str;
 }
 
-void VVim::setRegister(QChar p_reg)
+void VVim::setCurrentRegisterName(QChar p_reg)
 {
     m_regName = p_reg;
 }
@@ -5785,7 +5742,7 @@ QString VVim::readRegister(int p_key, int p_modifiers)
     Key keyInfo(p_key, p_modifiers);
     QChar reg = keyToRegisterName(keyInfo);
     if (!reg.isNull()) {
-        return m_registers[reg].read();
+        return getRegister(reg).read();
     }
 
     return "";

src/utils/vvim.h

@@ -166,7 +166,7 @@ public:
     void setMode(VimMode p_mode, bool p_clearSelection = true);
 
     // Set current register.
-    void setRegister(QChar p_reg);
+    void setCurrentRegisterName(QChar p_reg);
 
     // Get m_registers.
     const QMap<QChar, Register> &getRegisters() const;
@@ -797,6 +797,10 @@ private:
     // Clear search highlight.
     void clearSearchHighlight();
 
+    // Function utils for register.
+    Register &getRegister(QChar p_regName) const;
+    void setRegister(QChar p_regName, const QString &p_val);
+
     VEdit *m_editor;
     const VEditConfig *m_editConfig;
     VimMode m_mode;
@@ -814,8 +818,6 @@ private:
     // Whether reset the position in block when moving cursor.
     bool m_resetPositionInBlock;
 
-    QMap<QChar, Register> m_registers;
-
     // Currently used register.
     QChar m_regName;
 
@@ -843,6 +845,18 @@ private:
     static const QChar c_unnamedRegister;
     static const QChar c_blackHoleRegister;
     static const QChar c_selectionRegister;
+
+    static QMap<QChar, VVim::Register> s_registers;
 };
 
+inline VVim::Register &VVim::getRegister(QChar p_regName) const
+{
+    return s_registers[p_regName];
+}
+
+inline void VVim::setRegister(QChar p_regName, const QString &p_val)
+{
+    s_registers[p_regName].update(p_val);
+}
+
 #endif // VVIM_H

src/vattachmentlist.cpp

@@ -5,13 +5,12 @@
 #include "vconfigmanager.h"
 #include "utils/vutils.h"
 #include "vbuttonwithwidget.h"
-#include "vnote.h"
 #include "vmainwindow.h"
 #include "dialog/vconfirmdeletiondialog.h"
 #include "dialog/vsortdialog.h"
 
 extern VConfigManager *g_config;
-extern VNote *g_vnote;
+extern VMainWindow *g_mainWin;
 
 VAttachmentList::VAttachmentList(QWidget *p_parent)
     : QWidget(p_parent), m_file(NULL)
@@ -53,7 +52,7 @@ void VAttachmentList::setupUI()
                                                     .arg(m_file->fetchAttachmentFolderPath()),
                                                   QMessageBox::Ok | QMessageBox::Cancel,
                                                   QMessageBox::Ok,
-                                                  g_vnote->getMainWindow(),
+                                                  g_mainWin,
                                                   MessageBoxType::Danger);
                     if (ret == QMessageBox::Ok) {
                         if (!m_file->deleteAttachments()) {
@@ -66,7 +65,7 @@ void VAttachmentList::setupUI()
                                                    "maintain the configuration file manually."),
                                                 QMessageBox::Ok,
                                                 QMessageBox::Ok,
-                                                g_vnote->getMainWindow());
+                                                g_mainWin);
                         }
 
                         m_attachmentList->clear();
@@ -204,7 +203,7 @@ void VAttachmentList::addAttachment()
     }
 
     static QString lastPath = QDir::homePath();
-    QStringList files = QFileDialog::getOpenFileNames(g_vnote->getMainWindow(),
+    QStringList files = QFileDialog::getOpenFileNames(g_mainWin,
                                                       tr("Select Files As Attachments"),
                                                       lastPath);
     if (files.isEmpty()) {
@@ -236,14 +235,14 @@ void VAttachmentList::addAttachments(const QStringList &p_files)
                                 "",
                                 QMessageBox::Ok,
                                 QMessageBox::Ok,
-                                g_vnote->getMainWindow());
+                                g_mainWin);
         } else {
             ++addedFiles;
         }
     }
 
     if (addedFiles > 0) {
-        g_vnote->getMainWindow()->showStatusMessage(tr("%1 %2 added as attachments")
+        g_mainWin->showStatusMessage(tr("%1 %2 added as attachments")
                                      .arg(addedFiles)
                                      .arg(addedFiles > 1 ? tr("files") : tr("file")));
     }
@@ -330,7 +329,7 @@ void VAttachmentList::deleteSelectedItems()
                                   false,
                                   false,
                                   false,
-                                  g_vnote->getMainWindow());
+                                  g_mainWin);
     if (dialog.exec()) {
         items = dialog.getConfirmedItems();
 
@@ -349,7 +348,7 @@ void VAttachmentList::deleteSelectedItems()
                                    "maintain the configuration file manually."),
                                 QMessageBox::Ok,
                                 QMessageBox::Ok,
-                                g_vnote->getMainWindow());
+                                g_mainWin);
         }
 
         updateButtonState();
@@ -370,7 +369,7 @@ void VAttachmentList::sortItems()
                           "in the configuration file.")
                          .arg(g_config->c_dataTextStyle)
                          .arg(m_file->getName()),
-                       g_vnote->getMainWindow());
+                       g_mainWin);
     QTreeWidget *tree = dialog.getTreeWidget();
     tree->clear();
     tree->setColumnCount(1);
@@ -624,7 +623,7 @@ void VAttachmentList::checkAttachments()
                                   false,
                                   false,
                                   false,
-                                  g_vnote->getMainWindow());
+                                  g_mainWin);
     if (dialog.exec()) {
         items = dialog.getConfirmedItems();
 
@@ -643,7 +642,7 @@ void VAttachmentList::checkAttachments()
                                    "maintain the configuration file manually."),
                                 QMessageBox::Ok,
                                 QMessageBox::Ok,
-                                g_vnote->getMainWindow());
+                                g_mainWin);
         }
 
         updateButtonState();

src/vcaptain.cpp

@@ -1,6 +1,5 @@
 #include <QtWidgets>
 #include <QString>
-#include <QTimer>
 #include <QDebug>
 #include <QShortcut>
 #include "vcaptain.h"
@@ -9,38 +8,39 @@
 #include "vedittab.h"
 #include "vfilelist.h"
 #include "vnavigationmode.h"
+#include "vconfigmanager.h"
+
+extern VMainWindow *g_mainWin;
+
+extern VConfigManager *g_config;
 
 // 3s pending time after the leader keys.
 const int c_pendingTime = 3 * 1000;
 
-#if defined(QT_NO_DEBUG)
+VCaptain::VCaptain(QWidget *p_parent)
-extern QFile g_logFile;
+    : QWidget(p_parent),
-#endif
+      m_mode(CaptainMode::Normal),
-
+      m_widgetBeforeNavigation(NULL),
-VCaptain::VCaptain(VMainWindow *p_parent)
+      m_nextMajorKey('a'),
-    : QWidget(p_parent), m_mainWindow(p_parent), m_mode(VCaptain::Normal),
+      m_ignoreFocusChange(false),
-      m_widgetBeforeCaptain(NULL), m_nextMajorKey('a'), m_ignoreFocusChange(false)
+      m_leaderKey(g_config->getShortcutKeySequence("CaptainMode"))
 {
-    m_pendingTimer = new QTimer(this);
+    Q_ASSERT(!m_leaderKey.isEmpty());
-    m_pendingTimer->setSingleShot(true);
-    m_pendingTimer->setInterval(c_pendingTime);
-    connect(m_pendingTimer, &QTimer::timeout,
-            this, &VCaptain::pendingTimerTimeout);
 
     connect(qApp, &QApplication::focusChanged,
             this, &VCaptain::handleFocusChanged);
 
-    QShortcut *shortcut = new QShortcut(QKeySequence("Ctrl+E"), this,
-                                        Q_NULLPTR, Q_NULLPTR);
-    connect(shortcut, &QShortcut::activated,
-            this, &VCaptain::trigger);
-
-    qApp->installEventFilter(this);
-
     setWindowFlags(Qt::FramelessWindowHint);
+
     // Make it as small as possible. This widget will stay at the top-left corner
     // of VMainWindow.
     resize(1, 1);
+
+    // Register Navigation mode as Captain mode target.
+    registerCaptainTarget(tr("NavigationMode"),
+                          g_config->getCaptainShortcutKeySequence("NavigationMode"),
+                          this,
+                          navigationModeByCaptain);
 }
 
 QChar VCaptain::getNextMajorKey()
@@ -59,39 +59,19 @@ void VCaptain::registerNavigationTarget(VNavigationMode *p_target)
     QChar key = getNextMajorKey();
     if (!key.isNull()) {
         p_target->registerNavigation(key);
-        m_targets.append(NaviModeTarget(p_target, true));
+        m_naviTargets.push_back(NaviModeTarget(p_target, true));
     }
 }
 
-// In pending mode, if user click other widgets, we need to exit Captain mode.
+void VCaptain::handleFocusChanged(QWidget *p_old, QWidget * p_now)
-void VCaptain::handleFocusChanged(QWidget *p_old, QWidget * /* p_now */)
 {
-    if (!m_ignoreFocusChange && p_old == this) {
+    Q_UNUSED(p_now);
-        exitCaptainMode();
-    }
-}
 
-void VCaptain::pendingTimerTimeout()
+    if (!m_ignoreFocusChange
-{
+        && !checkMode(CaptainMode::Normal)
-    qDebug() << "Captain mode timeout";
+        && p_old == this) {
-    exitCaptainMode();
+        exitNavigationMode();
-    restoreFocus();
     }
-
-void VCaptain::trigger()
-{
-    if (m_mode != VCaptain::Normal) {
-        return;
-    }
-    qDebug() << "trigger Captain mode";
-    // Focus to listen pending key press.
-    m_widgetBeforeCaptain = QApplication::focusWidget();
-    setFocus();
-    m_mode = VCaptain::Pending;
-    m_pendingTimer->stop();
-    m_pendingTimer->start();
-
-    emit captainModeChanged(true);
 }
 
 void VCaptain::keyPressEvent(QKeyEvent *p_event)
@@ -99,13 +79,6 @@ void VCaptain::keyPressEvent(QKeyEvent *p_event)
     int key = p_event->key();
     Qt::KeyboardModifiers modifiers = p_event->modifiers();
 
-    if (m_mode == VCaptain::Normal) {
-        // Should not in focus while in Normal mode.
-        QWidget::keyPressEvent(p_event);
-        m_mainWindow->focusNextChild();
-        return;
-    }
-
     if (key == Qt::Key_Control || key == Qt::Key_Shift) {
         QWidget::keyPressEvent(p_event);
         return;
@@ -120,230 +93,28 @@ void VCaptain::keyPressEvent(QKeyEvent *p_event)
 
 bool VCaptain::handleKeyPress(int p_key, Qt::KeyboardModifiers p_modifiers)
 {
-    bool ret = true;
+    if (!checkMode(CaptainMode::Navigation)) {
+        return false;
+    }
 
     if (p_key == Qt::Key_Escape
         || (p_key == Qt::Key_BracketLeft
             && p_modifiers == Qt::ControlModifier)) {
-        goto exit;
+        exitNavigationMode();
+        return true;
     }
 
-    m_ignoreFocusChange = true;
+    return handleKeyPressNavigationMode(p_key, p_modifiers);
-
-    if (m_mode == VCaptainMode::Navigation) {
-        ret = handleKeyPressNavigationMode(p_key, p_modifiers);
-        m_ignoreFocusChange = false;
-        return ret;
-    }
-
-    // In Captain mode, Ctrl key won't make a difference.
-    switch (p_key) {
-    case Qt::Key_1:
-    case Qt::Key_2:
-    case Qt::Key_3:
-    case Qt::Key_4:
-    case Qt::Key_5:
-    case Qt::Key_6:
-    case Qt::Key_7:
-    case Qt::Key_8:
-    case Qt::Key_9:
-    {
-        // Switch to tab <i>.
-        VEditWindow *win = m_mainWindow->editArea->getCurrentWindow();
-        if (win) {
-            int sequence = p_key - Qt::Key_0;
-            if (win->activateTab(sequence)) {
-                m_widgetBeforeCaptain = NULL;
-            }
-        }
-        break;
-    }
-
-    case Qt::Key_0:
-    {
-        // Alternate the tab.
-        VEditWindow *win = m_mainWindow->editArea->getCurrentWindow();
-        if (win) {
-            if (win->alternateTab()) {
-                m_widgetBeforeCaptain = NULL;
-            }
-        }
-        break;
-    }
-
-    case Qt::Key_A:
-    {
-        // Show attachment list of current note.
-        m_mainWindow->showAttachmentList();
-        break;
-    }
-
-    case Qt::Key_D:
-        // Locate current tab.
-        if (m_mainWindow->locateCurrentFile()) {
-            m_widgetBeforeCaptain = NULL;
-        }
-
-        break;
-
-    case Qt::Key_E:
-        // Toggle expand view.
-        m_mainWindow->expandViewAct->trigger();
-        break;
-
-    case Qt::Key_F:
-    {
-        // Show current window's opened file list.
-        VEditWindow *win = m_mainWindow->editArea->getCurrentWindow();
-        if (win) {
-            if (win->showOpenedFileList()) {
-                // showOpenedFileList() already focus the right widget.
-                m_widgetBeforeCaptain = NULL;
-            }
-        }
-        break;
-    }
-
-    case Qt::Key_H:
-    {
-        if (p_modifiers & Qt::ShiftModifier) {
-            // Move current tab one split left.
-            m_mainWindow->editArea->moveCurrentTabOneSplit(false);
-        } else {
-            // Focus previous window split.
-            int idx = m_mainWindow->editArea->focusNextWindow(-1);
-            if (idx > -1) {
-                m_widgetBeforeCaptain = NULL;
-            }
-        }
-        break;
-    }
-
-    case Qt::Key_J:
-    {
-        // Focus next tab.
-        VEditWindow *win = m_mainWindow->editArea->getCurrentWindow();
-        if (win) {
-            win->focusNextTab(true);
-            // focusNextTab() will focus the right widget.
-            m_widgetBeforeCaptain = NULL;
-        }
-        break;
-    }
-
-    case Qt::Key_K:
-    {
-        // Focus previous tab.
-        VEditWindow *win = m_mainWindow->editArea->getCurrentWindow();
-        if (win) {
-            win->focusNextTab(false);
-            // focusNextTab() will focus the right widget.
-            m_widgetBeforeCaptain = NULL;
-        }
-        break;
-    }
-
-    case Qt::Key_L:
-    {
-        if (p_modifiers & Qt::ShiftModifier) {
-            // Move current tab one split right.
-            m_mainWindow->editArea->moveCurrentTabOneSplit(true);
-        } else {
-            // Focus next window split.
-            int idx = m_mainWindow->editArea->focusNextWindow(1);
-            if (idx > -1) {
-                m_widgetBeforeCaptain = NULL;
-            }
-        }
-        break;
-    }
-
-    case Qt::Key_P:
-        // Toggle one/two panel view.
-        m_mainWindow->toggleOnePanelView();
-        break;
-
-    case Qt::Key_Q:
-        // Discard changes and exit edit mode.
-        if (m_mainWindow->m_curFile) {
-            m_mainWindow->discardExitAct->trigger();
-        }
-        break;
-
-    case Qt::Key_R:
-    {
-        // Remove current window split.
-        m_mainWindow->editArea->removeCurrentWindow();
-
-        QWidget *nextFocus = m_mainWindow->editArea->currentEditTab();
-        m_widgetBeforeCaptain = nextFocus ? nextFocus : m_mainWindow->fileList;
-        break;
-    }
-
-    case Qt::Key_T:
-        // Toggle the Tools dock.
-        m_mainWindow->toolDock->setVisible(!m_mainWindow->toolDock->isVisible());
-        break;
-
-    case Qt::Key_V:
-        // Vertical split current window.
-        m_mainWindow->editArea->splitCurrentWindow();
-        // Do not restore focus.
-        m_widgetBeforeCaptain = NULL;
-        break;
-
-    case Qt::Key_W:
-        // Enter navigation mode.
-        triggerNavigationMode();
-        m_ignoreFocusChange = false;
-        return ret;
-
-    case Qt::Key_X:
-    {
-        // Close current tab.
-        m_mainWindow->closeCurrentFile();
-
-        // m_widgetBeforeCaptain may be the closed tab which will cause crash.
-        QWidget *nextFocus = m_mainWindow->editArea->currentEditTab();
-        m_widgetBeforeCaptain = nextFocus ? nextFocus : m_mainWindow->fileList;
-        break;
-    }
-
-    case Qt::Key_Question:
-    {
-        // Display shortcuts doc.
-        m_mainWindow->shortcutHelp();
-        m_widgetBeforeCaptain = NULL;
-        break;
-    }
-
-#if defined(QT_NO_DEBUG)
-    case Qt::Key_Comma:
-    {
-        // Flush g_logFile.
-        g_logFile.flush();
-        break;
-    }
-#endif
-
-    default:
-        // Not implemented yet. Just exit Captain mode.
-        break;
-    }
-
-exit:
-    exitCaptainMode();
-    restoreFocus();
-    return ret;
 }
 
 bool VCaptain::handleKeyPressNavigationMode(int p_key,
                                             Qt::KeyboardModifiers /* p_modifiers */)
 {
-    Q_ASSERT(m_mode == VCaptainMode::Navigation);
+    Q_ASSERT(m_mode == CaptainMode::Navigation);
     bool hasConsumed = false;
     bool pending = false;
-    for (auto &target : m_targets) {
+    m_ignoreFocusChange = true;
+    for (auto &target : m_naviTargets) {
         if (hasConsumed) {
             target.m_available = false;
             target.m_target->hideNavigation();
@@ -351,12 +122,13 @@ bool VCaptain::handleKeyPressNavigationMode(int p_key,
         }
         if (target.m_available) {
             bool succeed = false;
+            // May change focus, so we need to ignore focus change here.
             bool consumed = target.m_target->handleKeyNavigation(p_key, succeed);
             if (consumed) {
                 hasConsumed = true;
                 if (succeed) {
                     // Exit.
-                    m_widgetBeforeCaptain = NULL;
+                    m_widgetBeforeNavigation = NULL;
                 } else {
                     // Consumed but not succeed. Need more keys.
                     pending = true;
@@ -368,20 +140,23 @@ bool VCaptain::handleKeyPressNavigationMode(int p_key,
             }
         }
     }
+
+    m_ignoreFocusChange = false;
     if (pending) {
         return true;
     }
-    exitCaptainMode();
+
-    restoreFocus();
+    exitNavigationMode();
     return true;
 }
 
 void VCaptain::triggerNavigationMode()
 {
-    m_pendingTimer->stop();
+    setMode(CaptainMode::Navigation);
-    m_mode = VCaptainMode::Navigation;
+    m_widgetBeforeNavigation = QApplication::focusWidget();
-
+    // Focus to listen pending key press.
-    for (auto &target : m_targets) {
+    setFocus();
+    for (auto &target : m_naviTargets) {
         target.m_available = true;
         target.m_target->showNavigation();
     }
@@ -389,51 +164,74 @@ void VCaptain::triggerNavigationMode()
 
 void VCaptain::exitNavigationMode()
 {
-    m_mode = VCaptainMode::Normal;
+    setMode(CaptainMode::Normal);
 
-    for (auto &target : m_targets) {
+    for (auto &target : m_naviTargets) {
         target.m_available = true;
         target.m_target->hideNavigation();
     }
-}
 
-bool VCaptain::eventFilter(QObject *p_obj, QEvent *p_event)
-{
-    if (m_mode != VCaptain::Normal && p_event->type() == QEvent::Shortcut) {
-        qDebug() << "filter" << p_event;
-        QShortcutEvent *keyEve = dynamic_cast<QShortcutEvent *>(p_event);
-        Q_ASSERT(keyEve);
-        const QKeySequence &keys = keyEve->key();
-        if (keys.count() == 1) {
-            int key = keys[0];
-            Qt::KeyboardModifiers modifiers = Qt::KeyboardModifiers(key & (~0x01FFFFFFU));
-            key &= 0x01FFFFFFUL;
-            if (handleKeyPress(key, modifiers)) {
-                return true;
-            }
-        }
-        exitCaptainMode();
     restoreFocus();
 }
-    return QWidget::eventFilter(p_obj, p_event);
-}
 
 void VCaptain::restoreFocus()
 {
-    if (m_widgetBeforeCaptain) {
+    if (m_widgetBeforeNavigation) {
-        m_widgetBeforeCaptain->setFocus();
+        m_widgetBeforeNavigation->setFocus();
     }
 }
 
-void VCaptain::exitCaptainMode()
+bool VCaptain::registerCaptainTarget(const QString &p_name,
+                                     const QString &p_key,
+                                     void *p_target,
+                                     CaptainFunc p_func)
 {
-    if (m_mode == VCaptainMode::Navigation) {
+    if (p_key.isEmpty()) {
-        exitNavigationMode();
+        return false;
-    }
-    m_mode = VCaptain::Normal;
-    m_pendingTimer->stop();
-    m_ignoreFocusChange = false;
-
-    emit captainModeChanged(false);
     }
 
+    QString lowerKey = p_key.toLower();
+
+    if (m_captainTargets.contains(lowerKey)) {
+        return false;
+    }
+
+    // Register shortcuts.
+    QString sequence = QString("%1,%2").arg(m_leaderKey).arg(p_key);
+    QShortcut *shortcut = new QShortcut(QKeySequence(sequence),
+                                        this);
+    shortcut->setContext(Qt::ApplicationShortcut);
+
+    connect(shortcut, &QShortcut::activated,
+            this, std::bind(&VCaptain::triggerCaptainTarget, this, p_key));
+
+
+    CaptainModeTarget target(p_name,
+                             p_key,
+                             p_target,
+                             p_func,
+                             shortcut);
+    m_captainTargets.insert(lowerKey, target);
+
+    qDebug() << "registered:" << target.toString() << sequence;
+
+    return true;
+}
+
+void VCaptain::triggerCaptainTarget(const QString &p_key)
+{
+    auto it = m_captainTargets.find(p_key.toLower());
+    Q_ASSERT(it != m_captainTargets.end());
+    const CaptainModeTarget &target = it.value();
+
+    qDebug() << "triggered:" << target.toString();
+
+    target.m_function(target.m_target, nullptr);
+}
+
+void VCaptain::navigationModeByCaptain(void *p_target, void *p_data)
+{
+    Q_UNUSED(p_data);
+    VCaptain *obj = static_cast<VCaptain *>(p_target);
+    obj->triggerNavigationMode();
+}

src/vcaptain.h

@@ -1,77 +1,166 @@
 #ifndef VCAPTAIN_H
 #define VCAPTAIN_H
 
-#include <QWidget>
+#include <functional>
-#include <QList>
+
+#include <QWidget>
+#include <QVector>
+#include <QHash>
 
-class QTimer;
 class QKeyEvent;
-class VMainWindow;
-class QEvent;
 class VNavigationMode;
+class QShortcut;
+
+// void func(void *p_target, void *p_data);
+typedef std::function<void(void *, void *)> CaptainFunc;
 
 class VCaptain : public QWidget
 {
     Q_OBJECT
 public:
-    explicit VCaptain(VMainWindow *p_parent);
+    explicit VCaptain(QWidget *p_parent);
 
-    // Trigger Captain mode.
+    // Register a target for Navigation mode.
-    void trigger();
-
-    // Register a target for Navigation Mode.
     void registerNavigationTarget(VNavigationMode *p_target);
 
-signals:
+    // Register a target for Captain mode.
-    void captainModeChanged(bool p_enabled);
+    bool registerCaptainTarget(const QString &p_name,
+                               const QString &p_key,
+                               void *p_target,
+                               CaptainFunc p_func);
 
 protected:
     void keyPressEvent(QKeyEvent *p_event) Q_DECL_OVERRIDE;
-    bool eventFilter(QObject *p_obj, QEvent *p_event) Q_DECL_OVERRIDE;
-
-public slots:
 
 private slots:
-    void pendingTimerTimeout();
+    // Exit Navigation mode if focus lost.
     void handleFocusChanged(QWidget *p_old, QWidget *p_new);
 
 private:
-    // Restore the focus to m_widgetBeforeCaptain.
+    // A widget target for Navigation mode.
-    void restoreFocus();
+    struct NaviModeTarget {
-    void exitCaptainMode();
+        NaviModeTarget()
-    // Return true if finish handling the event; otherwise, let the base widget
+            : m_target(nullptr), m_available(false)
-    // to handle it.
+        {
-    bool handleKeyPress(int p_key, Qt::KeyboardModifiers p_modifiers);
+        }
-    bool handleKeyPressNavigationMode(int p_key,
-                                      Qt::KeyboardModifiers p_modifiers);
-    QChar getNextMajorKey();
-    void triggerNavigationMode();
-    void exitNavigationMode();
 
-    enum VCaptainMode {
+        NaviModeTarget(VNavigationMode *p_target, bool p_available)
+            : m_target(p_target), m_available(p_available)
+        {
+        }
+
+        VNavigationMode *m_target;
+        bool m_available;
+    };
+
+    // Modes.
+    enum class CaptainMode {
         Normal = 0,
         Pending,
         Navigation
     };
 
-    VMainWindow *m_mainWindow;
+    struct CaptainModeTarget {
-    QTimer *m_pendingTimer;
+        CaptainModeTarget()
-    int m_mode;
+            : m_target(nullptr), m_function(nullptr), m_shortcut(nullptr)
-    // The widget which has the focus before entering Captain mode.
+        {
-    QWidget* m_widgetBeforeCaptain;
+        }
 
-    struct NaviModeTarget {
+        CaptainModeTarget(const QString &p_name,
-        VNavigationMode *m_target;
+                          const QString &p_key,
-        bool m_available;
+                          void *p_target,
+                          CaptainFunc p_func,
+                          QShortcut *p_shortcut)
+            : m_name(p_name),
+              m_key(p_key),
+              m_target(p_target),
+              m_function(p_func),
+              m_shortcut(p_shortcut)
+        {
+        }
 
-        NaviModeTarget(VNavigationMode *p_target, bool p_available)
+        QString toString() const
-            : m_target(p_target), m_available(p_available) {}
+        {
+            return QString("Captain mode target %1 key[%2]").arg(m_name).arg(m_key);
+        }
+
+        // Name to display.
+        QString m_name;
+
+        // Key sequence to trigger this target.
+        // This is the sub-sequence after leader key.
+        QString m_key;
+
+        // Target.
+        void *m_target;
+
+        // Function to call when this target is trigger.
+        CaptainFunc m_function;
+
+        // Shortcut for this target.
+        QShortcut *m_shortcut;
     };
-    QList<NaviModeTarget> m_targets;
+
+    // Restore the focus to m_widgetBeforeNavigation.
+    void restoreFocus();
+
+    // Return true if finish handling the event; otherwise, let the base widget
+    // to handle it.
+    bool handleKeyPress(int p_key, Qt::KeyboardModifiers p_modifiers);
+
+    // Handle key press event in Navigation mode.
+    bool handleKeyPressNavigationMode(int p_key,
+                                      Qt::KeyboardModifiers p_modifiers);
+
+    // Get next major key to use for Navigation mode.
+    QChar getNextMajorKey();
+
+    // Trigger navigation mode to ask all targets show themselves.
+    void triggerNavigationMode();
+
+    // Exit navigation mode to ask all targets hide themselves.
+    void exitNavigationMode();
+
+    // Called to trigger the action of a Captain target which has
+    // registered @p_key.
+    void triggerCaptainTarget(const QString &p_key);
+
+    void setMode(CaptainMode p_mode);
+
+    bool checkMode(CaptainMode p_mode) const;
+
+    static void navigationModeByCaptain(void *p_target, void *p_data);
+
+    // Used to indicate whether we are in Navigation mode.
+    CaptainMode m_mode;
+
+    // The widget which has the focus before entering Navigation mode.
+    QWidget* m_widgetBeforeNavigation;
+
+    // Targets for Navigation mode.
+    QVector<NaviModeTarget> m_naviTargets;
+
     QChar m_nextMajorKey;
-    // Ignore focus change to avoid exiting Captain mode while handling key
+
-    // press.
+    // Targets for Captain mode.
+    // Key(lower) -> CaptainModeTarget.
+    QHash<QString, CaptainModeTarget> m_captainTargets;
+
+    // Ignore focus change during handling Navigation target actions.
     bool m_ignoreFocusChange;
+
+    // Leader key sequence for Captain mode.
+    QString m_leaderKey;
 };
 
+inline void VCaptain::setMode(CaptainMode p_mode)
+{
+    m_mode = p_mode;
+}
+
+inline bool VCaptain::checkMode(CaptainMode p_mode) const
+{
+    return m_mode == p_mode;
+}
+
 #endif // VCAPTAIN_H

src/vconfigmanager.cpp

@@ -8,52 +8,60 @@
 #include <QtDebug>
 #include <QTextEdit>
 #include <QStandardPaths>
+#include <QCoreApplication>
 #include "utils/vutils.h"
 #include "vstyleparser.h"
 
 const QString VConfigManager::orgName = QString("vnote");
+
 const QString VConfigManager::appName = QString("vnote");
+
 const QString VConfigManager::c_version = QString("1.9");
+
 const QString VConfigManager::c_obsoleteDirConfigFile = QString(".vnote.json");
+
 const QString VConfigManager::c_dirConfigFile = QString("_vnote.json");
-const QString VConfigManager::defaultConfigFilePath = QString(":/resources/vnote.ini");
+
+const QString VConfigManager::c_defaultConfigFilePath = QString(":/resources/vnote.ini");
+
+const QString VConfigManager::c_defaultConfigFile = QString("vnote.ini");
+
+const QString VConfigManager::c_sessionConfigFile = QString("session.ini");
+
 const QString VConfigManager::c_styleConfigFolder = QString("styles");
+
 const QString VConfigManager::c_codeBlockStyleConfigFolder = QString("codeblock_styles");
+
 const QString VConfigManager::c_defaultCssFile = QString(":/resources/styles/default.css");
+
 const QString VConfigManager::c_defaultCodeBlockCssFile = QString(":/utils/highlightjs/styles/vnote.css");
+
 const QString VConfigManager::c_defaultMdhlFile = QString(":/resources/styles/default.mdhl");
+
 const QString VConfigManager::c_solarizedDarkMdhlFile = QString(":/resources/styles/solarized-dark.mdhl");
+
 const QString VConfigManager::c_solarizedLightMdhlFile = QString(":/resources/styles/solarized-light.mdhl");
+
 const QString VConfigManager::c_warningTextStyle = QString("color: red; font: bold");
+
 const QString VConfigManager::c_dataTextStyle = QString("font: bold");
+
 const QString VConfigManager::c_dangerBtnStyle = QString("QPushButton {color: #fff; border-color: #d43f3a; background-color: #d9534f;}"
                                                          "QPushButton::hover {color: #fff; border-color: #ac2925; background-color: #c9302c;}");
+
 const QString VConfigManager::c_vnoteNotebookFolderName = QString("vnote_notebooks");
 
 VConfigManager::VConfigManager(QObject *p_parent)
-    : QObject(p_parent), userSettings(NULL), defaultSettings(NULL)
+    : QObject(p_parent),
+      userSettings(NULL),
+      defaultSettings(NULL),
+      m_sessionSettings(NULL)
 {
 }
 
-void VConfigManager::migrateIniFile()
-{
-    const QString originalFolder = "tamlok";
-    const QString newFolder = orgName;
-    QString configFolder = getConfigFolder();
-    QDir dir(configFolder);
-    dir.cdUp();
-    dir.rename(originalFolder, newFolder);
-    userSettings->sync();
-}
-
 void VConfigManager::initialize()
 {
-    Q_ASSERT(!userSettings && !defaultSettings);
+    initSettings();
-    userSettings = new QSettings(QSettings::IniFormat, QSettings::UserScope,
-                                 orgName, appName, this);
-    defaultSettings = new QSettings(defaultConfigFilePath, QSettings::IniFormat, this);
-
-    migrateIniFile();
 
     // Override the default css styles on start up.
     outputDefaultCssStyle();
@@ -68,7 +76,6 @@ void VConfigManager::initialize()
     m_templateCss = getConfigFromSettings("global", "template_css").toString();
     m_templateCodeBlockCss = getConfigFromSettings("global", "template_code_block_css").toString();
     m_templateCodeBlockCssUrl = getConfigFromSettings("global", "template_code_block_css_url").toString();
-    curNotebookIndex = getConfigFromSettings("global", "current_notebook").toInt();
 
     markdownExtensions = hoedown_extensions(HOEDOWN_EXT_TABLES | HOEDOWN_EXT_FENCED_CODE |
                                             HOEDOWN_EXT_HIGHLIGHT | HOEDOWN_EXT_AUTOLINK |
@@ -91,10 +98,7 @@ void VConfigManager::initialize()
     curRenderBackgroundColor = getConfigFromSettings("global",
                                                      "current_render_background_color").toString();
 
-    m_toolsDockChecked = getConfigFromSettings("session", "tools_dock_checked").toBool();
+    m_toolsDockChecked = getConfigFromSettings("global", "tools_dock_checked").toBool();
-    m_mainWindowGeometry = getConfigFromSettings("session", "main_window_geometry").toByteArray();
-    m_mainWindowState = getConfigFromSettings("session", "main_window_state").toByteArray();
-    m_mainSplitterState = getConfigFromSettings("session", "main_splitter_state").toByteArray();
 
     m_findCaseSensitive = getConfigFromSettings("global",
                                                 "find_case_sensitive").toBool();
@@ -168,6 +172,8 @@ void VConfigManager::initialize()
 
     readShortcutsFromSettings();
 
+    readCaptainShortcutsFromSettings();
+
     initDocSuffixes();
 
     m_markdownHighlightInterval = getConfigFromSettings("global",
@@ -187,8 +193,14 @@ void VConfigManager::initialize()
         m_noteOpenMode = OpenFileMode::Read;
     }
 
-    m_enableHeadingSequence = getConfigFromSettings("global",
+    int tmpHeadingSequenceType = getConfigFromSettings("global",
-                                                    "enable_heading_sequence").toBool();
+                                                       "heading_sequence_type").toInt();
+    if (tmpHeadingSequenceType < (int)HeadingSequenceType::Invalid
+        && tmpHeadingSequenceType >= (int)HeadingSequenceType::Disabled) {
+        m_headingSequenceType = (HeadingSequenceType)tmpHeadingSequenceType;
+    } else {
+        m_headingSequenceType = HeadingSequenceType::Disabled;
+    }
 
     m_headingSequenceBaseLevel = getConfigFromSettings("global",
                                                        "heading_sequence_base_level").toInt();
@@ -227,6 +239,76 @@ void VConfigManager::initialize()
 
     m_doubleClickCloseTab = getConfigFromSettings("global",
                                                   "double_click_close_tab").toBool();
+
+    m_enableCompactMode = getConfigFromSettings("global",
+                                                "enable_compact_mode").toBool();
+
+    int tmpStartupPageMode = getConfigFromSettings("global",
+                                                   "startup_page_type").toInt();
+    if (tmpStartupPageMode < (int)StartupPageType::Invalid
+        && tmpStartupPageMode >= (int)StartupPageType::None) {
+        m_startupPageType = (StartupPageType)tmpStartupPageMode;
+    } else {
+        m_startupPageType = StartupPageType::None;
+    }
+
+    m_startupPages = getConfigFromSettings("global",
+                                           "startup_pages").toStringList();
+
+    initFromSessionSettings();
+}
+
+void VConfigManager::initSettings()
+{
+    Q_ASSERT(!userSettings && !defaultSettings && !m_sessionSettings);
+
+    const char *codecForIni = "UTF-8";
+
+    // vnote.ini.
+    // First try to read vnote.ini from the directory of the executable.
+    QString userIniPath = QDir(QCoreApplication::applicationDirPath()).filePath(c_defaultConfigFile);
+    if (QFileInfo::exists(userIniPath)) {
+        userSettings = new QSettings(userIniPath,
+                                     QSettings::IniFormat,
+                                     this);
+    } else {
+        userSettings = new QSettings(QSettings::IniFormat,
+                                     QSettings::UserScope,
+                                     orgName,
+                                     appName,
+                                     this);
+    }
+
+    userSettings->setIniCodec(codecForIni);
+
+    qDebug() << "use user config" << userSettings->fileName();
+
+    // Default vnote.ini from resource file.
+    defaultSettings = new QSettings(c_defaultConfigFilePath, QSettings::IniFormat, this);
+    defaultSettings->setIniCodec(codecForIni);
+
+    // session.ini.
+    m_sessionSettings = new QSettings(QDir(getConfigFolder()).filePath(c_sessionConfigFile),
+                                      QSettings::IniFormat,
+                                      this);
+    m_sessionSettings->setIniCodec(codecForIni);
+}
+
+void VConfigManager::initFromSessionSettings()
+{
+    curNotebookIndex = getConfigFromSessionSettings("global", "current_notebook").toInt();
+
+    m_mainWindowGeometry = getConfigFromSessionSettings("geometry",
+                                                        "main_window_geometry").toByteArray();
+
+    m_mainWindowState = getConfigFromSessionSettings("geometry",
+                                                     "main_window_state").toByteArray();
+
+    m_mainSplitterState = getConfigFromSessionSettings("geometry",
+                                                       "main_splitter_state").toByteArray();
+
+    m_naviSplitterState = getConfigFromSessionSettings("geometry",
+                                                       "navi_splitter_state").toByteArray();
 }
 
 void VConfigManager::readPredefinedColorsFromSettings()
@@ -245,49 +327,70 @@ void VConfigManager::readPredefinedColorsFromSettings()
              << "pre-defined colors from [predefined_colors] section";
 }
 
-void VConfigManager::readNotebookFromSettings(QVector<VNotebook *> &p_notebooks, QObject *parent)
+void VConfigManager::readNotebookFromSettings(QSettings *p_settings,
+                                              QVector<VNotebook *> &p_notebooks,
+                                              QObject *parent)
 {
     Q_ASSERT(p_notebooks.isEmpty());
-    int size = userSettings->beginReadArray("notebooks");
+    int size = p_settings->beginReadArray("notebooks");
     for (int i = 0; i < size; ++i) {
-        userSettings->setArrayIndex(i);
+        p_settings->setArrayIndex(i);
-        QString name = userSettings->value("name").toString();
+        QString name = p_settings->value("name").toString();
-        QString path = userSettings->value("path").toString();
+        QString path = p_settings->value("path").toString();
         VNotebook *notebook = new VNotebook(name, path, parent);
         notebook->readConfigNotebook();
         p_notebooks.append(notebook);
     }
-    userSettings->endArray();
+
+    p_settings->endArray();
     qDebug() << "read" << p_notebooks.size()
              << "notebook items from [notebooks] section";
 }
 
-void VConfigManager::writeNotebookToSettings(const QVector<VNotebook *> &p_notebooks)
+void VConfigManager::writeNotebookToSettings(QSettings *p_settings,
+                                             const QVector<VNotebook *> &p_notebooks)
 {
     // Clear it first
-    userSettings->beginGroup("notebooks");
+    p_settings->beginGroup("notebooks");
-    userSettings->remove("");
+    p_settings->remove("");
-    userSettings->endGroup();
+    p_settings->endGroup();
 
-    userSettings->beginWriteArray("notebooks");
+    p_settings->beginWriteArray("notebooks");
     for (int i = 0; i < p_notebooks.size(); ++i) {
-        userSettings->setArrayIndex(i);
+        p_settings->setArrayIndex(i);
         const VNotebook &notebook = *p_notebooks[i];
-        userSettings->setValue("name", notebook.getName());
+        p_settings->setValue("name", notebook.getName());
-        userSettings->setValue("path", notebook.getPath());
+        p_settings->setValue("path", notebook.getPath());
     }
-    userSettings->endArray();
+
+    p_settings->endArray();
     qDebug() << "write" << p_notebooks.size()
              << "notebook items in [notebooks] section";
 }
 
+static QVariant getConfigFromSettingsBySectionKey(const QSettings *p_settings,
+                                                  const QString &p_section,
+                                                  const QString &p_key)
+{
+    QString fullKey = p_section + "/" + p_key;
+    return p_settings->value(fullKey);
+}
+
+static void setConfigToSettingsBySectionKey(QSettings *p_settings,
+                                            const QString &p_section,
+                                            const QString &p_key,
+                                            const QVariant &p_value)
+{
+    QString fullKey = p_section + "/" + p_key;
+    return p_settings->setValue(fullKey, p_value);
+}
+
 QVariant VConfigManager::getConfigFromSettings(const QString &section, const QString &key) const
 {
-    QString fullKey = section + "/" + key;
     // First, look up the user-scoped config file
-    QVariant value = userSettings->value(fullKey);
+    QVariant value = getConfigFromSettingsBySectionKey(userSettings, section, key);
     if (!value.isNull()) {
-        qDebug() << "user config:" << fullKey << value.toString();
+        qDebug() << "user config:" << (section + "/" +  key) << value;
         return value;
     }
 
@@ -298,18 +401,14 @@ QVariant VConfigManager::getConfigFromSettings(const QString &section, const QSt
 void VConfigManager::setConfigToSettings(const QString &section, const QString &key, const QVariant &value)
 {
     // Set the user-scoped config file
-    QString fullKey = section + "/" + key;
+    setConfigToSettingsBySectionKey(userSettings, section, key, value);
-    userSettings->setValue(fullKey, value);
+    qDebug() << "set user config:" << (section + "/" + key) << value;
-    qDebug() << "set user config:" << fullKey << value.toString();
 }
 
 QVariant VConfigManager::getDefaultConfig(const QString &p_section, const QString &p_key) const
 {
-    QString fullKey = p_section + "/" + p_key;
+    QVariant value = getConfigFromSettingsBySectionKey(defaultSettings, p_section, p_key);
-
+    qDebug() << "default config:" << (p_section + "/" + p_key) << value;
-    QVariant value = defaultSettings->value(fullKey);
-    qDebug() << "default config:" << fullKey << value.toString();
-
     return value;
 }
 
@@ -321,6 +420,24 @@ QVariant VConfigManager::resetDefaultConfig(const QString &p_section, const QStr
     return defaultValue;
 }
 
+QVariant VConfigManager::getConfigFromSessionSettings(const QString &p_section,
+                                                      const QString &p_key) const
+{
+    return getConfigFromSettingsBySectionKey(m_sessionSettings,
+                                             p_section,
+                                             p_key);
+}
+
+void VConfigManager::setConfigToSessionSettings(const QString &p_section,
+                                                const QString &p_key,
+                                                const QVariant &p_value)
+{
+    setConfigToSettingsBySectionKey(m_sessionSettings,
+                                    p_section,
+                                    p_key,
+                                    p_value);
+}
+
 QString VConfigManager::fetchDirConfigFilePath(const QString &p_path)
 {
     QDir dir(p_path);
@@ -887,76 +1004,120 @@ QString VConfigManager::getVnoteNotebookFolderPath()
     return QDir::home().filePath(c_vnoteNotebookFolderName);
 }
 
+QHash<QString, QString> VConfigManager::readShortcutsFromSettings(QSettings *p_settings,
+                                                                  const QString &p_group)
+{
+    QHash<QString, QString> ret;
+    p_settings->beginGroup(p_group);
+    QStringList keys = p_settings->childKeys();
+    for (auto const & key : keys) {
+        if (key.isEmpty()) {
+            continue;
+        }
+
+        QVariant varVal = p_settings->value(key);
+        QString sequence = varVal.toString();
+        if (varVal.type() == QVariant::StringList) {
+            sequence = varVal.toStringList().join(",");
+        }
+
+        sequence = sequence.trimmed();
+        if (isValidKeySequence(sequence)) {
+            ret.insert(key, sequence);
+        }
+    }
+
+    p_settings->endGroup();
+
+    return ret;
+}
+
 bool VConfigManager::isValidKeySequence(const QString &p_seq)
 {
-    QString lower = p_seq.toLower();
+    return p_seq.toLower() != "ctrl+q"
-    return lower != "ctrl+q" && lower != "ctrl+e";
+           && !QKeySequence(p_seq).isEmpty();
 }
 
 void VConfigManager::readShortcutsFromSettings()
 {
+    const QString group("shortcuts");
+
     m_shortcuts.clear();
-    int size = defaultSettings->beginReadArray("shortcuts");
+    m_shortcuts = readShortcutsFromSettings(defaultSettings, group);
-    for (int i = 0; i < size; ++i) {
-        defaultSettings->setArrayIndex(i);
-        QString op = defaultSettings->value("operation").toString();
-        QString seq = defaultSettings->value("keysequence").toString().trimmed();
 
-        if (isValidKeySequence(seq)) {
+    // Update default settings according to user settings.
-            qDebug() << "read shortcut config" << op << seq;
+    QHash<QString, QString> userShortcuts = readShortcutsFromSettings(userSettings,
-            m_shortcuts[op] = seq;
+                                                                      group);
-        }
-    }
-
-    defaultSettings->endArray();
-
-    // Whether we need to update user settings.
-    bool needUpdate = false;
-    size = userSettings->beginReadArray("shortcuts");
     QSet<QString> matched;
     matched.reserve(m_shortcuts.size());
-    for (int i = 0; i < size; ++i) {
+    for (auto it = userShortcuts.begin(); it != userShortcuts.end(); ++it) {
-        userSettings->setArrayIndex(i);
+        auto defaultIt = m_shortcuts.find(it.key());
-        QString op = userSettings->value("operation").toString();
+        if (defaultIt != m_shortcuts.end()) {
-        QString seq = userSettings->value("keysequence").toString().trimmed();
+            QString sequence = it.value().trimmed();
-
+            if (sequence != defaultIt.value()) {
-        if (isValidKeySequence(seq)) {
+                if (isValidKeySequence(sequence)) {
-            qDebug() << "read user shortcut config" << op << seq;
+                    matched.insert(it.key());
-            auto it = m_shortcuts.find(op);
+                    *defaultIt = sequence;
-            if (it == m_shortcuts.end()) {
+                }
-                // Could not find this in default settings.
-                needUpdate = true;
             } else {
-                matched.insert(op);
+                matched.insert(it.key());
-                *it = seq;
             }
         }
     }
 
-    userSettings->endArray();
+    if (matched.size() < m_shortcuts.size()) {
-
+        writeShortcutsToSettings(userSettings, group, m_shortcuts);
-    if (needUpdate || matched.size() < m_shortcuts.size()) {
-        // Write the combined config to user settings.
-        writeShortcutsToSettings();
-    }
     }
 
-void VConfigManager::writeShortcutsToSettings()
+    qDebug() << "shortcuts:" << m_shortcuts;
+}
+
+void VConfigManager::readCaptainShortcutsFromSettings()
 {
-    // Clear it first
+    const QString group("captain_mode_shortcuts");
-    userSettings->beginGroup("shortcuts");
-    userSettings->remove("");
-    userSettings->endGroup();
 
-    userSettings->beginWriteArray("shortcuts");
+    m_captainShortcuts.clear();
-    int idx = 0;
+    m_captainShortcuts = readShortcutsFromSettings(defaultSettings, group);
-    for (auto it = m_shortcuts.begin(); it != m_shortcuts.end(); ++it, ++idx) {
+
-        userSettings->setArrayIndex(idx);
+    // Update default settings according to user settings.
-        userSettings->setValue("operation", it.key());
+    QHash<QString, QString> userShortcuts = readShortcutsFromSettings(userSettings,
-        userSettings->setValue("keysequence", it.value());
+                                                                      group);
+    QSet<QString> matched;
+    matched.reserve(m_captainShortcuts.size());
+    for (auto it = userShortcuts.begin(); it != userShortcuts.end(); ++it) {
+        auto defaultIt = m_captainShortcuts.find(it.key());
+        if (defaultIt != m_captainShortcuts.end()) {
+            QString sequence = it.value().trimmed();
+            if (sequence != defaultIt.value()) {
+                if (isValidKeySequence(sequence)) {
+                    matched.insert(it.key());
+                    *defaultIt = sequence;
+                }
+            } else {
+                matched.insert(it.key());
+            }
+        }
     }
 
-    userSettings->endArray();
+    if (matched.size() < m_captainShortcuts.size()) {
+        writeShortcutsToSettings(userSettings, group, m_captainShortcuts);
+    }
+
+    qDebug() << "captain mode shortcuts:" << m_captainShortcuts;
+}
+
+void VConfigManager::writeShortcutsToSettings(QSettings *p_settings,
+                                              const QString &p_group,
+                                              const QHash<QString, QString> &p_shortcuts)
+{
+    p_settings->beginGroup(p_group);
+    p_settings->remove("");
+
+    for (auto it = p_shortcuts.begin(); it != p_shortcuts.end(); ++it) {
+        p_settings->setValue(it.key(), it.value());
+    }
+
+    p_settings->endGroup();
 }
 
 QString VConfigManager::getShortcutKeySequence(const QString &p_operation) const
@@ -969,6 +1130,16 @@ QString VConfigManager::getShortcutKeySequence(const QString &p_operation) const
     return *it;
 }
 
+QString VConfigManager::getCaptainShortcutKeySequence(const QString &p_operation) const
+{
+    auto it = m_captainShortcuts.find(p_operation);
+    if (it == m_captainShortcuts.end()) {
+        return QString();
+    }
+
+    return *it;
+}
+
 void VConfigManager::initDocSuffixes()
 {
     m_docSuffixes.clear();
@@ -999,3 +1170,59 @@ void VConfigManager::initDocSuffixes()
 
     qDebug() << "doc suffixes" << m_docSuffixes;
 }
+
+QVector<VFileSessionInfo> VConfigManager::getLastOpenedFiles()
+{
+    QVector<VFileSessionInfo> files;
+    int size = m_sessionSettings->beginReadArray("last_opened_files");
+    for (int i = 0; i < size; ++i) {
+        m_sessionSettings->setArrayIndex(i);
+        files.push_back(VFileSessionInfo::fromSettings(m_sessionSettings));
+    }
+
+    m_sessionSettings->endArray();
+    qDebug() << "read" << files.size()
+             << "items from [last_opened_files] section";
+
+    return files;
+}
+
+void VConfigManager::setLastOpenedFiles(const QVector<VFileSessionInfo> &p_files)
+{
+    const QString section("last_opened_files");
+
+    // Clear it first
+    m_sessionSettings->beginGroup(section);
+    m_sessionSettings->remove("");
+    m_sessionSettings->endGroup();
+
+    m_sessionSettings->beginWriteArray(section);
+    for (int i = 0; i < p_files.size(); ++i) {
+        m_sessionSettings->setArrayIndex(i);
+        const VFileSessionInfo &info = p_files[i];
+        info.toSettings(m_sessionSettings);
+    }
+
+    m_sessionSettings->endArray();
+    qDebug() << "write" << p_files.size()
+             << "items in [last_opened_files] section";
+
+}
+
+QVector<VMagicWord> VConfigManager::getCustomMagicWords()
+{
+    QVector<VMagicWord> words;
+    int size = userSettings->beginReadArray("magic_words");
+    for (int i = 0; i < size; ++i) {
+        userSettings->setArrayIndex(i);
+
+        VMagicWord word;
+        word.m_name = userSettings->value("name").toString();
+        word.m_definition = userSettings->value("definition").toString();
+        words.push_back(word);
+    }
+
+    userSettings->endArray();
+
+    return words;
+}

src/vconfigmanager.h

@@ -11,6 +11,9 @@
 #include "hgmarkdownhighlighter.h"
 #include "vmarkdownconverter.h"
 #include "vconstants.h"
+#include "vfilesessioninfo.h"
+#include "utils/vmetawordmanager.h"
+
 
 class QJsonObject;
 class QString;
@@ -41,6 +44,18 @@ struct MarkdownitOption
     bool m_linkify;
 };
 
+// Type of heading sequence.
+enum class HeadingSequenceType
+{
+    Disabled = 0,
+    Enabled,
+
+    // Enabled only for internal notes.
+    EnabledNoteOnly,
+
+    Invalid
+};
+
 class VConfigManager : public QObject
 {
 public:
@@ -106,7 +121,10 @@ public:
     int getCurNotebookIndex() const;
     void setCurNotebookIndex(int index);
 
-    void getNotebooks(QVector<VNotebook *> &p_notebooks, QObject *parent);
+    // Read [notebooks] section from settings into @p_notebooks.
+    void getNotebooks(QVector<VNotebook *> &p_notebooks, QObject *p_parent);
+
+    // Write @p_notebooks to [notebooks] section into settings.
     void setNotebooks(const QVector<VNotebook *> &p_notebooks);
 
     hoedown_extensions getMarkdownExtensions() const;
@@ -153,6 +171,9 @@ public:
     const QByteArray &getMainSplitterState() const;
     void setMainSplitterState(const QByteArray &p_state);
 
+    const QByteArray &getNaviSplitterState() const;
+    void setNaviSplitterState(const QByteArray &p_state);
+
     bool getFindCaseSensitive() const;
     void setFindCaseSensitive(bool p_enabled);
 
@@ -254,8 +275,8 @@ public:
     OpenFileMode getNoteOpenMode() const;
     void setNoteOpenMode(OpenFileMode p_mode);
 
-    bool getEnableHeadingSequence() const;
+    HeadingSequenceType getHeadingSequenceType() const;
-    void setEnableHeadingSequence(bool p_enabled);
+    void setHeadingSequenceType(HeadingSequenceType p_type);
 
     int getHeadingSequenceBaseLevel() const;
     void setHeadingSequenceBaseLevel(int p_level);
@@ -291,10 +312,32 @@ public:
     // Whether user specify template_code_block_css_url directly.
     bool getUserSpecifyTemplateCodeBlockCssUrl() const;
 
+    bool getEnableCompactMode() const;
+    void setEnableCompactMode(bool p_enabled);
+
+    StartupPageType getStartupPageType() const;
+    void setStartupPageType(StartupPageType p_type);
+
+    const QStringList &getStartupPages() const;
+    void setStartupPages(const QStringList &p_pages);
+
+    // Read last opened files from [last_opened_files] of session.ini.
+    QVector<VFileSessionInfo> getLastOpenedFiles();
+
+    // Write last opened files to [last_opened_files] of session.ini.
+    void setLastOpenedFiles(const QVector<VFileSessionInfo> &p_files);
+
+    // Read custom magic words from [magic_words] section.
+    QVector<VMagicWord> getCustomMagicWords();
+
     // Return the configured key sequence of @p_operation.
     // Return empty if there is no corresponding config.
     QString getShortcutKeySequence(const QString &p_operation) const;
 
+    // Return the configured key sequence in Captain mode.
+    // Return empty if there is no corresponding config.
+    QString getCaptainShortcutKeySequence(const QString &p_operation) const;
+
     // Get the folder the ini file exists.
     QString getConfigFolder() const;
 
@@ -317,7 +360,10 @@ public:
     QVector<QString> getEditorStyles() const;
 
 private:
+    // Look up a config from user and default settings.
     QVariant getConfigFromSettings(const QString &section, const QString &key) const;
+
+    // Set a config to user settings.
     void setConfigToSettings(const QString &section, const QString &key, const QVariant &value);
 
     // Get default config from vnote.ini.
@@ -326,8 +372,29 @@ private:
     // Reset user config to default config and return the default config value.
     QVariant resetDefaultConfig(const QString &p_section, const QString &p_key);
 
-    void readNotebookFromSettings(QVector<VNotebook *> &p_notebooks, QObject *parent);
+    // Look up a config from session settings.
-    void writeNotebookToSettings(const QVector<VNotebook *> &p_notebooks);
+    QVariant getConfigFromSessionSettings(const QString &p_section, const QString &p_key) const;
+
+    // Set a config to session settings.
+    void setConfigToSessionSettings(const QString &p_section,
+                                    const QString &p_key,
+                                    const QVariant &p_value);
+
+    // Init defaultSettings, userSettings, and m_sessionSettings.
+    void initSettings();
+
+    // Init from m_sessionSettings.
+    void initFromSessionSettings();
+
+    // Read [notebooks] section from @p_settings.
+    void readNotebookFromSettings(QSettings *p_settings,
+                                  QVector<VNotebook *> &p_notebooks,
+                                  QObject *parent);
+
+    // Write to [notebooks] section to @p_settings.
+    void writeNotebookToSettings(QSettings *p_settings,
+                                 const QVector<VNotebook *> &p_notebooks);
+
     void readPredefinedColorsFromSettings();
 
     // 1. Update styles common in HTML and Markdown;
@@ -336,10 +403,6 @@ private:
 
     void updateMarkdownEditStyle();
 
-    // Migrate ini file from tamlok/vnote.ini to vnote/vnote.ini.
-    // This is for the change of org name.
-    void migrateIniFile();
-
     // Output pre-defined CSS styles to style folder.
     bool outputDefaultCssStyle() const;
 
@@ -359,8 +422,16 @@ private:
     // write the combined configs to user settings.
     void readShortcutsFromSettings();
 
-    // Write m_shortcuts to the [shortcuts] section in the user settings.
+    // Read the [captain_mode_shortcuts] section in the settings to init
-    void writeShortcutsToSettings();
+    // m_captainShortcuts.
+    void readCaptainShortcutsFromSettings();
+
+    QHash<QString, QString> readShortcutsFromSettings(QSettings *p_settings,
+                                                      const QString &p_group);
+
+    void writeShortcutsToSettings(QSettings *p_settings,
+                                  const QString &p_group,
+                                  const QHash<QString, QString> &p_shortcuts);
 
     // Whether @p_seq is a valid key sequence for shortcuts.
     bool isValidKeySequence(const QString &p_seq);
@@ -393,6 +464,8 @@ private:
     QString m_templateCodeBlockCssUrl;
 
     QString m_editorStyle;
+
+    // Index of current notebook.
     int curNotebookIndex;
 
     // Markdown Converter
@@ -429,6 +502,7 @@ private:
     QByteArray m_mainWindowGeometry;
     QByteArray m_mainWindowState;
     QByteArray m_mainSplitterState;
+    QByteArray m_naviSplitterState;
 
     // Find/Replace dialog options
     bool m_findCaseSensitive;
@@ -530,6 +604,10 @@ private:
     // Operation -> KeySequence.
     QHash<QString, QString> m_shortcuts;
 
+    // Shortcuts config in Captain mode.
+    // Operation -> KeySequence.
+    QHash<QString, QString> m_captainShortcuts;
+
     // Whether minimize to system tray icon when closing the app.
     // -1: uninitialized;
     // 0: do not minimize to the tay;
@@ -553,7 +631,7 @@ private:
     OpenFileMode m_noteOpenMode;
 
     // Whether auto genearte heading sequence.
-    bool m_enableHeadingSequence;
+    HeadingSequenceType m_headingSequenceType;
 
     // Heading sequence base level.
     int m_headingSequenceBaseLevel;
@@ -600,6 +678,15 @@ private:
     // Whether double click on a tab to close it.
     bool m_doubleClickCloseTab;
 
+    // Whether put folder and note panel in one single column.
+    bool m_enableCompactMode;
+
+    // Type of the pages to open on startup.
+    StartupPageType m_startupPageType;
+
+    // File paths to open on startup.
+    QStringList m_startupPages;
+
     // The name of the config file in each directory, obsolete.
     // Use c_dirConfigFile instead.
     static const QString c_obsoleteDirConfigFile;
@@ -607,13 +694,25 @@ private:
     // The name of the config file in each directory.
     static const QString c_dirConfigFile;
 
-    // The name of the default configuration file
+    // The path of the default configuration file
-    static const QString defaultConfigFilePath;
+    static const QString c_defaultConfigFilePath;
+
+    // The name of the config file.
+    static const QString c_defaultConfigFile;
+
+    // The name of the config file for session information.
+    static const QString c_sessionConfigFile;
+
     // QSettings for the user configuration
     QSettings *userSettings;
-    // Qsettings for @defaultConfigFileName
+
+    // Qsettings for @c_defaultConfigFilePath.
     QSettings *defaultSettings;
 
+    // QSettings for the session configuration, such as notebooks,
+    // geometry, last opened files.
+    QSettings *m_sessionSettings;
+
     // The folder name of style files.
     static const QString c_styleConfigFolder;
 
@@ -681,18 +780,35 @@ inline void VConfigManager::setCurNotebookIndex(int index)
     if (index == curNotebookIndex) {
         return;
     }
+
     curNotebookIndex = index;
-    setConfigToSettings("global", "current_notebook", index);
+    setConfigToSessionSettings("global", "current_notebook", index);
 }
 
-inline void VConfigManager::getNotebooks(QVector<VNotebook *> &p_notebooks, QObject *parent)
+inline void VConfigManager::getNotebooks(QVector<VNotebook *> &p_notebooks,
+                                         QObject *p_parent)
 {
-    readNotebookFromSettings(p_notebooks, parent);
+    // We used to store it in vnote.ini. For now, we store it in session.ini.
+    readNotebookFromSettings(m_sessionSettings, p_notebooks, p_parent);
+
+    // Migration.
+    if (p_notebooks.isEmpty()) {
+        readNotebookFromSettings(userSettings, p_notebooks, p_parent);
+
+        if (!p_notebooks.isEmpty()) {
+            // Clear and save it in another place.
+            userSettings->beginGroup("notebooks");
+            userSettings->remove("");
+            userSettings->endGroup();
+
+            writeNotebookToSettings(m_sessionSettings, p_notebooks);
+        }
+    }
 }
 
 inline void VConfigManager::setNotebooks(const QVector<VNotebook *> &p_notebooks)
 {
-    writeNotebookToSettings(p_notebooks);
+    writeNotebookToSettings(m_sessionSettings, p_notebooks);
 }
 
 inline hoedown_extensions VConfigManager::getMarkdownExtensions() const
@@ -860,7 +976,7 @@ inline bool VConfigManager::getToolsDockChecked() const
 inline void VConfigManager::setToolsDockChecked(bool p_checked)
 {
     m_toolsDockChecked = p_checked;
-    setConfigToSettings("session", "tools_dock_checked",
+    setConfigToSettings("global", "tools_dock_checked",
                         m_toolsDockChecked);
 }
 
@@ -872,7 +988,8 @@ inline const QByteArray& VConfigManager::getMainWindowGeometry() const
 inline void VConfigManager::setMainWindowGeometry(const QByteArray &p_geometry)
 {
     m_mainWindowGeometry = p_geometry;
-    setConfigToSettings("session", "main_window_geometry",
+    setConfigToSessionSettings("geometry",
+                               "main_window_geometry",
                                m_mainWindowGeometry);
 }
 
@@ -884,7 +1001,8 @@ inline const QByteArray& VConfigManager::getMainWindowState() const
 inline void VConfigManager::setMainWindowState(const QByteArray &p_state)
 {
     m_mainWindowState = p_state;
-    setConfigToSettings("session", "main_window_state",
+    setConfigToSessionSettings("geometry",
+                               "main_window_state",
                                m_mainWindowState);
 }
 
@@ -896,7 +1014,22 @@ inline const QByteArray& VConfigManager::getMainSplitterState() const
 inline void VConfigManager::setMainSplitterState(const QByteArray &p_state)
 {
     m_mainSplitterState = p_state;
-    setConfigToSettings("session", "main_splitter_state", m_mainSplitterState);
+    setConfigToSessionSettings("geometry",
+                               "main_splitter_state",
+                               m_mainSplitterState);
+}
+
+inline const QByteArray& VConfigManager::getNaviSplitterState() const
+{
+    return m_naviSplitterState;
+}
+
+inline void VConfigManager::setNaviSplitterState(const QByteArray &p_state)
+{
+    m_naviSplitterState = p_state;
+    setConfigToSessionSettings("geometry",
+                               "navi_splitter_state",
+                               m_naviSplitterState);
 }
 
 inline bool VConfigManager::getFindCaseSensitive() const
@@ -1370,20 +1503,21 @@ inline void VConfigManager::setNoteOpenMode(OpenFileMode p_mode)
                         m_noteOpenMode == OpenFileMode::Read ? 0 : 1);
 }
 
-inline bool VConfigManager::getEnableHeadingSequence() const
+inline HeadingSequenceType VConfigManager::getHeadingSequenceType() const
 {
-    return m_enableHeadingSequence;
+    return m_headingSequenceType;
 }
 
-inline void VConfigManager::setEnableHeadingSequence(bool p_enabled)
+inline void VConfigManager::setHeadingSequenceType(HeadingSequenceType p_type)
 {
-    if (m_enableHeadingSequence == p_enabled) {
+    if (m_headingSequenceType == p_type) {
         return;
     }
 
-    m_enableHeadingSequence = p_enabled;
+    m_headingSequenceType = p_type;
-    setConfigToSettings("global", "enable_heading_sequence",
+    setConfigToSettings("global",
-                        m_enableHeadingSequence);
+                        "heading_sequence_type",
+                        (int)m_headingSequenceType);
 }
 
 inline int VConfigManager::getHeadingSequenceBaseLevel() const
@@ -1570,4 +1704,49 @@ inline bool VConfigManager::getUserSpecifyTemplateCodeBlockCssUrl() const
     return !m_templateCodeBlockCssUrl.isEmpty();
 }
 
+inline bool VConfigManager::getEnableCompactMode() const
+{
+    return m_enableCompactMode;
+}
+
+inline void VConfigManager::setEnableCompactMode(bool p_enabled)
+{
+    if (m_enableCompactMode == p_enabled) {
+        return;
+    }
+
+    m_enableCompactMode = p_enabled;
+    setConfigToSettings("global", "enable_compact_mode", m_enableCompactMode);
+}
+
+inline StartupPageType VConfigManager::getStartupPageType() const
+{
+    return m_startupPageType;
+}
+
+inline void VConfigManager::setStartupPageType(StartupPageType p_type)
+{
+    if (m_startupPageType == p_type) {
+        return;
+    }
+
+    m_startupPageType = p_type;
+    setConfigToSettings("global", "startup_page_type", (int)m_startupPageType);
+}
+
+inline const QStringList &VConfigManager::getStartupPages() const
+{
+    return m_startupPages;
+}
+
+inline void VConfigManager::setStartupPages(const QStringList &p_pages)
+{
+    if (m_startupPages == p_pages) {
+        return;
+    }
+
+    m_startupPages = p_pages;
+    setConfigToSettings("global", "startup_pages", m_startupPages);
+}
+
 #endif // VCONFIGMANAGER_H

src/vconstants.h

@@ -1,6 +1,8 @@
 #ifndef VCONSTANTS_H
 #define VCONSTANTS_H
 
+#include <QString>
+
 // Html: rich text file;
 // Markdown: Markdown text file;
 // List: Infinite list file like WorkFlowy;
@@ -22,7 +24,7 @@ namespace ClipboardConfig
     static const QString c_dirs = "dirs";
 }
 
-enum class OpenFileMode {Read = 0, Edit};
+enum class OpenFileMode {Read = 0, Edit, Invalid };
 
 static const qreal c_webZoomFactorMax = 5;
 static const qreal c_webZoomFactorMin = 0.25;
@@ -50,12 +52,16 @@ namespace DirConfig
 
 static const QString c_emptyHeaderName = "[EMPTY]";
 
-enum class TextDecoration { None,
+enum class TextDecoration
+{
+    None,
     Bold,
     Italic,
     Underline,
     Strikethrough,
-                            InlineCode };
+    InlineCode,
+    CodeBlock
+};
 
 enum FindOption
 {
@@ -97,4 +103,13 @@ enum class LineNumberType
     CodeBlock
 };
 
+// Pages to open on start up.
+enum class StartupPageType
+{
+    None = 0,
+    ContinueLeftOff = 1,
+    SpecificPages = 2,
+    Invalid
+};
+
 #endif

src/vdirectorytree.cpp

@@ -430,7 +430,7 @@ void VDirectoryTree::newSubDirectory()
                      .arg(g_config->c_dataTextStyle)
                      .arg(curDir->getName());
     QString defaultName("new_folder");
-    defaultName = VUtils::getFileNameWithSequence(curDir->fetchPath(), defaultName);
+    defaultName = VUtils::getDirNameWithSequence(curDir->fetchPath(), defaultName);
     VNewDirDialog dialog(tr("Create Folder"), info, defaultName, curDir, this);
     if (dialog.exec() == QDialog::Accepted) {
         QString name = dialog.getNameInput();
@@ -467,7 +467,7 @@ void VDirectoryTree::newRootDirectory()
                      .arg(g_config->c_dataTextStyle)
                      .arg(m_notebook->getName());
     QString defaultName("new_folder");
-    defaultName = VUtils::getFileNameWithSequence(rootDir->fetchPath(), defaultName);
+    defaultName = VUtils::getDirNameWithSequence(rootDir->fetchPath(), defaultName);
     VNewDirDialog dialog(tr("Create Root Folder"), info, defaultName, rootDir, this);
     if (dialog.exec() == QDialog::Accepted) {
         QString name = dialog.getNameInput();

src/vdocument.h

@@ -16,9 +16,15 @@ class VDocument : public QObject
 public:
     // @p_file could be NULL.
     VDocument(const VFile *p_file, QObject *p_parent = 0);
+
     QString getToc();
+
+    // Scroll to @anchor in the web.
+    // @anchor is the id without '#', like "toc_1". If empty, will scroll to top.
     void scrollToAnchor(const QString &anchor);
+
     void setHtml(const QString &html);
+
     // Request to highlight a segment text.
     // Use p_id to identify the result.
     void highlightTextAsync(const QString &p_text, int p_id, int p_timeStamp);
@@ -35,6 +41,7 @@ public slots:
 
     // When the Web view has been scrolled, it will signal current header anchor.
     // Empty @anchor to indicate an invalid header.
+    // The header does not begins with '#'.
     void setHeader(const QString &anchor);
 
     void setLog(const QString &p_log);
@@ -49,8 +56,12 @@ public slots:
 
 signals:
     void textChanged(const QString &text);
+
     void tocChanged(const QString &toc);
+
     void requestScrollToAnchor(const QString &anchor);
+
+    // @anchor is the id of that anchor, without '#'.
     void headerChanged(const QString &anchor);
     void htmlChanged(const QString &html);
     void logChanged(const QString &p_log);

src/vedit.cpp

@@ -4,19 +4,26 @@
 #include "vedit.h"
 #include "vnote.h"
 #include "vconfigmanager.h"
-#include "vtoc.h"
+#include "vtableofcontent.h"
 #include "utils/vutils.h"
 #include "utils/veditutils.h"
+#include "utils/vmetawordmanager.h"
 #include "veditoperations.h"
 #include "vedittab.h"
+#include "dialog/vinsertlinkdialog.h"
 
 extern VConfigManager *g_config;
+
 extern VNote *g_vnote;
 
-void VEditConfig::init(const QFontMetrics &p_metric)
+extern VMetaWordManager *g_mwMgr;
+
+void VEditConfig::init(const QFontMetrics &p_metric,
+                       bool p_enableHeadingSequence)
 {
     update(p_metric);
 
+    // Init configs that do not support update later.
     m_enableVimMode = g_config->getEnableVimMode();
 
     if (g_config->getLineDistanceHeight() <= 0) {
@@ -26,6 +33,8 @@ void VEditConfig::init(const QFontMetrics &p_metric)
     }
 
     m_highlightWholeBlock = m_enableVimMode;
+
+    m_enableHeadingSequence = p_enableHeadingSequence;
 }
 
 void VEditConfig::update(const QFontMetrics &p_metric)
@@ -84,7 +93,7 @@ VEdit::VEdit(VFile *p_file, QWidget *p_parent)
 
     updateFontAndPalette();
 
-    m_config.init(QFontMetrics(font()));
+    m_config.init(QFontMetrics(font()), false);
     updateConfig();
 
     connect(this, &VEdit::cursorPositionChanged,
@@ -157,15 +166,16 @@ void VEdit::reloadFile()
     setModified(false);
 }
 
-void VEdit::scrollToLine(int p_lineNumber)
+bool VEdit::scrollToBlock(int p_blockNumber)
 {
-    Q_ASSERT(p_lineNumber >= 0);
+    QTextBlock block = document()->findBlockByNumber(p_blockNumber);
-
-    QTextBlock block = document()->findBlockByLineNumber(p_lineNumber);
     if (block.isValid()) {
         VEditUtils::scrollBlockInPage(this, block.blockNumber(), 0);
         moveCursor(QTextCursor::EndOfBlock);
+        return true;
     }
+
+    return false;
 }
 
 bool VEdit::isModified() const
@@ -189,6 +199,49 @@ void VEdit::insertImage()
     }
 }
 
+void VEdit::insertLink()
+{
+    if (!m_editOps) {
+        return;
+    }
+
+    QString text;
+    QString linkText, linkUrl;
+    QTextCursor cursor = textCursor();
+    if (cursor.hasSelection()) {
+        text = VEditUtils::selectedText(cursor).trimmed();
+        // Only pure space is accepted.
+        QRegExp reg("[\\S ]*");
+        if (reg.exactMatch(text)) {
+            QUrl url = QUrl::fromUserInput(text,
+                                           m_file->fetchBasePath());
+            QRegExp urlReg("[\\.\\\\/]");
+            if (url.isValid()
+                && text.contains(urlReg)) {
+                // Url.
+                linkUrl = text;
+            } else {
+                // Text.
+                linkText = text;
+            }
+        }
+    }
+
+    VInsertLinkDialog dialog(tr("Insert Link"),
+                             "",
+                             "",
+                             linkText,
+                             linkUrl,
+                             this);
+    if (dialog.exec() == QDialog::Accepted) {
+        linkText = dialog.getLinkText();
+        linkUrl = dialog.getLinkUrl();
+        Q_ASSERT(!linkText.isEmpty() && !linkUrl.isEmpty());
+
+        m_editOps->insertLink(linkText, linkUrl);
+    }
+}
+
 bool VEdit::peekText(const QString &p_text, uint p_options, bool p_forward)
 {
     if (p_text.isEmpty()) {
@@ -1383,3 +1436,36 @@ void VEdit::updateBlockLineDistanceHeight(int p_pos,
         cursor.endEditBlock();
     }
 }
+
+void VEdit::evaluateMagicWords()
+{
+    QString text;
+    QTextCursor cursor = textCursor();
+    if (!cursor.hasSelection()) {
+        // Get the WORD in current cursor.
+        int start, end;
+        VEditUtils::findCurrentWORD(cursor, start, end);
+
+        if (start == end) {
+            return;
+        } else {
+            cursor.setPosition(start);
+            cursor.setPosition(end, QTextCursor::KeepAnchor);
+        }
+    }
+
+    text = VEditUtils::selectedText(cursor);
+    Q_ASSERT(!text.isEmpty());
+    QString evaText = g_mwMgr->evaluate(text);
+    if (text != evaText) {
+        qDebug() << "evaluateMagicWords" << text << evaText;
+
+        cursor.insertText(evaText);
+
+        if (m_editOps) {
+            m_editOps->setVimMode(VimMode::Insert);
+        }
+
+        setTextCursor(cursor);
+    }
+}

src/vedit.h

@@ -10,7 +10,6 @@
 #include <QRect>
 #include <QFontMetrics>
 #include "vconstants.h"
-#include "vtoc.h"
 #include "vnotefile.h"
 
 class VEditOperations;
@@ -38,10 +37,12 @@ public:
                     m_tabSpaces("\t"),
                     m_enableVimMode(false),
                     m_highlightWholeBlock(false),
-                    m_lineDistanceHeight(0)
+                    m_lineDistanceHeight(0),
+                    m_enableHeadingSequence(false)
     {}
 
-    void init(const QFontMetrics &p_metric);
+    void init(const QFontMetrics &p_metric,
+              bool p_enableHeadingSequence);
 
     // Only update those configs which could be updated online.
     void update(const QFontMetrics &p_metric);
@@ -64,6 +65,9 @@ public:
 
     // Line distance height in pixels.
     int m_lineDistanceHeight;
+
+    // Whether enable auto heading sequence.
+    bool m_enableHeadingSequence;
 };
 
 class LineNumberArea;
@@ -81,10 +85,15 @@ public:
     virtual void setModified(bool p_modified);
     bool isModified() const;
     virtual void reloadFile();
-    virtual void scrollToLine(int p_lineNumber);
+
+    virtual bool scrollToBlock(int p_blockNumber);
+
     // User requests to insert an image.
     virtual void insertImage();
 
+    // User requests to insert a link.
+    virtual void insertLink();
+
     // Used for incremental search.
     // User has enter the content to search, but does not enter the "find" button yet.
     bool peekText(const QString &p_text, uint p_options, bool p_forward = true);
@@ -135,6 +144,9 @@ public:
 
     bool isBlockVisible(const QTextBlock &p_block);
 
+    // Evaluate selected text or cursor word as magic words.
+    void evaluateMagicWords();
+
 signals:
     // Request VEditTab to save and exit edit mode.
     void saveAndRead();
@@ -163,6 +175,9 @@ signals:
     // Request the edit tab to close find and replace dialog.
     void requestCloseFindReplaceDialog();
 
+    // Emit when all initialization is ready.
+    void ready();
+
 public slots:
     virtual void highlightCurrentLine();
 

src/veditarea.cpp

@@ -7,18 +7,27 @@
 #include "vfile.h"
 #include "dialog/vfindreplacedialog.h"
 #include "utils/vutils.h"
+#include "vfilesessioninfo.h"
+#include "vmainwindow.h"
+#include "vcaptain.h"
 
 extern VConfigManager *g_config;
+
 extern VNote *g_vnote;
 
-VEditArea::VEditArea(VNote *vnote, QWidget *parent)
+extern VMainWindow *g_mainWin;
-    : QWidget(parent), VNavigationMode(),
+
-      vnote(vnote), curWindowIndex(-1)
+VEditArea::VEditArea(QWidget *parent)
+    : QWidget(parent),
+      VNavigationMode(),
+      curWindowIndex(-1)
 {
     setupUI();
 
     insertSplitWindow(0);
     setCurrentWindow(0, false);
+
+    registerCaptainTargets();
 }
 
 void VEditArea::setupUI()
@@ -65,7 +74,7 @@ void VEditArea::setupUI()
 
 void VEditArea::insertSplitWindow(int idx)
 {
-    VEditWindow *win = new VEditWindow(vnote, this);
+    VEditWindow *win = new VEditWindow(this);
     splitter->insertWidget(idx, win);
     connect(win, &VEditWindow::tabStatusUpdated,
             this, &VEditArea::handleWindowTabStatusUpdated);
@@ -76,9 +85,9 @@ void VEditArea::insertSplitWindow(int idx)
     connect(win, &VEditWindow::getFocused,
             this, &VEditArea::handleWindowFocused);
     connect(win, &VEditWindow::outlineChanged,
-            this, &VEditArea::handleOutlineChanged);
+            this, &VEditArea::handleWindowOutlineChanged);
-    connect(win, &VEditWindow::curHeaderChanged,
+    connect(win, &VEditWindow::currentHeaderChanged,
-            this, &VEditArea::handleCurHeaderChanged);
+            this, &VEditArea::handleWindowCurrentHeaderChanged);
     connect(win, &VEditWindow::statusMessage,
             this, &VEditArea::handleWindowStatusMessage);
     connect(win, &VEditWindow::vimStatusUpdated,
@@ -119,17 +128,17 @@ void VEditArea::removeSplitWindow(VEditWindow *win)
     win->deleteLater();
 }
 
-void VEditArea::openFile(VFile *p_file, OpenFileMode p_mode, bool p_forceMode)
+VEditTab *VEditArea::openFile(VFile *p_file, OpenFileMode p_mode, bool p_forceMode)
 {
     if (!p_file) {
-        return;
+        return NULL;
     }
 
     // If it is DocType::Unknown, open it using system default method.
     if (p_file->getDocType() == DocType::Unknown) {
         QUrl url = QUrl::fromLocalFile(p_file->fetchPath());
         QDesktopServices::openUrl(url);
-        return;
+        return NULL;
     }
 
     // Find if it has been opened already
@@ -165,6 +174,8 @@ void VEditArea::openFile(VFile *p_file, OpenFileMode p_mode, bool p_forceMode)
     tabIdx = openFileInWindow(winIdx, p_file, p_mode);
 
 out:
+    VEditTab *tab = getTab(winIdx, tabIdx);
+
     setCurrentTab(winIdx, tabIdx, setFocus);
 
     if (existFile && p_forceMode) {
@@ -174,6 +185,8 @@ out:
             editFile();
         }
     }
+
+    return tab;
 }
 
 QVector<QPair<int, int> > VEditArea::findTabsByFile(const VFile *p_file)
@@ -232,15 +245,13 @@ void VEditArea::updateWindowStatus()
         Q_ASSERT(splitter->count() == 0);
 
         emit tabStatusUpdated(VEditTabInfo());
-        emit outlineChanged(VToc());
+        emit outlineChanged(VTableOfContent());
-        emit curHeaderChanged(VAnchor());
+        emit currentHeaderChanged(VHeaderPointer());
         return;
     }
 
     VEditWindow *win = getWindow(curWindowIndex);
     win->updateTabStatus();
-    win->requestUpdateOutline();
-    win->requestUpdateCurHeader();
 }
 
 bool VEditArea::closeFile(const VFile *p_file, bool p_forced)
@@ -431,26 +442,28 @@ void VEditArea::handleWindowFocused()
     }
 }
 
-void VEditArea::handleOutlineChanged(const VToc &toc)
+void VEditArea::handleWindowOutlineChanged(const VTableOfContent &p_outline)
 {
     QObject *winObject = sender();
     if (splitter->widget(curWindowIndex) == winObject) {
-        emit outlineChanged(toc);
+        emit outlineChanged(p_outline);
     }
 }
 
-void VEditArea::handleCurHeaderChanged(const VAnchor &anchor)
+void VEditArea::handleWindowCurrentHeaderChanged(const VHeaderPointer &p_header)
 {
     QObject *winObject = sender();
     if (splitter->widget(curWindowIndex) == winObject) {
-        emit curHeaderChanged(anchor);
+        emit currentHeaderChanged(p_header);
     }
 }
 
-void VEditArea::handleOutlineItemActivated(const VAnchor &anchor)
+void VEditArea::scrollToHeader(const VHeaderPointer &p_header)
 {
-    // Notice current window
+    VEditWindow *win = getCurrentWindow();
-    getWindow(curWindowIndex)->scrollCurTab(anchor);
+    if (win) {
+        win->scrollToHeader(p_header);
+    }
 }
 
 bool VEditArea::isFileOpened(const VFile *p_file)
@@ -482,13 +495,35 @@ void VEditArea::handleNotebookUpdated(const VNotebook *p_notebook)
     }
 }
 
-VEditTab *VEditArea::currentEditTab()
+VEditTab *VEditArea::getCurrentTab() const
 {
     if (curWindowIndex == -1) {
         return NULL;
     }
+
     VEditWindow *win = getWindow(curWindowIndex);
-    return win->currentEditTab();
+    return win->getCurrentTab();
+}
+
+VEditTab *VEditArea::getTab(int p_winIdx, int p_tabIdx) const
+{
+    VEditWindow *win = getWindow(p_winIdx);
+    if (!win) {
+        return NULL;
+    }
+
+    return win->getTab(p_tabIdx);
+}
+
+QVector<VEditTabInfo> VEditArea::getAllTabsInfo() const
+{
+    QVector<VEditTabInfo> tabs;
+    int nrWin = splitter->count();
+    for (int i = 0; i < nrWin; ++i) {
+        tabs.append(getWindow(i)->getAllTabsInfo());
+    }
+
+    return tabs;
 }
 
 int VEditArea::windowIndex(const VEditWindow *p_window) const
@@ -518,7 +553,7 @@ void VEditArea::moveTab(QWidget *p_widget, int p_fromIdx, int p_toIdx)
 // Only propogate the search in the IncrementalSearch case.
 void VEditArea::handleFindTextChanged(const QString &p_text, uint p_options)
 {
-    VEditTab *tab = currentEditTab();
+    VEditTab *tab = getCurrentTab();
     if (tab) {
         if (p_options & FindOption::IncrementalSearch) {
             tab->findText(p_text, p_options, true);
@@ -539,7 +574,7 @@ void VEditArea::handleFindNext(const QString &p_text, uint p_options,
                                bool p_forward)
 {
     qDebug() << "find next" << p_text << p_options << p_forward;
-    VEditTab *tab = currentEditTab();
+    VEditTab *tab = getCurrentTab();
     if (tab) {
         tab->findText(p_text, p_options, false, p_forward);
     }
@@ -550,7 +585,7 @@ void VEditArea::handleReplace(const QString &p_text, uint p_options,
 {
     qDebug() << "replace" << p_text << p_options << "with" << p_replaceText
              << p_findNext;
-    VEditTab *tab = currentEditTab();
+    VEditTab *tab = getCurrentTab();
     if (tab) {
         tab->replaceText(p_text, p_options, p_replaceText, p_findNext);
     }
@@ -560,7 +595,7 @@ void VEditArea::handleReplaceAll(const QString &p_text, uint p_options,
                                  const QString &p_replaceText)
 {
     qDebug() << "replace all" << p_text << p_options << "with" << p_replaceText;
-    VEditTab *tab = currentEditTab();
+    VEditTab *tab = getCurrentTab();
     if (tab) {
         tab->replaceTextAll(p_text, p_options, p_replaceText);
     }
@@ -584,7 +619,7 @@ void VEditArea::handleFindDialogClosed()
 
 QString VEditArea::getSelectedText()
 {
-    VEditTab *tab = currentEditTab();
+    VEditTab *tab = getCurrentTab();
     if (tab) {
         return tab->getSelectedText();
     } else {
@@ -621,6 +656,7 @@ VEditWindow *VEditArea::getCurrentWindow() const
     if (curWindowIndex < 0) {
         return NULL;
     }
+
     return getWindow(curWindowIndex);
 }
 
@@ -694,3 +730,220 @@ bool VEditArea::handleKeyNavigation(int p_key, bool &p_succeed)
     return ret;
 }
 
+int VEditArea::openFiles(const QVector<VFileSessionInfo> &p_files)
+{
+    int nrOpened = 0;
+    for (auto const & info : p_files) {
+        QString filePath = VUtils::validFilePathToOpen(info.m_file);
+        if (filePath.isEmpty()) {
+            continue;
+        }
+
+        VFile *file = g_vnote->getFile(filePath);
+        if (!file) {
+            continue;
+        }
+
+        VEditTab *tab = openFile(file, info.m_mode, true);
+        ++nrOpened;
+
+        VEditTabInfo tabInfo;
+        tabInfo.m_editTab = tab;
+        info.toEditTabInfo(&tabInfo);
+
+        tab->tryRestoreFromTabInfo(tabInfo);
+    }
+
+    return nrOpened;
+}
+
+void VEditArea::registerCaptainTargets()
+{
+    using namespace std::placeholders;
+
+    VCaptain *captain = g_mainWin->getCaptain();
+
+    captain->registerCaptainTarget(tr("ActivateTab1"),
+                                   g_config->getCaptainShortcutKeySequence("ActivateTab1"),
+                                   this,
+                                   std::bind(activateTabByCaptain, _1, _2, 1));
+    captain->registerCaptainTarget(tr("ActivateTab2"),
+                                   g_config->getCaptainShortcutKeySequence("ActivateTab2"),
+                                   this,
+                                   std::bind(activateTabByCaptain, _1, _2, 2));
+    captain->registerCaptainTarget(tr("ActivateTab3"),
+                                   g_config->getCaptainShortcutKeySequence("ActivateTab3"),
+                                   this,
+                                   std::bind(activateTabByCaptain, _1, _2, 3));
+    captain->registerCaptainTarget(tr("ActivateTab4"),
+                                   g_config->getCaptainShortcutKeySequence("ActivateTab4"),
+                                   this,
+                                   std::bind(activateTabByCaptain, _1, _2, 4));
+    captain->registerCaptainTarget(tr("ActivateTab5"),
+                                   g_config->getCaptainShortcutKeySequence("ActivateTab5"),
+                                   this,
+                                   std::bind(activateTabByCaptain, _1, _2, 5));
+    captain->registerCaptainTarget(tr("ActivateTab6"),
+                                   g_config->getCaptainShortcutKeySequence("ActivateTab6"),
+                                   this,
+                                   std::bind(activateTabByCaptain, _1, _2, 6));
+    captain->registerCaptainTarget(tr("ActivateTab7"),
+                                   g_config->getCaptainShortcutKeySequence("ActivateTab7"),
+                                   this,
+                                   std::bind(activateTabByCaptain, _1, _2, 7));
+    captain->registerCaptainTarget(tr("ActivateTab8"),
+                                   g_config->getCaptainShortcutKeySequence("ActivateTab8"),
+                                   this,
+                                   std::bind(activateTabByCaptain, _1, _2, 8));
+    captain->registerCaptainTarget(tr("ActivateTab9"),
+                                   g_config->getCaptainShortcutKeySequence("ActivateTab9"),
+                                   this,
+                                   std::bind(activateTabByCaptain, _1, _2, 9));
+    captain->registerCaptainTarget(tr("AlternateTab"),
+                                   g_config->getCaptainShortcutKeySequence("AlternateTab"),
+                                   this,
+                                   alternateTabByCaptain);
+    captain->registerCaptainTarget(tr("OpenedFileList"),
+                                   g_config->getCaptainShortcutKeySequence("OpenedFileList"),
+                                   this,
+                                   showOpenedFileListByCaptain);
+    captain->registerCaptainTarget(tr("ActivateSplitLeft"),
+                                   g_config->getCaptainShortcutKeySequence("ActivateSplitLeft"),
+                                   this,
+                                   activateSplitLeftByCaptain);
+    captain->registerCaptainTarget(tr("ActivateSplitRight"),
+                                   g_config->getCaptainShortcutKeySequence("ActivateSplitRight"),
+                                   this,
+                                   activateSplitRightByCaptain);
+    captain->registerCaptainTarget(tr("MoveTabSplitLeft"),
+                                   g_config->getCaptainShortcutKeySequence("MoveTabSplitLeft"),
+                                   this,
+                                   moveTabSplitLeftByCaptain);
+    captain->registerCaptainTarget(tr("MoveTabSplitRight"),
+                                   g_config->getCaptainShortcutKeySequence("MoveTabSplitRight"),
+                                   this,
+                                   moveTabSplitRightByCaptain);
+    captain->registerCaptainTarget(tr("ActivateNextTab"),
+                                   g_config->getCaptainShortcutKeySequence("ActivateNextTab"),
+                                   this,
+                                   activateNextTabByCaptain);
+    captain->registerCaptainTarget(tr("ActivatePreviousTab"),
+                                   g_config->getCaptainShortcutKeySequence("ActivatePreviousTab"),
+                                   this,
+                                   activatePreviousTabByCaptain);
+    captain->registerCaptainTarget(tr("VerticalSplit"),
+                                   g_config->getCaptainShortcutKeySequence("VerticalSplit"),
+                                   this,
+                                   verticalSplitByCaptain);
+    captain->registerCaptainTarget(tr("RemoveSplit"),
+                                   g_config->getCaptainShortcutKeySequence("RemoveSplit"),
+                                   this,
+                                   removeSplitByCaptain);
+    captain->registerCaptainTarget(tr("MagicWord"),
+                                   g_config->getCaptainShortcutKeySequence("MagicWord"),
+                                   this,
+                                   evaluateMagicWordsByCaptain);
+}
+
+void VEditArea::activateTabByCaptain(void *p_target, void *p_data, int p_idx)
+{
+    Q_UNUSED(p_data);
+    VEditArea *obj = static_cast<VEditArea *>(p_target);
+    VEditWindow *win = obj->getCurrentWindow();
+    if (win) {
+        win->activateTab(p_idx);
+    }
+}
+
+void VEditArea::alternateTabByCaptain(void *p_target, void *p_data)
+{
+    Q_UNUSED(p_data);
+    VEditArea *obj = static_cast<VEditArea *>(p_target);
+    VEditWindow *win = obj->getCurrentWindow();
+    if (win) {
+        win->alternateTab();
+    }
+}
+
+void VEditArea::showOpenedFileListByCaptain(void *p_target, void *p_data)
+{
+    Q_UNUSED(p_data);
+    VEditArea *obj = static_cast<VEditArea *>(p_target);
+    VEditWindow *win = obj->getCurrentWindow();
+    if (win) {
+        win->showOpenedFileList();
+    }
+}
+
+void VEditArea::activateSplitLeftByCaptain(void *p_target, void *p_data)
+{
+    Q_UNUSED(p_data);
+    VEditArea *obj = static_cast<VEditArea *>(p_target);
+    obj->focusNextWindow(-1);
+}
+
+void VEditArea::activateSplitRightByCaptain(void *p_target, void *p_data)
+{
+    Q_UNUSED(p_data);
+    VEditArea *obj = static_cast<VEditArea *>(p_target);
+    obj->focusNextWindow(1);
+}
+
+void VEditArea::moveTabSplitLeftByCaptain(void *p_target, void *p_data)
+{
+    Q_UNUSED(p_data);
+    VEditArea *obj = static_cast<VEditArea *>(p_target);
+    obj->moveCurrentTabOneSplit(false);
+}
+
+void VEditArea::moveTabSplitRightByCaptain(void *p_target, void *p_data)
+{
+    Q_UNUSED(p_data);
+    VEditArea *obj = static_cast<VEditArea *>(p_target);
+    obj->moveCurrentTabOneSplit(true);
+}
+
+void VEditArea::activateNextTabByCaptain(void *p_target, void *p_data)
+{
+    Q_UNUSED(p_data);
+    VEditArea *obj = static_cast<VEditArea *>(p_target);
+    VEditWindow *win = obj->getCurrentWindow();
+    if (win) {
+        win->focusNextTab(true);
+    }
+}
+
+void VEditArea::activatePreviousTabByCaptain(void *p_target, void *p_data)
+{
+    Q_UNUSED(p_data);
+    VEditArea *obj = static_cast<VEditArea *>(p_target);
+    VEditWindow *win = obj->getCurrentWindow();
+    if (win) {
+        win->focusNextTab(false);
+    }
+}
+
+void VEditArea::verticalSplitByCaptain(void *p_target, void *p_data)
+{
+    Q_UNUSED(p_data);
+    VEditArea *obj = static_cast<VEditArea *>(p_target);
+    obj->splitCurrentWindow();
+}
+
+void VEditArea::removeSplitByCaptain(void *p_target, void *p_data)
+{
+    Q_UNUSED(p_data);
+    VEditArea *obj = static_cast<VEditArea *>(p_target);
+    obj->removeCurrentWindow();
+}
+
+void VEditArea::evaluateMagicWordsByCaptain(void *p_target, void *p_data)
+{
+    Q_UNUSED(p_data);
+    VEditArea *obj = static_cast<VEditArea *>(p_target);
+    VEditTab *tab = obj->getCurrentTab();
+    if (tab && tab->tabHasFocus()) {
+        tab->evaluateMagicWords();
+    }
+}
+

src/veditarea.h

@@ -12,10 +12,8 @@
 #include <QSplitter>
 #include "vnotebook.h"
 #include "veditwindow.h"
-#include "vtoc.h"
 #include "vnavigationmode.h"
 
-class VNote;
 class VFile;
 class VDirectory;
 class VFindReplaceDialog;
@@ -26,7 +24,7 @@ class VEditArea : public QWidget, public VNavigationMode
 {
     Q_OBJECT
 public:
-    explicit VEditArea(VNote *vnote, QWidget *parent = 0);
+    explicit VEditArea(QWidget *parent = 0);
 
     // Whether @p_file has been opened in edit area.
     bool isFileOpened(const VFile *p_file);
@@ -35,17 +33,31 @@ public:
     bool closeFile(const VFile *p_file, bool p_forced);
     bool closeFile(const VDirectory *p_dir, bool p_forced);
     bool closeFile(const VNotebook *p_notebook, bool p_forced);
-    // Returns current edit tab.
+
-    VEditTab *currentEditTab();
+    // Return current edit window.
-    // Returns the count of VEditWindow.
+    VEditWindow *getCurrentWindow() const;
-    inline int windowCount() const;
+
+    // Return current edit tab.
+    VEditTab *getCurrentTab() const;
+
+    // Return the @p_tabIdx tab in the @p_winIdx window.
+    VEditTab *getTab(int p_winIdx, int p_tabIdx) const;
+
+    // Return VEditTabInfo of all edit tabs.
+    QVector<VEditTabInfo> getAllTabsInfo() const;
+
+    // Return the count of VEditWindow.
+    int windowCount() const;
+
     // Returns the index of @p_window.
     int windowIndex(const VEditWindow *p_window) const;
     // Move tab widget @p_widget from window @p_fromIdx to @p_toIdx.
     // @p_widget has been removed from the original window.
     // If fail, just delete the p_widget.
     void moveTab(QWidget *p_widget, int p_fromIdx, int p_toIdx);
-    inline VFindReplaceDialog *getFindReplaceDialog() const;
+
+    VFindReplaceDialog *getFindReplaceDialog() const;
+
     // Return selected text of current edit tab.
     QString getSelectedText();
     void splitCurrentWindow();
@@ -54,7 +66,6 @@ public:
     // Return the new current window index, otherwise, return -1.
     int focusNextWindow(int p_biaIdx);
     void moveCurrentTabOneSplit(bool p_right);
-    VEditWindow *getCurrentWindow() const;
 
     // Implementations for VNavigationMode.
     void registerNavigation(QChar p_majorKey) Q_DECL_OVERRIDE;
@@ -62,12 +73,18 @@ public:
     void hideNavigation() Q_DECL_OVERRIDE;
     bool handleKeyNavigation(int p_key, bool &p_succeed) Q_DECL_OVERRIDE;
 
+    // Open files @p_files.
+    int openFiles(const QVector<VFileSessionInfo> &p_files);
+
 signals:
     // Emit when current window's tab status updated.
     void tabStatusUpdated(const VEditTabInfo &p_info);
 
-    void outlineChanged(const VToc &toc);
+    // Emit when current window's tab's outline changed.
-    void curHeaderChanged(const VAnchor &anchor);
+    void outlineChanged(const VTableOfContent &p_outline);
+
+    // Emit when current window's tab's current header changed.
+    void currentHeaderChanged(const VHeaderPointer &p_header);
 
     // Emit when want to show message in status bar.
     void statusMessage(const QString &p_msg);
@@ -84,13 +101,16 @@ public slots:
     // @p_forceMode is true.
     // A given file can be opened in multiple split windows. A given file could be
     // opened at most in one tab inside a window.
-    void openFile(VFile *p_file, OpenFileMode p_mode, bool p_forceMode = false);
+    VEditTab *openFile(VFile *p_file, OpenFileMode p_mode, bool p_forceMode = false);
 
     void editFile();
     void saveFile();
     void readFile();
     void saveAndReadFile();
-    void handleOutlineItemActivated(const VAnchor &anchor);
+
+    // Scroll current tab to @p_header.
+    void scrollToHeader(const VHeaderPointer &p_header);
+
     void handleFileUpdated(const VFile *p_file);
     void handleDirectoryUpdated(const VDirectory *p_dir);
     void handleNotebookUpdated(const VNotebook *p_notebook);
@@ -102,8 +122,11 @@ private slots:
 
     void handleRemoveSplitRequest(VEditWindow *curWindow);
     void handleWindowFocused();
-    void handleOutlineChanged(const VToc &toc);
+
-    void handleCurHeaderChanged(const VAnchor &anchor);
+    void handleWindowOutlineChanged(const VTableOfContent &p_outline);
+
+    void handleWindowCurrentHeaderChanged(const VHeaderPointer &p_header);
+
     void handleFindTextChanged(const QString &p_text, uint p_options);
     void handleFindOptionChanged(uint p_options);
     void handleFindNext(const QString &p_text, uint p_options, bool p_forward);
@@ -128,14 +151,48 @@ private:
     int openFileInWindow(int windowIndex, VFile *p_file, OpenFileMode p_mode);
     void setCurrentTab(int windowIndex, int tabIndex, bool setFocus);
     void setCurrentWindow(int windowIndex, bool setFocus);
-    inline VEditWindow *getWindow(int windowIndex) const;
+
+    VEditWindow *getWindow(int windowIndex) const;
+
     void insertSplitWindow(int idx);
     void removeSplitWindow(VEditWindow *win);
 
     // Update status of current window.
     void updateWindowStatus();
 
-    VNote *vnote;
+    // Init targets for Captain mode.
+    void registerCaptainTargets();
+
+    // Captain mode functions.
+
+    // Activate tab @p_idx.
+    static void activateTabByCaptain(void *p_target, void *p_data, int p_idx);
+
+    static void alternateTabByCaptain(void *p_target, void *p_data);
+
+    static void showOpenedFileListByCaptain(void *p_target, void *p_data);
+
+    static void activateSplitLeftByCaptain(void *p_target, void *p_data);
+
+    static void activateSplitRightByCaptain(void *p_target, void *p_data);
+
+    static void moveTabSplitLeftByCaptain(void *p_target, void *p_data);
+
+    static void moveTabSplitRightByCaptain(void *p_target, void *p_data);
+
+    static void activateNextTabByCaptain(void *p_target, void *p_data);
+
+    static void activatePreviousTabByCaptain(void *p_target, void *p_data);
+
+    static void verticalSplitByCaptain(void *p_target, void *p_data);
+
+    static void removeSplitByCaptain(void *p_target, void *p_data);
+
+    // Evaluate selected text or the word on cursor as magic words.
+    static void evaluateMagicWordsByCaptain(void *p_target, void *p_data);
+
+    // End Captain mode functions.
+
     int curWindowIndex;
 
     // Splitter holding multiple split windows

src/veditoperations.cpp

@@ -90,3 +90,10 @@ void VEditOperations::requestUpdateVimStatus()
 {
     emit vimStatusUpdated(m_vim);
 }
+
+void VEditOperations::setVimMode(VimMode p_mode)
+{
+    if (m_vim && m_editConfig->m_enableVimMode) {
+        m_vim->setMode(p_mode);
+    }
+}

src/veditoperations.h

@@ -18,11 +18,18 @@ class VEditOperations: public QObject
     Q_OBJECT
 public:
     VEditOperations(VEdit *p_editor, VFile *p_file);
+
     virtual ~VEditOperations();
+
     virtual bool insertImageFromMimeData(const QMimeData *source) = 0;
+
     virtual bool insertImage() = 0;
+
     virtual bool insertImageFromURL(const QUrl &p_imageUrl) = 0;
 
+    virtual bool insertLink(const QString &p_linkText,
+                            const QString &p_linkUrl) = 0;
+
     // Return true if @p_event has been handled and no need to be further
     // processed.
     virtual bool handleKeyPressEvent(QKeyEvent *p_event) = 0;
@@ -33,6 +40,9 @@ public:
     // Insert decoration markers or decorate selected text.
     virtual void decorateText(TextDecoration p_decoration) {Q_UNUSED(p_decoration);};
 
+    // Set Vim mode if not NULL.
+    void setVimMode(VimMode p_mode);
+
 signals:
     // Want to display a template message in status bar.
     void statusMessage(const QString &p_msg);

src/vedittab.cpp

@@ -3,12 +3,13 @@
 #include <QWheelEvent>
 
 VEditTab::VEditTab(VFile *p_file, VEditArea *p_editArea, QWidget *p_parent)
-    : QWidget(p_parent), m_file(p_file), m_isEditMode(false),
+    : QWidget(p_parent),
-      m_modified(false), m_editArea(p_editArea)
+      m_file(p_file),
+      m_isEditMode(false),
+      m_outline(p_file),
+      m_currentHeader(p_file, -1),
+      m_editArea(p_editArea)
 {
-    m_toc.m_file = m_file;
-    m_curHeader.m_file = m_file;
-
     connect(qApp, &QApplication::focusChanged,
             this, &VEditTab::handleFocusChanged);
 }
@@ -24,6 +25,7 @@ void VEditTab::focusTab()
 {
     focusChild();
     emit getFocused();
+    updateStatus();
 }
 
 bool VEditTab::isEditMode() const
@@ -33,7 +35,7 @@ bool VEditTab::isEditMode() const
 
 bool VEditTab::isModified() const
 {
-    return m_modified;
+    return m_file->isModified();
 }
 
 VFile *VEditTab::getFile() const
@@ -48,21 +50,13 @@ void VEditTab::handleFocusChanged(QWidget * /* p_old */, QWidget *p_now)
         focusChild();
 
         emit getFocused();
+        updateStatus();
     } else if (isAncestorOf(p_now)) {
         emit getFocused();
+        updateStatus();
     }
 }
 
-void VEditTab::requestUpdateCurHeader()
-{
-    emit curHeaderChanged(m_curHeader);
-}
-
-void VEditTab::requestUpdateOutline()
-{
-    emit outlineChanged(m_toc);
-}
-
 void VEditTab::wheelEvent(QWheelEvent *p_event)
 {
     QPoint angle = p_event->angleDelta();
@@ -78,17 +72,55 @@ void VEditTab::wheelEvent(QWheelEvent *p_event)
     p_event->ignore();
 }
 
-void VEditTab::updateStatus()
+VEditTabInfo VEditTab::fetchTabInfo() const
-{
-    m_modified = m_file->isModified();
-
-    emit statusUpdated(createEditTabInfo());
-}
-
-VEditTabInfo VEditTab::createEditTabInfo()
 {
     VEditTabInfo info;
-    info.m_editTab = this;
+    info.m_editTab = const_cast<VEditTab *>(this);
 
     return info;
 }
+
+const VHeaderPointer &VEditTab::getCurrentHeader() const
+{
+    return m_currentHeader;
+}
+
+const VTableOfContent &VEditTab::getOutline() const
+{
+    return m_outline;
+}
+
+void VEditTab::tryRestoreFromTabInfo(const VEditTabInfo &p_info)
+{
+    if (p_info.m_editTab != this) {
+        m_infoToRestore.clear();
+        return;
+    }
+
+    if (restoreFromTabInfo(p_info)) {
+        m_infoToRestore.clear();
+        return;
+    }
+
+    // Save it and restore later.
+    m_infoToRestore = p_info;
+}
+
+void VEditTab::updateStatus()
+{
+    emit statusUpdated(fetchTabInfo());
+}
+
+void VEditTab::evaluateMagicWords()
+{
+}
+
+bool VEditTab::tabHasFocus() const
+{
+    QWidget *wid = QApplication::focusWidget();
+    return wid == this || isAncestorOf(wid);
+}
+
+void VEditTab::insertLink()
+{
+}

src/vedittab.h

@@ -4,7 +4,7 @@
 #include <QWidget>
 #include <QString>
 #include <QPointer>
-#include "vtoc.h"
+#include "vtableofcontent.h"
 #include "vfile.h"
 #include "utils/vvim.h"
 #include "vedittabinfo.h"
@@ -37,18 +37,21 @@ public:
 
     void focusTab();
 
-    virtual void requestUpdateOutline();
+    // Whether this tab has focus.
+    bool tabHasFocus() const;
 
-    virtual void requestUpdateCurHeader();
+    // Scroll to @p_header.
-
+    // Will emit currentHeaderChanged() if @p_header is valid.
-    // Scroll to anchor @p_anchor.
+    virtual void scrollToHeader(const VHeaderPointer &p_header) { Q_UNUSED(p_header) }
-    virtual void scrollToAnchor(const VAnchor& p_anchor) = 0;
 
     VFile *getFile() const;
 
     // User requests to insert image.
     virtual void insertImage() = 0;
 
+    // User requests to insert link.
+    virtual void insertLink();
+
     // Search @p_text in current note.
     virtual void findText(const QString &p_text, uint p_options, bool p_peek,
                           bool p_forward = true) = 0;
@@ -69,15 +72,29 @@ public:
     virtual void requestUpdateVimStatus() = 0;
 
     // Insert decoration markers or decorate selected text.
-    virtual void decorateText(TextDecoration p_decoration) {Q_UNUSED(p_decoration);};
+    virtual void decorateText(TextDecoration p_decoration) {Q_UNUSED(p_decoration);}
+
+    // Create a filled VEditTabInfo.
+    virtual VEditTabInfo fetchTabInfo() const;
+
+    const VTableOfContent &getOutline() const;
+
+    const VHeaderPointer &getCurrentHeader() const;
+
+    // Restore status from @p_info.
+    // If this tab is not ready yet, it will restore once it is ready.
+    void tryRestoreFromTabInfo(const VEditTabInfo &p_info);
+
+    // Emit signal to update current status.
+    virtual void updateStatus();
+
+    // Called by evaluateMagicWordsByCaptain() to evaluate the magic words.
+    virtual void evaluateMagicWords();
 
 public slots:
     // Enter edit mode
     virtual void editFile() = 0;
 
-    // Update status of current tab. Emit statusUpdated().
-    virtual void updateStatus();
-
 protected:
     void wheelEvent(QWheelEvent *p_event) Q_DECL_OVERRIDE;
 
@@ -87,23 +104,32 @@ protected:
     // Called to zoom in/out content.
     virtual void zoom(bool p_zoomIn, qreal p_step = 0.25) = 0;
 
-    // Create a filled VEditTabInfo.
+    // Restore from @p_fino.
-    virtual VEditTabInfo createEditTabInfo();
+    // Return true if succeed.
+    virtual bool restoreFromTabInfo(const VEditTabInfo &p_info) = 0;
 
     // File related to this tab.
     QPointer<VFile> m_file;
+
     bool m_isEditMode;
-    bool m_modified;
+
-    VToc m_toc;
+    // Table of content of this tab.
-    VAnchor m_curHeader;
+    VTableOfContent m_outline;
+
+    // Current header in m_outline of this tab.
+    VHeaderPointer m_currentHeader;
+
     VEditArea *m_editArea;
 
+    // Tab info to restore from once ready.
+    VEditTabInfo m_infoToRestore;
+
 signals:
     void getFocused();
 
-    void outlineChanged(const VToc &p_toc);
+    void outlineChanged(const VTableOfContent &p_outline);
 
-    void curHeaderChanged(const VAnchor &p_anchor);
+    void currentHeaderChanged(const VHeaderPointer &p_header);
 
     // The status of current tab has updates.
     void statusUpdated(const VEditTabInfo &p_info);

src/vedittabinfo.h

@@ -6,8 +6,22 @@ class VEditTab;
 struct VEditTabInfo
 {
     VEditTabInfo()
-        : m_editTab(NULL), m_cursorBlockNumber(-1), m_cursorPositionInBlock(-1),
+        : m_editTab(NULL),
-          m_blockCount(-1) {}
+          m_cursorBlockNumber(-1),
+          m_cursorPositionInBlock(-1),
+          m_blockCount(-1),
+          m_headerIndex(-1)
+    {
+    }
+
+    void clear()
+    {
+        m_editTab = NULL;
+        m_cursorBlockNumber = -1;
+        m_cursorPositionInBlock = -1;
+        m_blockCount = -1;
+        m_headerIndex = -1;
+    }
 
     VEditTab *m_editTab;
 
@@ -15,6 +29,9 @@ struct VEditTabInfo
     int m_cursorBlockNumber;
     int m_cursorPositionInBlock;
     int m_blockCount;
+
+    // Header index in outline.
+    int m_headerIndex;
 };
 
 #endif // VEDITTABINFO_H

src/veditwindow.cpp

@@ -2,7 +2,6 @@
 #include <QtDebug>
 #include "veditwindow.h"
 #include "vedittab.h"
-#include "vnote.h"
 #include "utils/vutils.h"
 #include "vorphanfile.h"
 #include "vmainwindow.h"
@@ -13,12 +12,14 @@
 #include "vfilelist.h"
 #include "vconfigmanager.h"
 
-extern VNote *g_vnote;
 extern VConfigManager *g_config;
+extern VMainWindow *g_mainWin;
 
-VEditWindow::VEditWindow(VNote *vnote, VEditArea *editArea, QWidget *parent)
+VEditWindow::VEditWindow(VEditArea *editArea, QWidget *parent)
-    : QTabWidget(parent), vnote(vnote), m_editArea(editArea),
+    : QTabWidget(parent),
-      m_curTabWidget(NULL), m_lastTabWidget(NULL)
+      m_editArea(editArea),
+      m_curTabWidget(NULL),
+      m_lastTabWidget(NULL)
 {
     setAcceptDrops(true);
     initTabActions();
@@ -137,9 +138,9 @@ void VEditWindow::initTabActions()
                 Q_ASSERT(file);
                 if (file->getType() == FileType::Note) {
                     VNoteFile *tmpFile = dynamic_cast<VNoteFile *>((VFile *)file);
-                    g_vnote->getMainWindow()->getFileList()->fileInfo(tmpFile);
+                    g_mainWin->getFileList()->fileInfo(tmpFile);
                 } else if (file->getType() == FileType::Orphan) {
-                    g_vnote->getMainWindow()->editOrphanFileInfo(file);
+                    g_mainWin->editOrphanFileInfo(file);
                 }
             });
 
@@ -262,8 +263,10 @@ void VEditWindow::removeEditTab(int p_index)
 
 int VEditWindow::insertEditTab(int p_index, VFile *p_file, QWidget *p_page)
 {
-    int idx = insertTab(p_index, p_page, p_file->getName());
+    int idx = insertTab(p_index,
-    setTabToolTip(idx, generateTooltip(p_file));
+                        p_page,
+                        p_file->getName());
+    updateTabInfo(idx);
     return idx;
 }
 
@@ -466,15 +469,17 @@ void VEditWindow::updateTabStatus(int p_index)
 
     if (p_index == -1) {
         emit tabStatusUpdated(VEditTabInfo());
-        emit outlineChanged(VToc());
+        emit outlineChanged(VTableOfContent());
-        emit curHeaderChanged(VAnchor());
+        emit currentHeaderChanged(VHeaderPointer());
         return;
     }
 
     VEditTab *tab = getTab(p_index);
-    tab->updateStatus();
+    emit tabStatusUpdated(tab->fetchTabInfo());
-    tab->requestUpdateOutline();
+    emit outlineChanged(tab->getOutline());
-    tab->requestUpdateCurHeader();
+    emit currentHeaderChanged(tab->getCurrentHeader());
+
+    updateTabInfo(p_index);
 }
 
 void VEditWindow::updateTabInfo(int p_index)
@@ -483,8 +488,7 @@ void VEditWindow::updateTabInfo(int p_index)
     const VFile *file = editor->getFile();
     bool editMode = editor->isEditMode();
 
-    setTabText(p_index, generateTabText(p_index, file->getName(),
+    setTabText(p_index, generateTabText(p_index, file));
-                                        file->isModified(), file->isModifiable()));
     setTabToolTip(p_index, generateTooltip(file));
 
     QString iconUrl(":/resources/icons/reading.svg");
@@ -501,31 +505,28 @@ void VEditWindow::updateAllTabsSequence()
     for (int i = 0; i < count(); ++i) {
         VEditTab *editor = getTab(i);
         const VFile *file = editor->getFile();
-        setTabText(i, generateTabText(i, file->getName(),
+        setTabText(i, generateTabText(i, file));
-                                      file->isModified(), file->isModifiable()));
     }
 }
 
-// Be requested to report current outline
+VTableOfContent VEditWindow::getOutline() const
-void VEditWindow::requestUpdateOutline()
 {
     int idx = currentIndex();
     if (idx == -1) {
-        emit outlineChanged(VToc());
+        return VTableOfContent();
-        return;
-    }
-    getTab(idx)->requestUpdateOutline();
     }
 
-// Be requested to report current header
+    return getTab(idx)->getOutline();
-void VEditWindow::requestUpdateCurHeader()
+}
+
+VHeaderPointer VEditWindow::getCurrentHeader() const
 {
     int idx = currentIndex();
     if (idx == -1) {
-        emit curHeaderChanged(VAnchor());
+        return VHeaderPointer();
-        return;
     }
-    getTab(idx)->requestUpdateCurHeader();
+
+    return getTab(idx)->getCurrentHeader();
 }
 
 // Focus this windows. Try to focus current tab.
@@ -681,44 +682,39 @@ bool VEditWindow::canRemoveSplit()
     return splitter->count() > 1;
 }
 
-void VEditWindow::handleOutlineChanged(const VToc &p_toc)
+void VEditWindow::handleTabOutlineChanged(const VTableOfContent &p_outline)
 {
-    // Only propagate it if it is current tab
+    // Only propagate it if it is current tab.
-    int idx = currentIndex();
+    VEditTab *tab = getCurrentTab();
-    if (idx == -1) {
+    if (tab) {
-        emit outlineChanged(VToc());
+        if (tab->getFile() == p_outline.getFile()) {
-        return;
+            emit outlineChanged(p_outline);
         }
-    const VFile *file = getTab(idx)->getFile();
+    } else {
-    if (p_toc.m_file == file) {
+        emit outlineChanged(VTableOfContent());
-        emit outlineChanged(p_toc);
+        return;
     }
 }
 
-void VEditWindow::handleCurHeaderChanged(const VAnchor &p_anchor)
+void VEditWindow::handleTabCurrentHeaderChanged(const VHeaderPointer &p_header)
 {
-    // Only propagate it if it is current tab
+    // Only propagate it if it is current tab.
-    int idx = currentIndex();
+    VEditTab *tab = getCurrentTab();
-    if (idx == -1) {
+    if (tab) {
-        emit curHeaderChanged(VAnchor());
+        if (tab->getFile() == p_header.m_file) {
-        return;
+            emit currentHeaderChanged(p_header);
         }
-    const VFile *file = getTab(idx)->getFile();
+    } else {
-    if (p_anchor.m_file == file) {
+        emit currentHeaderChanged(VHeaderPointer());
-        emit curHeaderChanged(p_anchor);
+        return;
     }
 }
 
-void VEditWindow::scrollCurTab(const VAnchor &p_anchor)
+void VEditWindow::scrollToHeader(const VHeaderPointer &p_header)
 {
-    int idx = currentIndex();
+    VEditTab *tab = getCurrentTab();
-    if (idx == -1) {
+    if (tab) {
-        emit curHeaderChanged(VAnchor());
+        tab->scrollToHeader(p_header);
-        return;
-    }
-    const VFile *file = getTab(idx)->getFile();
-    if (file == p_anchor.m_file) {
-        getTab(idx)->scrollToAnchor(p_anchor);
     }
 }
 
@@ -794,22 +790,37 @@ void VEditWindow::updateNotebookInfo(const VNotebook *p_notebook)
     }
 }
 
-VEditTab *VEditWindow::currentEditTab()
+VEditTab *VEditWindow::getCurrentTab() const
 {
     int idx = currentIndex();
     if (idx == -1) {
         return NULL;
     }
+
     return getTab(idx);
 }
 
+QVector<VEditTabInfo> VEditWindow::getAllTabsInfo() const
+{
+    int nrTab = count();
+
+    QVector<VEditTabInfo> tabs;
+    tabs.reserve(nrTab);
+    for (int i = 0; i < nrTab; ++i) {
+        VEditTab *editTab = getTab(i);
+        tabs.push_back(editTab->fetchTabInfo());
+    }
+
+    return tabs;
+}
+
 void VEditWindow::handleLocateAct()
 {
     int tab = m_locateAct->data().toInt();
     VEditTab *editor = getTab(tab);
     QPointer<VFile> file = editor->getFile();
     if (file->getType() == FileType::Note) {
-        vnote->getMainWindow()->locateFile(file);
+        g_mainWin->locateFile(file);
     }
 }
 
@@ -901,9 +912,9 @@ void VEditWindow::connectEditTab(const VEditTab *p_tab)
     connect(p_tab, &VEditTab::getFocused,
             this, &VEditWindow::getFocused);
     connect(p_tab, &VEditTab::outlineChanged,
-            this, &VEditWindow::handleOutlineChanged);
+            this, &VEditWindow::handleTabOutlineChanged);
-    connect(p_tab, &VEditTab::curHeaderChanged,
+    connect(p_tab, &VEditTab::currentHeaderChanged,
-            this, &VEditWindow::handleCurHeaderChanged);
+            this, &VEditWindow::handleTabCurrentHeaderChanged);
     connect(p_tab, &VEditTab::statusUpdated,
             this, &VEditWindow::handleTabStatusUpdated);
     connect(p_tab, &VEditTab::statusMessage,
@@ -1014,7 +1025,7 @@ void VEditWindow::dropEvent(QDropEvent *p_event)
 
         if (!files.isEmpty()) {
             focusWindow();
-            g_vnote->getMainWindow()->openExternalFiles(files);
+            g_mainWin->openFiles(files);
         }
 
         p_event->acceptProposedAction();

src/veditwindow.h

@@ -8,11 +8,9 @@
 #include <QDir>
 #include "vnotebook.h"
 #include "vedittab.h"
-#include "vtoc.h"
 #include "vconstants.h"
 #include "vnotefile.h"
 
-class VNote;
 class QPushButton;
 class QActionGroup;
 class VEditArea;
@@ -21,7 +19,7 @@ class VEditWindow : public QTabWidget
 {
     Q_OBJECT
 public:
-    explicit VEditWindow(VNote *vnote, VEditArea *editArea, QWidget *parent = 0);
+    explicit VEditWindow(VEditArea *editArea, QWidget *parent = 0);
     int findTabByFile(const VFile *p_file) const;
     int openFile(VFile *p_file, OpenFileMode p_mode);
     bool closeFile(const VFile *p_file, bool p_forced);
@@ -32,15 +30,29 @@ public:
     void readFile();
     void saveAndReadFile();
     bool closeAllFiles(bool p_forced);
-    void requestUpdateOutline();
+
-    void requestUpdateCurHeader();
+    // Return outline of current tab.
+    VTableOfContent getOutline() const;
+
+    // Return current header of current tab.
+    VHeaderPointer getCurrentHeader() const;
+
     // Focus to current tab's editor
     void focusWindow();
-    void scrollCurTab(const VAnchor &p_anchor);
+
+    // Scroll current tab to header @p_header.
+    void scrollToHeader(const VHeaderPointer &p_header);
+
     void updateFileInfo(const VFile *p_file);
     void updateDirectoryInfo(const VDirectory *p_dir);
     void updateNotebookInfo(const VNotebook *p_notebook);
-    VEditTab *currentEditTab();
+
+    VEditTab *getCurrentTab() const;
+
+    VEditTab *getTab(int tabIndex) const;
+
+    QVector<VEditTabInfo> getAllTabsInfo() const;
+
     // Insert a tab with @p_widget. @p_widget is a fully initialized VEditTab.
     bool addEditTab(QWidget *p_widget);
     // Set whether it is the current window.
@@ -53,7 +65,6 @@ public:
     bool activateTab(int p_sequence);
     // Switch to previous activated tab.
     bool alternateTab();
-    VEditTab *getTab(int tabIndex) const;
 
     // Ask tab @p_index to update its status and propogate.
     // The status here means tab status, outline, current header.
@@ -79,8 +90,10 @@ signals:
     void requestRemoveSplit(VEditWindow *curWindow);
     // This widget or its children get the focus
     void getFocused();
-    void outlineChanged(const VToc &toc);
+
-    void curHeaderChanged(const VAnchor &anchor);
+    void outlineChanged(const VTableOfContent &p_outline);
+
+    void currentHeaderChanged(const VHeaderPointer &p_header);
 
     // Emit when want to show message in status bar.
     void statusMessage(const QString &p_msg);
@@ -100,8 +113,11 @@ private slots:
     void handleCurrentIndexChanged(int p_index);
     void contextMenuRequested(QPoint pos);
     void tabListJump(VFile *p_file);
-    void handleOutlineChanged(const VToc &p_toc);
+
-    void handleCurHeaderChanged(const VAnchor &p_anchor);
+    void handleTabOutlineChanged(const VTableOfContent &p_outline);
+
+    void handleTabCurrentHeaderChanged(const VHeaderPointer &p_header);
+
     void updateSplitMenu();
     void tabbarContextMenuRequested(QPoint p_pos);
     void handleLocateAct();
@@ -124,9 +140,11 @@ private:
     int insertEditTab(int p_index, VFile *p_file, QWidget *p_page);
     int appendEditTab(VFile *p_file, QWidget *p_page);
     int openFileInTab(VFile *p_file, OpenFileMode p_mode);
-    inline QString generateTooltip(const VFile *p_file) const;
+
-    inline QString generateTabText(int p_index, const QString &p_name,
+    QString generateTooltip(const VFile *p_file) const;
-                                   bool p_modified, bool p_modifiable) const;
+
+    QString generateTabText(int p_index, const VFile *p_file) const;
+
     bool canRemoveSplit();
 
     // Move tab at @p_tabIdx one split window.
@@ -135,6 +153,7 @@ private:
     // and move the tab to the new split.
     void moveTabOneSplit(int p_tabIdx, bool p_right);
 
+    // Update info of tab @p_idx according to the state of the editor and file.
     void updateTabInfo(int p_idx);
 
     // Update the sequence number of all the tabs.
@@ -143,7 +162,6 @@ private:
     // Connect the signals of VEditTab to this VEditWindow.
     void connectEditTab(const VEditTab *p_tab);
 
-    VNote *vnote;
     VEditArea *m_editArea;
 
     // These two members are only used for alternateTab().
@@ -197,11 +215,16 @@ inline QString VEditWindow::generateTooltip(const VFile *p_file) const
     }
 }
 
-inline QString VEditWindow::generateTabText(int p_index, const QString &p_name,
+inline QString VEditWindow::generateTabText(int p_index, const VFile *p_file) const
-                                            bool p_modified, bool p_modifiable) const
 {
-    QString seq = QString::number(p_index + c_tabSequenceBase, 10);
+    if (!p_file) {
-    return seq + ". " + p_name + (p_modifiable ? (p_modified ? "*" : "") : "#");
+        return "";
+    }
+
+    return QString("%1.%2%3").arg(QString::number(p_index + c_tabSequenceBase, 10))
+                             .arg(p_file->getName())
+                             .arg(p_file->isModifiable()
+                                  ? (p_file->isModified() ? "*" : "") : "#");
 }
 
 #endif // VEDITWINDOW_H

src/vfilelist.cpp

@@ -263,7 +263,7 @@ void VFileList::fileInfo(VNoteFile *p_file)
 
 void VFileList::fillItem(QListWidgetItem *p_item, const VNoteFile *p_file)
 {
-    unsigned long long ptr = (long long)p_file;
+    qulonglong ptr = (qulonglong)p_file;
     p_item->setData(Qt::UserRole, ptr);
     p_item->setToolTip(p_file->getName());
     p_item->setText(p_file->getName());
@@ -330,7 +330,9 @@ void VFileList::newFile()
     info = info + "<br>" + tr("Note with name ending with \"%1\" will be treated as Markdown type.")
                              .arg(suffixStr);
     QString defaultName = QString("new_note.%1").arg(defaultSuf);
-    defaultName = VUtils::getFileNameWithSequence(m_directory->fetchPath(), defaultName);
+    defaultName = VUtils::getFileNameWithSequence(m_directory->fetchPath(),
+                                                  defaultName,
+                                                  true);
     VNewFileDialog dialog(tr("Create Note"), info, defaultName, m_directory, this);
     if (dialog.exec() == QDialog::Accepted) {
         VNoteFile *file = m_directory->createFile(dialog.getNameInput());
@@ -349,7 +351,7 @@ void VFileList::newFile()
                 qWarning() << "fail to open newly-created note" << file->getName();
             } else {
                 Q_ASSERT(file->getContent().isEmpty());
-                QString content = QString("# %1\n").arg(QFileInfo(file->getName()).baseName());
+                QString content = QString("# %1\n").arg(QFileInfo(file->getName()).completeBaseName());
                 file->setContent(content);
                 if (!file->save()) {
                     qWarning() << "fail to write to newly-created note" << file->getName();
@@ -372,7 +374,7 @@ void VFileList::newFile()
 
         // Move cursor down if content has been inserted.
         if (contentInserted) {
-            const VMdTab *tab = dynamic_cast<VMdTab *>(editArea->currentEditTab());
+            const VMdTab *tab = dynamic_cast<VMdTab *>(editArea->getCurrentTab());
             if (tab) {
                 VMdEdit *edit = dynamic_cast<VMdEdit *>(tab->getEditor());
                 if (edit && edit->getFile() == file) {
@@ -621,7 +623,7 @@ bool VFileList::importFiles(const QStringList &p_files, QString *p_errMsg)
 
         QString name = VUtils::fileNameFromPath(file);
         Q_ASSERT(!name.isEmpty());
-        name = VUtils::getFileNameWithSequence(dirPath, name);
+        name = VUtils::getFileNameWithSequence(dirPath, name, true);
         QString targetFilePath = dir.filePath(name);
         bool ret = VUtils::copyFile(file, targetFilePath, false);
         if (!ret) {
@@ -763,10 +765,14 @@ void VFileList::pasteFiles(VDirectory *p_destDir,
             }
 
             // Rename it to xxx_copy.md.
-            fileName = VUtils::generateCopiedFileName(file->fetchBasePath(), fileName);
+            fileName = VUtils::generateCopiedFileName(file->fetchBasePath(),
+                                                      fileName,
+                                                      true);
         } else {
             // Rename it to xxx_copy.md if needed.
-            fileName = VUtils::generateCopiedFileName(p_destDir->fetchPath(), fileName);
+            fileName = VUtils::generateCopiedFileName(p_destDir->fetchPath(),
+                                                      fileName,
+                                                      true);
         }
 
         QString msg;

src/vfilelist.h

@@ -44,7 +44,9 @@ public:
     // Locate @p_file in the list widget.
     bool locateFile(const VNoteFile *p_file);
 
-    inline const VDirectory *currentDirectory() const;
+    const VDirectory *currentDirectory() const;
+
+    QWidget *getContentWidget() const;
 
     // Implementations for VNavigationMode.
     void registerNavigation(QChar p_majorKey) Q_DECL_OVERRIDE;
@@ -199,4 +201,9 @@ inline const VDirectory *VFileList::currentDirectory() const
     return m_directory;
 }
 
+inline QWidget *VFileList::getContentWidget() const
+{
+    return fileList;
+}
+
 #endif // VFILELIST_H

src/vfilesessioninfo.cpp

@@ -0,0 +1,74 @@
+#include "vfilesessioninfo.h"
+
+#include <QSettings>
+
+#include "vedittabinfo.h"
+#include "vtableofcontent.h"
+#include "vedittab.h"
+
+
+VFileSessionInfo::VFileSessionInfo()
+    : m_mode(OpenFileMode::Read),
+      m_headerIndex(-1),
+      m_cursorBlockNumber(-1),
+      m_cursorPositionInBlock(-1)
+{
+}
+
+VFileSessionInfo::VFileSessionInfo(const QString &p_file,
+                                   OpenFileMode p_mode)
+    : m_file(p_file),
+      m_mode(p_mode),
+      m_headerIndex(-1),
+      m_cursorBlockNumber(-1),
+      m_cursorPositionInBlock(-1)
+{
+}
+
+// Fetch VFileSessionInfo from @p_tabInfo.
+VFileSessionInfo VFileSessionInfo::fromEditTabInfo(const VEditTabInfo *p_tabInfo)
+{
+    Q_ASSERT(p_tabInfo);
+    VEditTab *tab = p_tabInfo->m_editTab;
+    VFileSessionInfo info(tab->getFile()->fetchPath(),
+                          tab->isEditMode() ? OpenFileMode::Edit : OpenFileMode::Read);
+    info.m_headerIndex = p_tabInfo->m_headerIndex;
+    info.m_cursorBlockNumber = p_tabInfo->m_cursorBlockNumber;
+    info.m_cursorPositionInBlock = p_tabInfo->m_cursorPositionInBlock;
+
+    return info;
+}
+
+void VFileSessionInfo::toEditTabInfo(VEditTabInfo *p_tabInfo) const
+{
+    p_tabInfo->m_headerIndex = m_headerIndex;
+    p_tabInfo->m_cursorBlockNumber = m_cursorBlockNumber;
+    p_tabInfo->m_cursorPositionInBlock = m_cursorPositionInBlock;
+}
+
+VFileSessionInfo VFileSessionInfo::fromSettings(const QSettings *p_settings)
+{
+    VFileSessionInfo info;
+    info.m_file = p_settings->value(FileSessionConfig::c_file).toString();
+    int tmpMode = p_settings->value(FileSessionConfig::c_mode).toInt();
+    if (tmpMode >= (int)OpenFileMode::Read && tmpMode < (int)OpenFileMode::Invalid) {
+        info.m_mode = (OpenFileMode)tmpMode;
+    } else {
+        info.m_mode = OpenFileMode::Read;
+    }
+
+    info.m_headerIndex = p_settings->value(FileSessionConfig::c_headerIndex).toInt();
+    info.m_cursorBlockNumber = p_settings->value(FileSessionConfig::c_cursorBlockNumber).toInt();
+    info.m_cursorPositionInBlock = p_settings->value(FileSessionConfig::c_cursorPositionInBlock).toInt();
+
+    return info;
+}
+
+void VFileSessionInfo::toSettings(QSettings *p_settings) const
+{
+    p_settings->setValue(FileSessionConfig::c_file, m_file);
+    p_settings->setValue(FileSessionConfig::c_mode, (int)m_mode);
+    p_settings->setValue(FileSessionConfig::c_headerIndex, m_headerIndex);
+    p_settings->setValue(FileSessionConfig::c_cursorBlockNumber, m_cursorBlockNumber);
+    p_settings->setValue(FileSessionConfig::c_cursorPositionInBlock, m_cursorPositionInBlock);
+}

src/vfilesessioninfo.h

@@ -0,0 +1,57 @@
+#ifndef VFILESESSIONINFO_H
+#define VFILESESSIONINFO_H
+
+#include "vconstants.h"
+
+struct VEditTabInfo;
+class QSettings;
+
+namespace FileSessionConfig
+{
+    static const QString c_file = "file";
+    static const QString c_mode = "mode";
+
+    // Index in outline of the anchor.
+    static const QString c_headerIndex = "header_index";
+
+    static const QString c_cursorBlockNumber = "cursor_block_number";
+    static const QString c_cursorPositionInBlock = "cursor_position_in_block";
+}
+
+// Information about an opened file (session).
+class VFileSessionInfo
+{
+public:
+    VFileSessionInfo();
+
+    VFileSessionInfo(const QString &p_file,
+                     OpenFileMode p_mode);
+
+    // Fetch VFileSessionInfo from @p_tabInfo.
+    static VFileSessionInfo fromEditTabInfo(const VEditTabInfo *p_tabInfo);
+
+    // Fill corresponding fields of @p_tabInfo.
+    void toEditTabInfo(VEditTabInfo *p_tabInfo) const;
+
+    // Fetch VFileSessionInfo from @p_settings.
+    static VFileSessionInfo fromSettings(const QSettings *p_settings);
+
+    void toSettings(QSettings *p_settings) const;
+
+    // Absolute path of the file.
+    QString m_file;
+
+    // Mode of this file in this session.
+    OpenFileMode m_mode;
+
+    // Index in outline of the header.
+    int m_headerIndex;
+
+    // Block number of cursor block.
+    int m_cursorBlockNumber;
+
+    // Position in block of cursor.
+    int m_cursorPositionInBlock;
+};
+
+#endif // VFILESESSIONINFO_H

src/vhtmltab.cpp

@@ -32,7 +32,7 @@ void VHtmlTab::setupUI()
 {
     m_editor = new VEdit(m_file, this);
     connect(m_editor, &VEdit::textChanged,
-            this, &VHtmlTab::handleTextChanged);
+            this, &VHtmlTab::updateStatus);
     connect(m_editor, &VEdit::saveAndRead,
             this, &VHtmlTab::saveAndRead);
     connect(m_editor, &VEdit::discardAndRead,
@@ -52,17 +52,6 @@ void VHtmlTab::setupUI()
     setLayout(mainLayout);
 }
 
-void VHtmlTab::handleTextChanged()
-{
-    V_ASSERT(m_file->isModifiable());
-
-    if (m_modified) {
-        return;
-    }
-
-    updateStatus();
-}
-
 void VHtmlTab::showFileReadMode()
 {
     m_isEditMode = false;
@@ -194,10 +183,6 @@ void VHtmlTab::discardAndRead()
     readFile();
 }
 
-void VHtmlTab::scrollToAnchor(const VAnchor & /* p_anchor */)
-{
-}
-
 void VHtmlTab::insertImage()
 {
 }
@@ -252,3 +237,12 @@ void VHtmlTab::requestUpdateVimStatus()
 {
     m_editor->requestUpdateVimStatus();
 }
+
+bool VHtmlTab::restoreFromTabInfo(const VEditTabInfo &p_info)
+{
+    if (p_info.m_editTab != this) {
+        return false;
+    }
+
+    return true;
+}

src/vhtmltab.h

@@ -26,9 +26,6 @@ public:
     // Save file.
     bool saveFile() Q_DECL_OVERRIDE;
 
-    // Scroll to anchor @p_anchor.
-    void scrollToAnchor(const VAnchor& p_anchor) Q_DECL_OVERRIDE;
-
     void insertImage() Q_DECL_OVERRIDE;
 
     // Search @p_text in current note.
@@ -53,9 +50,6 @@ public slots:
     void editFile() Q_DECL_OVERRIDE;
 
 private slots:
-    // Handle text changed in m_editor.
-    void handleTextChanged();
-
     // m_editor requests to save changes and enter read mode.
     void saveAndRead();
 
@@ -78,6 +72,10 @@ private:
     // Focus the proper child widget.
     void focusChild() Q_DECL_OVERRIDE;
 
+    // Restore from @p_fino.
+    // Return true if succeed.
+    bool restoreFromTabInfo(const VEditTabInfo &p_info) Q_DECL_OVERRIDE;
+
     VEdit *m_editor;
 };
 #endif // VHTMLTAB_H

src/vlineedit.cpp

@@ -0,0 +1,48 @@
+#include "vlineedit.h"
+
+#include <QDebug>
+#include <QToolTip>
+
+#include "utils/vmetawordmanager.h"
+
+
+extern VMetaWordManager *g_mwMgr;
+
+VLineEdit::VLineEdit(QWidget *p_parent)
+    : QLineEdit(p_parent)
+{
+    init();
+}
+
+VLineEdit::VLineEdit(const QString &p_contents, QWidget *p_parent)
+    : QLineEdit(p_contents, p_parent)
+{
+    init();
+}
+
+void VLineEdit::handleTextChanged(const QString &p_text)
+{
+    m_evaluatedText = g_mwMgr->evaluate(p_text);
+    qDebug() << "evaluate text:" << m_evaluatedText;
+
+    if (m_evaluatedText == p_text) {
+        return;
+    }
+
+    // Display tooltip at bottom-left.
+    QPoint pos = mapToGlobal(QPoint(0, height()));
+    QToolTip::showText(pos, m_evaluatedText, this);
+}
+
+void VLineEdit::init()
+{
+    m_evaluatedText = g_mwMgr->evaluate(text());
+
+    connect(this, &QLineEdit::textChanged,
+            this, &VLineEdit::handleTextChanged);
+}
+
+const QString VLineEdit::getEvaluatedText() const
+{
+    return m_evaluatedText;
+}

src/vlineedit.h

@@ -0,0 +1,29 @@
+#ifndef VLINEEDIT_H
+#define VLINEEDIT_H
+
+#include <QLineEdit>
+
+
+// QLineEdit with meta word support.
+class VLineEdit : public QLineEdit
+{
+    Q_OBJECT
+public:
+    explicit VLineEdit(QWidget *p_parent = nullptr);
+
+    VLineEdit(const QString &p_contents, QWidget *p_parent = Q_NULLPTR);
+
+    // Return the evaluated text.
+    const QString getEvaluatedText() const;
+
+private slots:
+    void handleTextChanged(const QString &p_text);
+
+private:
+    void init();
+
+    // We should keep the evaluated text identical with what's displayed.
+    QString m_evaluatedText;
+};
+
+#endif // VLINEEDIT_H

src/vmainwindow.h

@@ -38,6 +38,15 @@ class QShortcut;
 class VButtonWithWidget;
 class VAttachmentList;
 
+enum class PanelViewState
+{
+    ExpandMode,
+    SinglePanel,
+    TwoPanels,
+    CompactMode,
+    Invalid
+};
+
 class VMainWindow : public QMainWindow
 {
     Q_OBJECT
@@ -51,18 +60,17 @@ public:
     // Returns true if the location succeeds.
     bool locateFile(VFile *p_file);
 
-    // Returns true if the location succeeds.
-    bool locateCurrentFile();
-
     VFileList *getFileList() const;
 
+    VEditArea *getEditArea() const;
+
     // View and edit the information of @p_file, which is an orphan file.
     void editOrphanFileInfo(VFile *p_file);
 
-    // Open external files @p_files as orphan files.
+    // Open files @p_files as orphan files or internal note files.
     // If @p_forceOrphan is false, for each file, VNote will try to find out if
     // it is a note inside VNote. If yes, VNote will open it as internal file.
-    void openExternalFiles(const QStringList &p_files, bool p_forceOrphan = false);
+    void openFiles(const QStringList &p_files, bool p_forceOrphan = false);
 
     // Try to open @p_filePath as internal note.
     bool tryOpenInternalFile(const QString &p_filePath);
@@ -70,15 +78,23 @@ public:
     // Show a temporary message in status bar.
     void showStatusMessage(const QString &p_msg);
 
-    // Popup the attachment list if it is enabled.
+    // Open startup pages according to configuration.
-    void showAttachmentList();
+    void openStartupPages();
+
+    VCaptain *getCaptain() const;
+
+    // Prompt user for new notebook if there is no notebook.
+    void promptNewNotebookIfEmpty();
 
 private slots:
     void importNoteFromFile();
     void viewSettings();
     void changeMarkdownConverter(QAction *action);
     void aboutMessage();
-    void shortcutHelp();
+
+    // Display shortcuts help.
+    void shortcutsHelp();
+
     void changeExpandTab(bool checked);
     void setTabStopWidth(QAction *action);
     void setEditorBackgroundColor(QAction *action);
@@ -105,17 +121,15 @@ private slots:
     void changeHighlightTrailingSapce(bool p_checked);
     void onePanelView();
     void twoPanelView();
-    void expandPanelView(bool p_checked);
+    void compactModeView();
     void curEditFileInfo();
     void deleteCurNote();
     void handleCurrentDirectoryChanged(const VDirectory *p_dir);
     void handleCurrentNotebookChanged(const VNotebook *p_notebook);
-    void insertImage();
     void handleFindDialogTextChanged(const QString &p_text, uint p_options);
     void openFindDialog();
     void enableMermaid(bool p_checked);
     void enableMathjax(bool p_checked);
-    void handleCaptainModeChanged(bool p_enabled);
     void changeAutoIndent(bool p_checked);
     void changeAutoList(bool p_checked);
     void changeVimMode(bool p_checked);
@@ -127,10 +141,14 @@ private slots:
     void printNote();
     void exportAsPDF();
 
+    // Set the panel view properly.
+    void enableCompactMode(bool p_enabled);
+
     // Handle Vim status updated.
     void handleVimStatusUpdated(const VVim *p_vim);
 
     // Handle the status update of the current tab of VEditArea.
+    // Will be called frequently.
     void handleAreaTabStatusUpdated(const VEditTabInfo &p_info);
 
     // Check the shared memory between different instances to see if we have
@@ -142,6 +160,9 @@ private slots:
     // Restore main window.
     void showMainWindow();
 
+    // Close current note.
+    void closeCurrentFile();
+
 protected:
     void closeEvent(QCloseEvent *event) Q_DECL_OVERRIDE;
     void resizeEvent(QResizeEvent *event) Q_DECL_OVERRIDE;
@@ -186,17 +207,19 @@ private:
     void initEditorLineNumberMenu(QMenu *p_menu);
 
     void initEditorStyleMenu(QMenu *p_emnu);
-    void changeSplitterView(int nrPanel);
     void updateWindowTitle(const QString &str);
-    void updateActionStateFromTabStatusChange(const VFile *p_file,
+
-                                              bool p_editMode);
+    // Update state of actions according to @p_tab.
+    void updateActionsStateFromTab(const VEditTab *p_tab);
+
     void saveStateAndGeometry();
     void restoreStateAndGeometry();
     void repositionAvatar();
 
+    // Should init VCaptain before setupUI().
     void initCaptain();
-    void toggleOnePanelView();
+
-    void closeCurrentFile();
+    void registerCaptainAndNavigationTargets();
 
     // Update status bar information.
     void updateStatusInfo(const VEditTabInfo &p_info);
@@ -213,6 +236,37 @@ private:
     // Init system tray icon and correspondign context menu.
     void initTrayIcon();
 
+    // Change the panel view according to @p_state.
+    // Will not change m_panelViewState.
+    void changePanelView(PanelViewState p_state);
+
+    // Whether heading sequence is applicable to current tab.
+    // Only available for writable Markdown file.
+    bool isHeadingSequenceApplicable() const;
+
+    // Captain mode functions.
+
+    // Popup the attachment list if it is enabled.
+    static void showAttachmentListByCaptain(void *p_target, void *p_data);
+
+    static void locateCurrentFileByCaptain(void *p_target, void *p_data);
+
+    static void toggleExpandModeByCaptain(void *p_target, void *p_data);
+
+    static void toggleOnePanelViewByCaptain(void *p_target, void *p_data);
+
+    static void discardAndReadByCaptain(void *p_target, void *p_data);
+
+    static void toggleToolsDockByCaptain(void *p_target, void *p_data);
+
+    static void closeFileByCaptain(void *p_target, void *p_data);
+
+    static void shortcutsHelpByCaptain(void *p_target, void *p_data);
+
+    static void flushLogFileByCaptain(void *p_target, void *p_data);
+
+    // End Captain mode functions.
+
     VNote *vnote;
     QPointer<VFile> m_curFile;
     QPointer<VEditTab> m_curTab;
@@ -222,10 +276,18 @@ private:
     QLabel *notebookLabel;
     QLabel *directoryLabel;
     VNotebookSelector *notebookSelector;
-    VFileList *fileList;
+    VFileList *m_fileList;
     VDirectoryTree *directoryTree;
-    QSplitter *mainSplitter;
+
+    // Splitter for directory | files | edit.
+    QSplitter *m_mainSplitter;
+
+    // Splitter for directory | files.
+    // Move directory and file panel in one compact vertical split.
+    QSplitter *m_naviSplitter;
+
     VEditArea *editArea;
+
     QDockWidget *toolDock;
     QToolBox *toolBox;
     VOutline *outline;
@@ -234,8 +296,8 @@ private:
     VVimIndicator *m_vimIndicator;
     VTabIndicator *m_tabIndicator;
 
-    // Whether it is one panel or two panles.
+    // SinglePanel, TwoPanels, CompactMode.
-    bool m_onePanel;
+    PanelViewState m_panelViewState;
 
     // Actions
     QAction *newRootDirAct;
@@ -251,7 +313,6 @@ private:
     QAction *m_printAct;
     QAction *m_exportAsPDFAct;
 
-    QAction *m_insertImageAct;
     QAction *m_findReplaceAct;
     QAction *m_findNextAct;
     QAction *m_findPreviousAct;
@@ -261,6 +322,9 @@ private:
 
     QAction *m_autoIndentAct;
 
+    // Enable heading sequence for current note.
+    QAction *m_headingSequenceAct;
+
     // Act group for render styles.
     QActionGroup *m_renderStyleActs;
 
@@ -269,6 +333,9 @@ private:
     // Act group for code block render styles.
     QActionGroup *m_codeBlockStyleActs;
 
+    // Act group for panel view actions.
+    QActionGroup *m_viewActGroup;
+
     QShortcut *m_closeNoteShortcut;
 
     // Menus
@@ -306,7 +373,17 @@ private:
 
 inline VFileList *VMainWindow::getFileList() const
 {
-    return fileList;
+    return m_fileList;
+}
+
+inline VEditArea *VMainWindow::getEditArea() const
+{
+    return editArea;
+}
+
+inline VCaptain *VMainWindow::getCaptain() const
+{
+    return m_captain;
 }
 
 #endif // VMAINWINDOW_H

src/vmdedit.cpp

@@ -5,7 +5,7 @@
 #include "vmdeditoperations.h"
 #include "vnote.h"
 #include "vconfigmanager.h"
-#include "vtoc.h"
+#include "vtableofcontent.h"
 #include "utils/vutils.h"
 #include "utils/veditutils.h"
 #include "utils/vpreviewutils.h"
@@ -35,7 +35,7 @@ VMdEdit::VMdEdit(VFile *p_file, VDocument *p_vdoc, MarkdownConverterType p_type,
                                                 document());
 
     connect(m_mdHighlighter, &HGMarkdownHighlighter::headersUpdated,
-            this, &VMdEdit::updateOutline);
+            this, &VMdEdit::updateHeaders);
 
     // After highlight, the cursor may trun into non-visible. We should make it visible
     // in this case.
@@ -74,7 +74,7 @@ VMdEdit::VMdEdit(VFile *p_file, VDocument *p_vdoc, MarkdownConverterType p_type,
             this, &VEdit::vimStatusUpdated);
 
     connect(this, &VMdEdit::cursorPositionChanged,
-            this, &VMdEdit::updateCurHeader);
+            this, &VMdEdit::updateCurrentHeader);
 
     connect(QApplication::clipboard(), &QClipboard::changed,
             this, &VMdEdit::handleClipboardChanged);
@@ -111,7 +111,7 @@ void VMdEdit::beginEdit()
         setReadOnly(false);
     }
 
-    updateOutline(m_mdHighlighter->getHeaderRegions());
+    updateHeaders(m_mdHighlighter->getHeaderRegions());
 }
 
 void VMdEdit::endEdit()
@@ -345,43 +345,9 @@ void VMdEdit::clearUnusedImages()
     m_initImages.clear();
 }
 
-int VMdEdit::currentCursorHeader() const
+void VMdEdit::updateCurrentHeader()
 {
-    if (m_headers.isEmpty()) {
+    emit currentHeaderChanged(textCursor().block().blockNumber());
-        return -1;
-    }
-
-    int curLine = textCursor().block().firstLineNumber();
-    int i = 0;
-    for (i = m_headers.size() - 1; i >= 0; --i) {
-        if (!m_headers[i].isEmpty()) {
-            if (m_headers[i].lineNumber <= curLine) {
-                break;
-            }
-        }
-    }
-
-    if (i == -1) {
-        return -1;
-    } else {
-        Q_ASSERT(m_headers[i].index == i);
-        return i;
-    }
-}
-
-void VMdEdit::updateCurHeader()
-{
-    if (m_headers.isEmpty()) {
-        return;
-    }
-
-    int idx = currentCursorHeader();
-    if (idx == -1) {
-        emit curHeaderChanged(VAnchor(m_file, "", -1, -1));
-        return;
-    }
-
-    emit curHeaderChanged(VAnchor(m_file, "", m_headers[idx].lineNumber, m_headers[idx].index));
 }
 
 static void addHeaderSequence(QVector<int> &p_sequence, int p_level, int p_baseLevel)
@@ -448,11 +414,11 @@ static void insertSequenceToHeader(QTextBlock p_block,
     }
 }
 
-void VMdEdit::updateOutline(const QVector<VElementRegion> &p_headerRegions)
+void VMdEdit::updateHeaders(const QVector<VElementRegion> &p_headerRegions)
 {
     QTextDocument *doc = document();
 
-    QVector<VHeader> headers;
+    QVector<VTableOfContentItem> headers;
     QVector<int> headerBlockNumbers;
     QVector<QString> headerSequences;
     if (!p_headerRegions.isEmpty()) {
@@ -480,8 +446,10 @@ void VMdEdit::updateOutline(const QVector<VElementRegion> &p_headerRegions)
         if ((block.userState() == HighlightBlockState::Normal) &&
             headerReg.exactMatch(block.text())) {
             int level = headerReg.cap(1).length();
-            VHeader header(level, headerReg.cap(2).trimmed(),
+            VTableOfContentItem header(headerReg.cap(2).trimmed(),
-                           "", block.firstLineNumber(), headers.size());
+                                       level,
+                                       block.blockNumber(),
+                                       headers.size());
             headers.append(header);
             headerBlockNumbers.append(block.blockNumber());
             headerSequences.append(headerReg.cap(3));
@@ -496,7 +464,7 @@ void VMdEdit::updateOutline(const QVector<VElementRegion> &p_headerRegions)
 
     m_headers.clear();
 
-    bool autoSequence = g_config->getEnableHeadingSequence() && !isReadOnly();
+    bool autoSequence = m_config.m_enableHeadingSequence && !isReadOnly();
     int headingSequenceBaseLevel = g_config->getHeadingSequenceBaseLevel();
     if (headingSequenceBaseLevel < 1 || headingSequenceBaseLevel > 6) {
         headingSequenceBaseLevel = 1;
@@ -506,22 +474,25 @@ void VMdEdit::updateOutline(const QVector<VElementRegion> &p_headerRegions)
     QRegExp preReg(VUtils::c_headerPrefixRegExp);
     int curLevel = baseLevel - 1;
     for (int i = 0; i < headers.size(); ++i) {
-        VHeader &item = headers[i];
+        VTableOfContentItem &item = headers[i];
-        while (item.level > curLevel + 1) {
+        while (item.m_level > curLevel + 1) {
             curLevel += 1;
 
             // Insert empty level which is an invalid header.
-            m_headers.append(VHeader(curLevel, c_emptyHeaderName, "", -1, m_headers.size()));
+            m_headers.append(VTableOfContentItem(c_emptyHeaderName,
+                                                 curLevel,
+                                                 -1,
+                                                 m_headers.size()));
             if (autoSequence) {
                 addHeaderSequence(seqs, curLevel, headingSequenceBaseLevel);
             }
         }
 
-        item.index = m_headers.size();
+        item.m_index = m_headers.size();
         m_headers.append(item);
-        curLevel = item.level;
+        curLevel = item.m_level;
         if (autoSequence) {
-            addHeaderSequence(seqs, item.level, headingSequenceBaseLevel);
+            addHeaderSequence(seqs, item.m_level, headingSequenceBaseLevel);
 
             QString seqStr = headerSequenceStr(seqs);
             if (headerSequences[i] != seqStr) {
@@ -536,25 +507,16 @@ void VMdEdit::updateOutline(const QVector<VElementRegion> &p_headerRegions)
 
     emit headersChanged(m_headers);
 
-    updateCurHeader();
+    updateCurrentHeader();
 }
 
-void VMdEdit::scrollToHeader(const VAnchor &p_anchor)
+bool VMdEdit::scrollToHeader(int p_blockNumber)
 {
-    if (p_anchor.lineNumber == -1
+    if (p_blockNumber < 0) {
-        || p_anchor.m_outlineIndex < 0) {
+        return false;
-        // Move to the start of document if m_headers is not empty.
-        // Otherwise, there is no outline, so just let it be.
-        if (!m_headers.isEmpty()) {
-            moveCursor(QTextCursor::Start);
     }
 
-        return;
+    return scrollToBlock(p_blockNumber);
-    } else if (p_anchor.m_outlineIndex >= m_headers.size()) {
-        return;
-    }
-
-    scrollToLine(p_anchor.lineNumber);
 }
 
 QString VMdEdit::toPlainTextWithoutImg()
@@ -728,9 +690,21 @@ void VMdEdit::resizeEvent(QResizeEvent *p_event)
     VEdit::resizeEvent(p_event);
 }
 
-const QVector<VHeader> &VMdEdit::getHeaders() const
+int VMdEdit::indexOfCurrentHeader() const
 {
-    return m_headers;
+    if (m_headers.isEmpty()) {
+        return -1;
+    }
+
+    int blockNumber = textCursor().block().blockNumber();
+    for (int i = m_headers.size() - 1; i >= 0; --i) {
+        if (!m_headers[i].isEmpty()
+            && m_headers[i].m_blockNumber <= blockNumber) {
+            return i;
+        }
+    }
+
+    return -1;
 }
 
 bool VMdEdit::jumpTitle(bool p_forward, int p_relativeLevel, int p_repeat)
@@ -740,11 +714,11 @@ bool VMdEdit::jumpTitle(bool p_forward, int p_relativeLevel, int p_repeat)
     }
 
     QTextCursor cursor = textCursor();
-    int cursorLine = cursor.block().firstLineNumber();
+    int cursorLine = cursor.block().blockNumber();
     int targetIdx = -1;
     // -1: skip level check.
     int targetLevel = 0;
-    int idx = currentCursorHeader();
+    int idx = indexOfCurrentHeader();
     if (idx == -1) {
         // Cursor locates at the beginning, before any headers.
         if (p_relativeLevel < 0 || !p_forward) {
@@ -761,7 +735,7 @@ bool VMdEdit::jumpTitle(bool p_forward, int p_relativeLevel, int p_repeat)
     for (targetIdx = idx == -1 ? 0 : idx;
          targetIdx >= 0 && targetIdx < m_headers.size();
          targetIdx += delta) {
-        const VHeader &header = m_headers[targetIdx];
+        const VTableOfContentItem &header = m_headers[targetIdx];
         if (header.isEmpty()) {
             continue;
         }
@@ -769,7 +743,7 @@ bool VMdEdit::jumpTitle(bool p_forward, int p_relativeLevel, int p_repeat)
         if (targetLevel == 0) {
             // The target level has not been init yet.
             Q_ASSERT(firstHeader);
-            targetLevel = header.level;
+            targetLevel = header.m_level;
             if (p_relativeLevel < 0) {
                 targetLevel += p_relativeLevel;
                 if (targetLevel < 1) {
@@ -781,9 +755,9 @@ bool VMdEdit::jumpTitle(bool p_forward, int p_relativeLevel, int p_repeat)
             }
         }
 
-        if (targetLevel == -1 || header.level == targetLevel) {
+        if (targetLevel == -1 || header.m_level == targetLevel) {
             if (firstHeader
-                && (cursorLine == header.lineNumber
+                && (cursorLine == header.m_blockNumber
                     || p_forward)
                 && idx != -1) {
                 // This header is not counted for the repeat.
@@ -795,7 +769,7 @@ bool VMdEdit::jumpTitle(bool p_forward, int p_relativeLevel, int p_repeat)
                 // Found.
                 break;
             }
-        } else if (header.level < targetLevel) {
+        } else if (header.m_level < targetLevel) {
             // Stop by higher level.
             return false;
         }
@@ -808,9 +782,9 @@ bool VMdEdit::jumpTitle(bool p_forward, int p_relativeLevel, int p_repeat)
     }
 
     // Jump to target header.
-    int line = m_headers[targetIdx].lineNumber;
+    int line = m_headers[targetIdx].m_blockNumber;
     if (line > -1) {
-        QTextBlock block = document()->findBlockByLineNumber(line);
+        QTextBlock block = document()->findBlockByNumber(line);
         if (block.isValid()) {
             cursor.setPosition(block.position());
             setTextCursor(cursor);
@@ -837,6 +811,8 @@ void VMdEdit::finishOneAsyncJob(int p_idx)
         m_freshEdit = false;
         emit statusChanged();
 
-        updateOutline(m_mdHighlighter->getHeaderRegions());
+        updateHeaders(m_mdHighlighter->getHeaderRegions());
+
+        emit ready();
     }
 }

src/vmdedit.h

@@ -7,7 +7,7 @@
 #include <QColor>
 #include <QClipboard>
 #include <QImage>
-#include "vtoc.h"
+#include "vtableofcontent.h"
 #include "veditoperations.h"
 #include "vconfigmanager.h"
 #include "utils/vutils.h"
@@ -32,31 +32,34 @@ public:
     // @p_path is the absolute path of the inserted image.
     void imageInserted(const QString &p_path);
 
-    void scrollToHeader(const VAnchor &p_anchor);
+    // Scroll to header @p_blockNumber.
+    // Return true if @p_blockNumber is valid to scroll to.
+    bool scrollToHeader(int p_blockNumber);
 
     // Like toPlainText(), but remove image preview characters.
     QString toPlainTextWithoutImg();
 
-    const QVector<VHeader> &getHeaders() const;
-
 public slots:
     bool jumpTitle(bool p_forward, int p_relativeLevel, int p_repeat) Q_DECL_OVERRIDE;
 
 signals:
-    void headersChanged(const QVector<VHeader> &headers);
+    // Signal when headers change.
+    void headersChanged(const QVector<VTableOfContentItem> &p_headers);
 
     // Signal when current header change.
-    void curHeaderChanged(VAnchor p_anchor);
+    void currentHeaderChanged(int p_blockNumber);
 
     // Signal when the status of VMdEdit changed.
     // Will be emitted by VImagePreviewer for now.
     void statusChanged();
 
 private slots:
-    void updateOutline(const QVector<VElementRegion> &p_headerRegions);
+    // Update m_headers according to elements.
+    void updateHeaders(const QVector<VElementRegion> &p_headerRegions);
 
+    // Update current header according to cursor position.
     // When there is no header in current cursor, will signal an invalid header.
-    void updateCurHeader();
+    void updateCurrentHeader();
 
     void handleClipboardChanged(QClipboard::Mode p_mode);
 
@@ -95,9 +98,6 @@ private:
     // in the selection. Get the QImage.
     QImage tryGetSelectedImage();
 
-    // Return the header index in m_headers where current cursor locates.
-    int currentCursorHeader() const;
-
     QString getPlainTextWithoutPreviewImage() const;
 
     // Try to get all the regions of preview image within @p_block.
@@ -107,6 +107,9 @@ private:
 
     void finishOneAsyncJob(int p_idx);
 
+    // Index in m_headers of current header which contains the cursor.
+    int indexOfCurrentHeader() const;
+
     HGMarkdownHighlighter *m_mdHighlighter;
     VCodeBlockHighlightHelper *m_cbHighlighter;
     VImagePreviewer *m_imagePreviewer;
@@ -117,7 +120,8 @@ private:
     // Image links right at the beginning of the edit.
     QVector<ImageLink> m_initImages;
 
-    QVector<VHeader> m_headers;
+    // Mainly used for title jump.
+    QVector<VTableOfContentItem> m_headers;
 
     bool m_freshEdit;
 

src/vmdeditoperations.cpp

@@ -26,7 +26,7 @@
 
 extern VConfigManager *g_config;
 
-const QString VMdEditOperations::c_defaultImageTitle = "image";
+const QString VMdEditOperations::c_defaultImageTitle = "";
 
 VMdEditOperations::VMdEditOperations(VEdit *p_editor, VFile *p_file)
     : VEditOperations(p_editor, p_file), m_autoIndentPos(-1)
@@ -278,6 +278,28 @@ bool VMdEditOperations::handleKeyPressEvent(QKeyEvent *p_event)
         break;
     }
 
+    case Qt::Key_L:
+    {
+        if (modifiers == Qt::ControlModifier) {
+            m_editor->insertLink();
+            p_event->accept();
+            ret = true;
+        }
+
+        break;
+    }
+
+    case Qt::Key_M:
+    {
+        if (modifiers == Qt::ControlModifier) {
+            decorateCodeBlock();
+            p_event->accept();
+            ret = true;
+        }
+
+        break;
+    }
+
     case Qt::Key_O:
     {
         if (modifiers == Qt::ControlModifier) {
@@ -626,33 +648,25 @@ void VMdEditOperations::changeListBlockSeqNumber(QTextBlock &p_block, int p_seq)
 
 bool VMdEditOperations::insertTitle(int p_level)
 {
-    Q_ASSERT(p_level > 0 && p_level < 7);
     QTextDocument *doc = m_editor->document();
-    QString titleMark(p_level, '#');
     QTextCursor cursor = m_editor->textCursor();
+    int firstBlock = cursor.block().blockNumber();
+    int lastBlock = firstBlock;
+
     if (cursor.hasSelection()) {
-        // Insert title # in front of the selected lines.
+        // Insert title # in front of the selected blocks.
         int start = cursor.selectionStart();
         int end = cursor.selectionEnd();
-        int startBlock = doc->findBlock(start).blockNumber();
+        firstBlock = doc->findBlock(start).blockNumber();
-        int endBlock = doc->findBlock(end).blockNumber();
+        lastBlock = doc->findBlock(end).blockNumber();
-        cursor.beginEditBlock();
-        cursor.clearSelection();
-        for (int i = startBlock; i <= endBlock; ++i) {
-            QTextBlock block = doc->findBlockByNumber(i);
-            cursor.setPosition(block.position(), QTextCursor::MoveAnchor);
-            cursor.insertText(titleMark + " ");
     }
-        cursor.movePosition(QTextCursor::EndOfBlock);
+
-        cursor.endEditBlock();
-    } else {
-        // Insert title # in front of current block.
     cursor.beginEditBlock();
-        cursor.movePosition(QTextCursor::StartOfBlock);
+    for (int i = firstBlock; i <= lastBlock; ++i) {
-        cursor.insertText(titleMark + " ");
+        VEditUtils::insertTitleMark(cursor, doc->findBlockByNumber(i), p_level);
-        cursor.movePosition(QTextCursor::EndOfBlock);
-        cursor.endEditBlock();
     }
+
+    cursor.endEditBlock();
     m_editor->setTextCursor(cursor);
     return true;
 }
@@ -681,6 +695,10 @@ void VMdEditOperations::decorateText(TextDecoration p_decoration)
         decorateInlineCode();
         break;
 
+    case TextDecoration::CodeBlock:
+        decorateCodeBlock();
+        break;
+
     default:
         validDecoration = false;
         qDebug() << "decoration" << (int)p_decoration << "is not implemented yet";
@@ -804,6 +822,86 @@ void VMdEditOperations::decorateInlineCode()
     m_editor->setTextCursor(cursor);
 }
 
+void VMdEditOperations::decorateCodeBlock()
+{
+    const QString marker("```");
+
+    QTextCursor cursor = m_editor->textCursor();
+    cursor.beginEditBlock();
+    if (cursor.hasSelection()) {
+        // Insert ``` around the selected text.
+        int start = cursor.selectionStart();
+        int end = cursor.selectionEnd();
+
+        QString indentation = VEditUtils::fetchIndentSpaces(cursor.block());
+
+        // Insert the end marker first.
+        cursor.setPosition(end, QTextCursor::MoveAnchor);
+        VEditUtils::insertBlock(cursor, false);
+        VEditUtils::indentBlock(cursor, indentation);
+        cursor.insertText(marker);
+
+        // Insert the start marker.
+        cursor.setPosition(start, QTextCursor::MoveAnchor);
+        VEditUtils::insertBlock(cursor, true);
+        VEditUtils::indentBlock(cursor, indentation);
+        cursor.insertText(marker);
+    } else {
+        // Insert ``` ``` and place cursor after the first marker.
+        // Or if current block or next block is ```, we will skip it.
+        QTextBlock block = cursor.block();
+        int state = block.userState();
+        if (state == HighlightBlockState::CodeBlock
+            || state == HighlightBlockState::CodeBlockStart
+            || state == HighlightBlockState::CodeBlockEnd) {
+            // Find the block end.
+            while (block.isValid()) {
+                if (block.userState() == HighlightBlockState::CodeBlockEnd) {
+                    break;
+                }
+
+                block = block.next();
+            }
+
+            if (block.isValid()) {
+                // It is CodeBlockEnd.
+                cursor.setPosition(block.position());
+                if (block.next().isValid()) {
+                    cursor.movePosition(QTextCursor::NextBlock);
+                    cursor.movePosition(QTextCursor::StartOfBlock);
+                } else {
+                    cursor.movePosition(QTextCursor::EndOfBlock);
+                }
+            } else {
+                // Reach the end of the document.
+                cursor.movePosition(QTextCursor::End);
+            }
+        } else {
+            bool insertInline = false;
+            if (!cursor.atBlockEnd()) {
+                cursor.insertBlock();
+                cursor.movePosition(QTextCursor::PreviousBlock);
+            } else if (cursor.atBlockStart()) {
+                insertInline = true;
+            }
+
+            if (!insertInline) {
+                VEditUtils::insertBlock(cursor, false);
+                VEditUtils::indentBlockAsBlock(cursor, false);
+            }
+
+            cursor.insertText(marker);
+
+            VEditUtils::insertBlock(cursor, true);
+            VEditUtils::indentBlockAsBlock(cursor, true);
+            cursor.insertText(marker);
+        }
+    }
+
+    cursor.endEditBlock();
+    m_editor->setTextCursor(cursor);
+}
+
 void VMdEditOperations::decorateStrikethrough()
 {
     QTextCursor cursor = m_editor->textCursor();
@@ -840,3 +938,16 @@ void VMdEditOperations::decorateStrikethrough()
     cursor.endEditBlock();
     m_editor->setTextCursor(cursor);
 }
+
+bool VMdEditOperations::insertLink(const QString &p_linkText,
+                                   const QString &p_linkUrl)
+{
+    QString link = QString("[%1](%2)").arg(p_linkText).arg(p_linkUrl);
+    QTextCursor cursor = m_editor->textCursor();
+    cursor.insertText(link);
+    m_editor->setTextCursor(cursor);
+
+    setVimMode(VimMode::Insert);
+
+    return true;
+}

src/vmdeditoperations.h

@@ -16,11 +16,18 @@ class VMdEditOperations : public VEditOperations
     Q_OBJECT
 public:
     VMdEditOperations(VEdit *p_editor, VFile *p_file);
+
     bool insertImageFromMimeData(const QMimeData *source) Q_DECL_OVERRIDE;
+
     bool insertImage() Q_DECL_OVERRIDE;
+
     bool handleKeyPressEvent(QKeyEvent *p_event) Q_DECL_OVERRIDE;
+
     bool insertImageFromURL(const QUrl &p_imageUrl) Q_DECL_OVERRIDE;
 
+    bool insertLink(const QString &p_linkText,
+                    const QString &p_linkUrl);
+
     // Insert decoration markers or decorate selected text.
     // If it is Vim Normal mode, change to Insert mode first.
     void decorateText(TextDecoration p_decoration) Q_DECL_OVERRIDE;
@@ -47,6 +54,10 @@ private:
     bool handleKeyEsc(QKeyEvent *p_event);
     bool handleKeyReturn(QKeyEvent *p_event);
     bool handleKeyBracketLeft(QKeyEvent *p_event);
+
+    // Insert title of level @p_level.
+    // Will detect if current block already has some leading #s. If yes,
+    // will delete it and insert the correct #s.
     bool insertTitle(int p_level);
 
     // Change the sequence number of a list block.
@@ -61,6 +72,9 @@ private:
     // Insert inline-code marker or set selected text inline-coded.
     void decorateInlineCode();
 
+    // Insert inline-code marker or set selected text inline-coded.
+    void decorateCodeBlock();
+
     // Insert strikethrough marker or set selected text strikethrough.
     void decorateStrikethrough();
 

src/vmdtab.cpp

@@ -11,7 +11,7 @@
 #include "vconfigmanager.h"
 #include "vmarkdownconverter.h"
 #include "vnotebook.h"
-#include "vtoc.h"
+#include "vtableofcontent.h"
 #include "vmdedit.h"
 #include "dialog/vfindreplacedialog.h"
 #include "veditarea.h"
@@ -22,13 +22,25 @@ extern VConfigManager *g_config;
 
 VMdTab::VMdTab(VFile *p_file, VEditArea *p_editArea,
                OpenFileMode p_mode, QWidget *p_parent)
-    : VEditTab(p_file, p_editArea, p_parent), m_editor(NULL), m_webViewer(NULL),
+    : VEditTab(p_file, p_editArea, p_parent),
-      m_document(NULL), m_mdConType(g_config->getMdConverterType())
+      m_editor(NULL),
+      m_webViewer(NULL),
+      m_document(NULL),
+      m_mdConType(g_config->getMdConverterType()),
+      m_enableHeadingSequence(false)
 {
     V_ASSERT(m_file->getDocType() == DocType::Markdown);
 
     m_file->open();
 
+    HeadingSequenceType headingSequenceType = g_config->getHeadingSequenceType();
+    if (headingSequenceType == HeadingSequenceType::Enabled) {
+        m_enableHeadingSequence = true;
+    } else if (headingSequenceType == HeadingSequenceType::EnabledNoteOnly
+               && m_file->getType() == FileType::Note) {
+        m_enableHeadingSequence = true;
+    }
+
     setupUI();
 
     if (p_mode == OpenFileMode::Edit) {
@@ -50,54 +62,110 @@ void VMdTab::setupUI()
     setLayout(m_stacks);
 }
 
-void VMdTab::handleTextChanged()
-{
-    V_ASSERT(m_file->isModifiable());
-
-    if (m_modified) {
-        return;
-    }
-
-    updateStatus();
-}
-
 void VMdTab::showFileReadMode()
 {
     m_isEditMode = false;
 
-    int outlineIndex = m_curHeader.m_outlineIndex;
+    VHeaderPointer header(m_currentHeader);
 
     if (m_mdConType == MarkdownConverterType::Hoedown) {
         viewWebByConverter();
     } else {
         m_document->updateText();
-        updateTocFromHtml(m_document->getToc());
+        updateOutlineFromHtml(m_document->getToc());
     }
 
     m_stacks->setCurrentWidget(m_webViewer);
     clearSearchedWordHighlight();
 
-    scrollWebViewToHeader(outlineIndex);
+    scrollWebViewToHeader(header);
 
     updateStatus();
 }
 
-void VMdTab::scrollWebViewToHeader(int p_outlineIndex)
+bool VMdTab::scrollWebViewToHeader(const VHeaderPointer &p_header)
 {
-    QString anchor;
+    if (!m_outline.isMatched(p_header)
-
+        || m_outline.getType() != VTableOfContentType::Anchor) {
-    m_curHeader = VAnchor(m_file, anchor, -1, p_outlineIndex);
+        return false;
-
-    if (p_outlineIndex < m_toc.headers.size() && p_outlineIndex >= 0) {
-        QString tmp = m_toc.headers[p_outlineIndex].anchor;
-        V_ASSERT(!tmp.isEmpty());
-        m_curHeader.anchor = tmp;
-        anchor = tmp.mid(1);
     }
 
-    m_document->scrollToAnchor(anchor);
+    if (p_header.isValid()) {
+        const VTableOfContentItem *item = m_outline.getItem(p_header);
+        if (item) {
+            if (item->m_anchor.isEmpty()) {
+                return false;
+            }
 
-    emit curHeaderChanged(m_curHeader);
+            m_currentHeader = p_header;
+            m_document->scrollToAnchor(item->m_anchor);
+        } else {
+            return false;
+        }
+    } else {
+        if (m_outline.isEmpty()) {
+            // Let it be.
+            m_currentHeader = p_header;
+        } else {
+            // Scroll to top.
+            m_currentHeader = p_header;
+            m_document->scrollToAnchor("");
+        }
+    }
+
+    emit currentHeaderChanged(m_currentHeader);
+    return true;
+}
+
+bool VMdTab::scrollEditorToHeader(const VHeaderPointer &p_header)
+{
+    if (!m_outline.isMatched(p_header)
+        || m_outline.getType() != VTableOfContentType::BlockNumber) {
+        return false;
+    }
+
+    VMdEdit *mdEdit = dynamic_cast<VMdEdit *>(getEditor());
+
+    int blockNumber = -1;
+    if (p_header.isValid()) {
+        const VTableOfContentItem *item = m_outline.getItem(p_header);
+        if (item) {
+            blockNumber = item->m_blockNumber;
+            if (blockNumber == -1) {
+                // Empty item.
+                return false;
+            }
+        } else {
+            return false;
+        }
+    } else {
+        if (m_outline.isEmpty()) {
+            // No outline and scroll to -1 index.
+            // Just let it be.
+            m_currentHeader = p_header;
+            return true;
+        } else {
+            // Has outline and scroll to -1 index.
+            // Scroll to top.
+            blockNumber = 0;
+        }
+    }
+
+    if (mdEdit->scrollToHeader(blockNumber)) {
+        m_currentHeader = p_header;
+        return true;
+    } else {
+        return false;
+    }
+}
+
+bool VMdTab::scrollToHeaderInternal(const VHeaderPointer &p_header)
+{
+    if (m_isEditMode) {
+        return scrollEditorToHeader(p_header);
+    } else {
+        return scrollWebViewToHeader(p_header);
+    }
 }
 
 void VMdTab::viewWebByConverter()
@@ -108,7 +176,7 @@ void VMdTab::viewWebByConverter()
                                             g_config->getMarkdownExtensions(),
                                             toc);
     m_document->setHtml(html);
-    updateTocFromHtml(toc);
+    updateOutlineFromHtml(toc);
 }
 
 void VMdTab::showFileEditMode()
@@ -117,42 +185,28 @@ void VMdTab::showFileEditMode()
         return;
     }
 
+    VHeaderPointer header(m_currentHeader);
+
     m_isEditMode = true;
 
     VMdEdit *mdEdit = dynamic_cast<VMdEdit *>(getEditor());
     V_ASSERT(mdEdit);
 
-    // beginEdit() may change m_curHeader.
-    int outlineIndex = m_curHeader.m_outlineIndex;
-
     mdEdit->beginEdit();
     m_stacks->setCurrentWidget(mdEdit);
 
-    int lineNumber = -1;
-    const QVector<VHeader> &headers = mdEdit->getHeaders();
     // If editor is not init, we need to wait for it to init headers.
     // Generally, beginEdit() will generate the headers. Wait is needed when
     // highlight completion is going to re-generate the headers.
     int nrRetry = 5;
-    while (outlineIndex > -1 && headers.isEmpty() && nrRetry-- > 0) {
+    while (header.m_index > -1 && m_outline.isEmpty() && nrRetry-- > 0) {
         qDebug() << "wait another 100 ms for editor's headers ready";
         VUtils::sleepWait(100);
     }
 
-    if (outlineIndex < 0 || outlineIndex >= headers.size()) {
+    scrollEditorToHeader(header);
-        lineNumber = -1;
-        outlineIndex = -1;
-    } else {
-        lineNumber = headers[outlineIndex].lineNumber;
-    }
-
-    VAnchor anchor(m_file, "", lineNumber, outlineIndex);
-
-    mdEdit->scrollToHeader(anchor);
 
     mdEdit->setFocus();
-
-    updateStatus();
 }
 
 bool VMdTab::closeFile(bool p_forced)
@@ -232,7 +286,7 @@ bool VMdTab::saveFile()
         return true;
     }
 
-    bool ret;
+    bool ret = true;
     // Make sure the file already exists. Temporary deal with cases when user delete or move
     // a file.
     QString filePath = m_file->fetchPath();
@@ -242,9 +296,8 @@ bool VMdTab::saveFile()
                             tr("File <span style=\"%1\">%2</span> being written has been removed.")
                               .arg(g_config->c_dataTextStyle).arg(filePath),
                             QMessageBox::Ok, QMessageBox::Ok, this);
-        return false;
+        ret = false;
-    }
+    } else {
-
         m_editor->saveFile();
         ret = m_file->save();
         if (!ret) {
@@ -253,6 +306,7 @@ bool VMdTab::saveFile()
                                 QMessageBox::Ok, QMessageBox::Ok, this);
             m_editor->setModified(true);
         }
+    }
 
     updateStatus();
 
@@ -285,11 +339,13 @@ void VMdTab::setupMarkdownViewer()
     QWebChannel *channel = new QWebChannel(m_webViewer);
     channel->registerObject(QStringLiteral("content"), m_document);
     connect(m_document, &VDocument::tocChanged,
-            this, &VMdTab::updateTocFromHtml);
+            this, &VMdTab::updateOutlineFromHtml);
     connect(m_document, SIGNAL(headerChanged(const QString &)),
-            this, SLOT(updateCurHeader(const QString &)));
+            this, SLOT(updateCurrentHeader(const QString &)));
     connect(m_document, &VDocument::keyPressed,
             this, &VMdTab::handleWebKeyPressed);
+    connect(m_document, SIGNAL(logicsFinished(void)),
+            this, SLOT(restoreFromTabInfo(void)));
     page->setWebChannel(channel);
 
     m_webViewer->setHtml(VUtils::generateHtmlTemplate(m_mdConType, false),
@@ -302,15 +358,16 @@ void VMdTab::setupMarkdownEditor()
 {
     Q_ASSERT(m_file->isModifiable() && !m_editor);
     qDebug() << "create Markdown editor";
+
     m_editor = new VMdEdit(m_file, m_document, m_mdConType, this);
     connect(dynamic_cast<VMdEdit *>(m_editor), &VMdEdit::headersChanged,
-            this, &VMdTab::updateTocFromHeaders);
+            this, &VMdTab::updateOutlineFromHeaders);
+    connect(dynamic_cast<VMdEdit *>(m_editor), SIGNAL(currentHeaderChanged(int)),
+            this, SLOT(updateCurrentHeader(int)));
     connect(dynamic_cast<VMdEdit *>(m_editor), &VMdEdit::statusChanged,
             this, &VMdTab::updateStatus);
-    connect(m_editor, SIGNAL(curHeaderChanged(VAnchor)),
-            this, SLOT(updateCurHeader(VAnchor)));
     connect(m_editor, &VEdit::textChanged,
-            this, &VMdTab::handleTextChanged);
+            this, &VMdTab::updateStatus);
     connect(m_editor, &VEdit::cursorPositionChanged,
             this, &VMdTab::updateStatus);
     connect(m_editor, &VEdit::saveAndRead,
@@ -327,190 +384,79 @@ void VMdTab::setupMarkdownEditor()
             this, [this]() {
                 this->m_editArea->getFindReplaceDialog()->closeDialog();
             });
+    connect(m_editor, SIGNAL(ready(void)),
+            this, SLOT(restoreFromTabInfo(void)));
 
+    enableHeadingSequence(m_enableHeadingSequence);
     m_editor->reloadFile();
     m_stacks->addWidget(m_editor);
 }
 
-static void parseTocUl(QXmlStreamReader &p_xml, QVector<VHeader> &p_headers,
+void VMdTab::updateOutlineFromHtml(const QString &p_tocHtml)
-                       int p_level);
-
-static void parseTocLi(QXmlStreamReader &p_xml, QVector<VHeader> &p_headers, int p_level)
-{
-    Q_ASSERT(p_xml.isStartElement() && p_xml.name() == "li");
-
-    if (p_xml.readNextStartElement()) {
-        if (p_xml.name() == "a") {
-            QString anchor = p_xml.attributes().value("href").toString();
-            QString name;
-            if (p_xml.readNext()) {
-                if (p_xml.tokenString() == "Characters") {
-                    name = p_xml.text().toString();
-                } else if (!p_xml.isEndElement()) {
-                    qWarning() << "TOC HTML <a> should be ended by </a>" << p_xml.name();
-                    return;
-                }
-
-                VHeader header(p_level, name, anchor, -1, p_headers.size());
-                p_headers.append(header);
-            } else {
-                // Error
-                return;
-            }
-        } else if (p_xml.name() == "ul") {
-            // Such as header 3 under header 1 directly
-            VHeader header(p_level, c_emptyHeaderName, "#", -1, p_headers.size());
-            p_headers.append(header);
-            parseTocUl(p_xml, p_headers, p_level + 1);
-        } else {
-            qWarning() << "TOC HTML <li> should contain <a> or <ul>" << p_xml.name();
-            return;
-        }
-    }
-
-    while (p_xml.readNext()) {
-        if (p_xml.isEndElement()) {
-            if (p_xml.name() == "li") {
-                return;
-            }
-            continue;
-        }
-        if (p_xml.name() == "ul") {
-            // Nested unordered list
-            parseTocUl(p_xml, p_headers, p_level + 1);
-        } else {
-            return;
-        }
-    }
-}
-
-static void parseTocUl(QXmlStreamReader &p_xml, QVector<VHeader> &p_headers,
-                       int p_level)
-{
-    Q_ASSERT(p_xml.isStartElement() && p_xml.name() == "ul");
-
-    while (p_xml.readNextStartElement()) {
-        if (p_xml.name() == "li") {
-            parseTocLi(p_xml, p_headers, p_level);
-        } else {
-            qWarning() << "TOC HTML <ul> should contain <li>" << p_xml.name();
-            break;
-        }
-    }
-}
-
-static bool parseTocHtml(const QString &p_tocHtml,
-                         QVector<VHeader> &p_headers)
-{
-    if (!p_tocHtml.isEmpty()) {
-        QXmlStreamReader xml(p_tocHtml);
-        if (xml.readNextStartElement()) {
-            if (xml.name() == "ul") {
-                parseTocUl(xml, p_headers, 1);
-            } else {
-                qWarning() << "TOC HTML does not start with <ul>";
-            }
-        }
-
-        if (xml.hasError()) {
-            qWarning() << "fail to parse TOC in HTML";
-            return false;
-        }
-    }
-
-    return true;
-}
-
-void VMdTab::updateTocFromHtml(const QString &p_tocHtml)
 {
     if (m_isEditMode) {
         return;
     }
 
-    m_toc.type = VHeaderType::Anchor;
+    m_outline.clear();
-    m_toc.headers.clear();
 
-    if (!parseTocHtml(p_tocHtml, m_toc.headers)) {
+    if (m_outline.parseTableFromHtml(p_tocHtml)) {
-        return;
+        m_outline.setFile(m_file);
+        m_outline.setType(VTableOfContentType::Anchor);
     }
 
-    m_toc.m_file = m_file;
+    m_currentHeader.reset();
-    m_toc.valid = true;
 
-    emit outlineChanged(m_toc);
+    emit outlineChanged(m_outline);
 }
 
-void VMdTab::updateTocFromHeaders(const QVector<VHeader> &p_headers)
+void VMdTab::updateOutlineFromHeaders(const QVector<VTableOfContentItem> &p_headers)
 {
     if (!m_isEditMode) {
         return;
     }
 
-    m_toc.type = VHeaderType::LineNumber;
+    m_outline.update(m_file,
-    m_toc.headers = p_headers;
+                     p_headers,
-    m_toc.m_file = m_file;
+                     VTableOfContentType::BlockNumber);
-    m_toc.valid = true;
 
-    // Clear current header.
+    m_currentHeader.reset();
-    m_curHeader = VAnchor(m_file, "", -1, -1);
-    emit curHeaderChanged(m_curHeader);
 
-    emit outlineChanged(m_toc);
+    emit outlineChanged(m_outline);
 }
 
-void VMdTab::scrollToAnchor(const VAnchor &p_anchor)
+void VMdTab::scrollToHeader(const VHeaderPointer &p_header)
 {
-    if (p_anchor == m_curHeader) {
+    if (m_outline.isMatched(p_header)) {
-        return;
+        // Scroll only when @p_header is valid.
-    }
+        scrollToHeaderInternal(p_header);
-
-    m_curHeader = p_anchor;
-
-    if (m_isEditMode) {
-        dynamic_cast<VMdEdit *>(getEditor())->scrollToHeader(p_anchor);
-    } else {
-        if (!p_anchor.anchor.isEmpty()) {
-            m_document->scrollToAnchor(p_anchor.anchor.mid(1));
-        }
     }
 }
 
-void VMdTab::updateCurHeader(const QString &p_anchor)
+void VMdTab::updateCurrentHeader(const QString &p_anchor)
-{
-    if (m_isEditMode || m_curHeader.anchor.mid(1) == p_anchor) {
-        return;
-    }
-
-    m_curHeader = VAnchor(m_file, "#" + p_anchor, -1);
-    if (!p_anchor.isEmpty()) {
-        const QVector<VHeader> &headers = m_toc.headers;
-        for (int i = 0; i < headers.size(); ++i) {
-            if (headers[i].anchor == m_curHeader.anchor) {
-                V_ASSERT(headers[i].index == i);
-                m_curHeader.m_outlineIndex = headers[i].index;
-                break;
-            }
-        }
-    }
-
-    emit curHeaderChanged(m_curHeader);
-}
-
-void VMdTab::updateCurHeader(VAnchor p_anchor)
 {
     if (m_isEditMode) {
-        if (!p_anchor.anchor.isEmpty() || p_anchor.lineNumber == m_curHeader.lineNumber) {
         return;
     }
-    } else {
+
-        if (p_anchor.lineNumber != -1 || p_anchor.anchor == m_curHeader.anchor) {
+    // Find the index of the anchor in outline.
+    int idx = m_outline.indexOfItemByAnchor(p_anchor);
+    m_currentHeader.update(m_file, idx);
+
+    emit currentHeaderChanged(m_currentHeader);
+}
+
+void VMdTab::updateCurrentHeader(int p_blockNumber)
+{
+    if (!m_isEditMode) {
         return;
     }
-    }
 
-    m_curHeader = p_anchor;
+    // Find the index of the block number in outline.
+    int idx = m_outline.indexOfItemByBlockNumber(p_blockNumber);
+    m_currentHeader.update(m_file, idx);
 
-    emit curHeaderChanged(m_curHeader);
+    emit currentHeaderChanged(m_currentHeader);
 }
 
 void VMdTab::insertImage()
@@ -523,6 +469,16 @@ void VMdTab::insertImage()
     m_editor->insertImage();
 }
 
+void VMdTab::insertLink()
+{
+    if (!m_isEditMode) {
+        return;
+    }
+
+    Q_ASSERT(m_editor);
+    m_editor->insertLink();
+}
+
 void VMdTab::findText(const QString &p_text, uint p_options, bool p_peek,
                       bool p_forward)
 {
@@ -682,9 +638,9 @@ void VMdTab::requestUpdateVimStatus()
     }
 }
 
-VEditTabInfo VMdTab::createEditTabInfo()
+VEditTabInfo VMdTab::fetchTabInfo() const
 {
-    VEditTabInfo info = VEditTab::createEditTabInfo();
+    VEditTabInfo info = VEditTab::fetchTabInfo();
 
     if (m_editor) {
         QTextCursor cursor = m_editor->textCursor();
@@ -693,6 +649,8 @@ VEditTabInfo VMdTab::createEditTabInfo()
         info.m_blockCount = m_editor->document()->blockCount();
     }
 
+    info.m_headerIndex = m_currentHeader.m_index;
+
     return info;
 }
 
@@ -702,3 +660,45 @@ void VMdTab::decorateText(TextDecoration p_decoration)
         m_editor->decorateText(p_decoration);
     }
 }
+
+bool VMdTab::restoreFromTabInfo(const VEditTabInfo &p_info)
+{
+    if (p_info.m_editTab != this) {
+        return false;
+    }
+
+    // Restore header.
+    VHeaderPointer header(m_file, p_info.m_headerIndex);
+    bool ret = scrollToHeaderInternal(header);
+    return ret;
+}
+
+void VMdTab::restoreFromTabInfo()
+{
+    restoreFromTabInfo(m_infoToRestore);
+
+    // Clear it anyway.
+    m_infoToRestore.clear();
+}
+
+void VMdTab::enableHeadingSequence(bool p_enabled)
+{
+    m_enableHeadingSequence = p_enabled;
+
+    if (m_editor) {
+        VEditConfig &config = m_editor->getConfig();
+        config.m_enableHeadingSequence = m_enableHeadingSequence;
+    }
+}
+
+bool VMdTab::isHeadingSequenceEnabled() const
+{
+    return m_enableHeadingSequence;
+}
+
+void VMdTab::evaluateMagicWords()
+{
+    if (isEditMode() && m_file->isModifiable()) {
+        getEditor()->evaluateMagicWords();
+    }
+}

src/vmdtab.h

@@ -31,11 +31,13 @@ public:
     // Save file.
     bool saveFile() Q_DECL_OVERRIDE;
 
-    // Scroll to anchor @p_anchor.
+    // Scroll to @p_header.
-    void scrollToAnchor(const VAnchor& p_anchor) Q_DECL_OVERRIDE;
+    void scrollToHeader(const VHeaderPointer &p_header) Q_DECL_OVERRIDE;
 
     void insertImage() Q_DECL_OVERRIDE;
 
+    void insertLink() Q_DECL_OVERRIDE;
+
     // Search @p_text in current note.
     void findText(const QString &p_text, uint p_options, bool p_peek,
                   bool p_forward = true) Q_DECL_OVERRIDE;
@@ -62,25 +64,34 @@ public:
     // Insert decoration markers or decorate selected text.
     void decorateText(TextDecoration p_decoration) Q_DECL_OVERRIDE;
 
+    // Create a filled VEditTabInfo.
+    VEditTabInfo fetchTabInfo() const Q_DECL_OVERRIDE;
+
+    // Enable or disable heading sequence.
+    void enableHeadingSequence(bool p_enabled);
+
+    bool isHeadingSequenceEnabled() const;
+
+    // Evaluate magic words.
+    void evaluateMagicWords() Q_DECL_OVERRIDE;
+
 public slots:
     // Enter edit mode.
     void editFile() Q_DECL_OVERRIDE;
 
 private slots:
-    // Handle text changed in m_editor.
+    // Update m_outline according to @p_tocHtml for read mode.
-    void handleTextChanged();
+    void updateOutlineFromHtml(const QString &p_tocHtml);
 
-    // Update m_toc according to @p_tocHtml for read mode.
+    // Update m_outline accroding to @p_headers for edit mode.
-    void updateTocFromHtml(const QString &p_tocHtml);
+    void updateOutlineFromHeaders(const QVector<VTableOfContentItem> &p_headers);
-
-    // Update m_toc accroding to @p_headers for edit mode.
-    void updateTocFromHeaders(const QVector<VHeader> &p_headers);
 
     // Web viewer requests to update current header.
-    void updateCurHeader(const QString &p_anchor);
+    // @p_anchor is the anchor of the header, like "toc_1".
+    void updateCurrentHeader(const QString &p_anchor);
 
     // Editor requests to update current header.
-    void updateCurHeader(VAnchor p_anchor);
+    void updateCurrentHeader(int p_blockNumber);
 
     // Handle key press event in Web view.
     void handleWebKeyPressed(int p_key, bool p_ctrl, bool p_shift);
@@ -91,6 +102,9 @@ private slots:
     // m_editor requests to discard changes and enter read mode.
     void discardAndRead();
 
+    // Restore from m_infoToRestore.
+    void restoreFromTabInfo();
+
 private:
     // Setup UI.
     void setupUI();
@@ -111,8 +125,14 @@ private:
     void viewWebByConverter();
 
     // Scroll Web view to given header.
-    // @p_outlineIndex is the index in m_toc.headers.
+    // Return true if scroll was made.
-    void scrollWebViewToHeader(int p_outlineIndex);
+    bool scrollWebViewToHeader(const VHeaderPointer &p_header);
+
+    bool scrollEditorToHeader(const VHeaderPointer &p_header);
+
+    // Scroll web/editor to given header.
+    // Return true if scroll was made.
+    bool scrollToHeaderInternal(const VHeaderPointer &p_header);
 
     // Search text in Web view.
     void findTextInWebView(const QString &p_text, uint p_options, bool p_peek,
@@ -127,17 +147,21 @@ private:
     // Focus the proper child widget.
     void focusChild() Q_DECL_OVERRIDE;
 
-    // Create a filled VEditTabInfo.
-    VEditTabInfo createEditTabInfo() Q_DECL_OVERRIDE;
-
     // Get the markdown editor. If not init yet, init and return it.
     VEdit *getEditor();
 
+    // Restore from @p_fino.
+    // Return true if succeed.
+    bool restoreFromTabInfo(const VEditTabInfo &p_info) Q_DECL_OVERRIDE;
+
     VEdit *m_editor;
     VWebView *m_webViewer;
     VDocument *m_document;
     MarkdownConverterType m_mdConType;
 
+    // Whether heading sequence is enabled.
+    bool m_enableHeadingSequence;
+
     QStackedLayout *m_stacks;
 };
 

src/vnote.cpp

@@ -16,6 +16,10 @@
 
 extern VConfigManager *g_config;
 
+// Meta word manager.
+VMetaWordManager *g_mwMgr;
+
+
 QString VNote::s_markdownTemplate;
 QString VNote::s_markdownTemplatePDF;
 
@@ -53,10 +57,15 @@ const QString VNote::c_markdownGuideDocFile_en = ":/resources/docs/markdown_guid
 const QString VNote::c_markdownGuideDocFile_zh = ":/resources/docs/markdown_guide_zh.md";
 
 VNote::VNote(QObject *parent)
-    : QObject(parent), m_mainWindow(dynamic_cast<VMainWindow *>(parent))
+    : QObject(parent)
 {
     initTemplate();
+
     g_config->getNotebooks(m_notebooks, this);
+
+    m_metaWordMgr.init();
+
+    g_mwMgr = &m_metaWordMgr;
 }
 
 void VNote::initPalette(QPalette palette)
@@ -330,6 +339,16 @@ VNoteFile *VNote::getInternalFile(const QString &p_path)
     return file;
 }
 
+VFile *VNote::getFile(const QString &p_path)
+{
+    VFile *file = getInternalFile(p_path);
+    if (!file) {
+        file = getOrphanFile(p_path, true, false);
+    }
+
+    return file;
+}
+
 VDirectory *VNote::getInternalDirectory(const QString &p_path)
 {
     VDirectory *dir = NULL;

src/vnote.h

@@ -12,11 +12,12 @@
 #include <QPalette>
 #include "vnotebook.h"
 #include "vconstants.h"
+#include "utils/vmetawordmanager.h"
 
-class VMainWindow;
 class VOrphanFile;
 class VNoteFile;
 
+
 class VNote : public QObject
 {
     Q_OBJECT
@@ -74,10 +75,13 @@ public:
     const QVector<QPair<QString, QString> > &getPalette() const;
     void initPalette(QPalette palette);
     QString getColorFromPalette(const QString &p_name) const;
-    VMainWindow *getMainWindow() const;
 
     QString getNavigationLabelStyle(const QString &p_str) const;
 
+    // Given the path of a file, first try to open it as note file,
+    // then try to open it as orphan file.
+    VFile *getFile(const QString &p_path);
+
     // Given the path of an external file, create a VOrphanFile struct.
     VOrphanFile *getOrphanFile(const QString &p_path,
                                bool p_modifiable,
@@ -102,7 +106,8 @@ private:
     // Maintain all the notebooks. Other holder should use QPointer.
     QVector<VNotebook *> m_notebooks;
     QVector<QPair<QString, QString> > m_palette;
-    VMainWindow *m_mainWindow;
+
+    VMetaWordManager m_metaWordMgr;
 
     // Hold all external file: Orphan File.
     // Need to clean up periodly.
@@ -114,9 +119,4 @@ inline const QVector<QPair<QString, QString> >& VNote::getPalette() const
     return m_palette;
 }
 
-inline VMainWindow *VNote::getMainWindow() const
-{
-    return m_mainWindow;
-}
-
 #endif // VNOTE_H

src/vnote.qrc

@@ -130,5 +130,9 @@
         <file>resources/icons/delete_attachment.svg</file>
         <file>resources/icons/sort.svg</file>
         <file>resources/icons/create_subdir.svg</file>
+        <file>resources/icons/compact_mode.svg</file>
+        <file>resources/icons/heading_sequence.svg</file>
+        <file>resources/icons/link.svg</file>
+        <file>resources/icons/code_block.svg</file>
     </qresource>
 </RCC>

src/vnotebook.cpp

@@ -9,7 +9,7 @@
 extern VConfigManager *g_config;
 
 VNotebook::VNotebook(const QString &name, const QString &path, QObject *parent)
-    : QObject(parent), m_name(name)
+    : QObject(parent), m_name(name), m_valid(false)
 {
     m_path = QDir::cleanPath(path);
     m_recycleBinFolder = g_config->getRecycleBinFolder();
@@ -29,6 +29,7 @@ bool VNotebook::readConfigNotebook()
     QJsonObject configJson = VConfigManager::readDirectoryConfig(m_path);
     if (configJson.isEmpty()) {
         qWarning() << "fail to read notebook configuration" << m_path;
+        m_valid = false;
         return false;
     }
 
@@ -58,6 +59,7 @@ bool VNotebook::readConfigNotebook()
         writeConfigNotebook();
     }
 
+    m_valid = true;
     return true;
 }
 

src/vnotebook.h

@@ -93,6 +93,8 @@ public:
     // Need to check if this notebook has been opened.
     QDateTime getCreatedTimeUtc();
 
+    bool isValid() const;
+
 private:
     // Serialize current instance to json.
     QJsonObject toConfigJson() const;
@@ -118,6 +120,10 @@ private:
 
     // Parent is NULL for root directory
     VDirectory *m_rootDir;
+
+    // Whether this notebook is valid.
+    // Will set to true after readConfigNotebook().
+    bool m_valid;
 };
 
 inline VDirectory *VNotebook::getRootDir() const
@@ -130,4 +136,9 @@ inline const QString &VNotebook::getRecycleBinFolder() const
     return m_recycleBinFolder;
 }
 
+inline bool VNotebook::isValid() const
+{
+    return m_valid;
+}
+
 #endif // VNOTEBOOK_H

src/vnotebookselector.cpp

@@ -20,22 +20,27 @@
 #include "vnote.h"
 #include "veditarea.h"
 #include "vnofocusitemdelegate.h"
+#include "vmainwindow.h"
 
 extern VConfigManager *g_config;
+
 extern VNote *g_vnote;
 
-const int VNotebookSelector::c_notebookStartIdx = 1;
+extern VMainWindow *g_mainWin;
 
-VNotebookSelector::VNotebookSelector(VNote *vnote, QWidget *p_parent)
+VNotebookSelector::VNotebookSelector(QWidget *p_parent)
-    : QComboBox(p_parent), VNavigationMode(),
+    : QComboBox(p_parent),
-      m_vnote(vnote), m_notebooks(m_vnote->getNotebooks()),
+      VNavigationMode(),
-      m_editArea(NULL), m_lastValidIndex(-1), m_naviLabel(NULL)
+      m_notebooks(g_vnote->getNotebooks()),
+      m_lastValidIndex(-1),
+      m_muted(false),
+      m_naviLabel(NULL)
 {
     m_listWidget = new QListWidget(this);
     m_listWidget->setItemDelegate(new VNoFocusItemDelegate(this));
     m_listWidget->setContextMenuPolicy(Qt::CustomContextMenu);
     connect(m_listWidget, &QListWidget::customContextMenuRequested,
-            this, &VNotebookSelector::requestPopupListContextMenu);
+            this, &VNotebookSelector::popupListContextMenuRequested);
 
     setModel(m_listWidget->model());
     setView(m_listWidget);
@@ -47,8 +52,6 @@ VNotebookSelector::VNotebookSelector(VNote *vnote, QWidget *p_parent)
 
     connect(this, SIGNAL(currentIndexChanged(int)),
             this, SLOT(handleCurIndexChanged(int)));
-    connect(this, SIGNAL(activated(int)),
-            this, SLOT(handleItemActivated(int)));
 }
 
 void VNotebookSelector::initActions()
@@ -75,9 +78,7 @@ void VNotebookSelector::initActions()
                 }
 
                 Q_ASSERT(items.size() == 1);
-                QListWidgetItem *item = items[0];
+                VNotebook *notebook = getNotebook(items[0]);
-                int index = this->indexOfListItem(item);
-                VNotebook *notebook = this->getNotebookFromComboIndex(index);
                 QUrl url = QUrl::fromLocalFile(notebook->getPath());
                 QDesktopServices::openUrl(url);
             });
@@ -93,9 +94,7 @@ void VNotebookSelector::initActions()
                 }
 
                 Q_ASSERT(items.size() == 1);
-                QListWidgetItem *item = items[0];
+                VNotebook *notebook = getNotebook(items[0]);
-                int index = this->indexOfListItem(item);
-                VNotebook *notebook = this->getNotebookFromComboIndex(index);
                 QUrl url = QUrl::fromLocalFile(notebook->getRecycleBinFolderPath());
                 QDesktopServices::openUrl(url);
             });
@@ -111,9 +110,7 @@ void VNotebookSelector::initActions()
                 }
 
                 Q_ASSERT(items.size() == 1);
-                QListWidgetItem *item = items[0];
+                VNotebook *notebook = getNotebook(items[0]);
-                int index = this->indexOfListItem(item);
-                VNotebook *notebook = this->getNotebookFromComboIndex(index);
                 QString binPath = notebook->getRecycleBinFolderPath();
 
                 int ret = VUtils::showMessage(QMessageBox::Warning, tr("Warning"),
@@ -129,7 +126,9 @@ void VNotebookSelector::initActions()
                                                 .arg(g_config->c_dataTextStyle)
                                                 .arg(binPath),
                                               QMessageBox::Ok | QMessageBox::Cancel,
-                                              QMessageBox::Ok, this, MessageBoxType::Danger);
+                                              QMessageBox::Ok,
+                                              this,
+                                              MessageBoxType::Danger);
                 if (ret == QMessageBox::Ok) {
                     QString info;
                     if (VUtils::emptyDirectory(notebook, binPath, true)) {
@@ -157,37 +156,60 @@ void VNotebookSelector::initActions()
 
 void VNotebookSelector::updateComboBox()
 {
+    m_muted = true;
+
     int index = g_config->getCurNotebookIndex();
 
-    disconnect(this, SIGNAL(currentIndexChanged(int)),
-               this, SLOT(handleCurIndexChanged(int)));
     clear();
+
     m_listWidget->clear();
 
     insertAddNotebookItem();
 
     for (int i = 0; i < m_notebooks.size(); ++i) {
-        addNotebookItem(m_notebooks[i]->getName());
+        addNotebookItem(m_notebooks[i]);
     }
+
     setCurrentIndex(-1);
-    connect(this, SIGNAL(currentIndexChanged(int)),
+
-            this, SLOT(handleCurIndexChanged(int)));
+    m_muted = false;
 
     if (m_notebooks.isEmpty()) {
         g_config->setCurNotebookIndex(-1);
         setCurrentIndex(0);
     } else {
-        setCurrentIndexNotebook(index);
+        const VNotebook *nb = NULL;
+        if (index >= 0 && index < m_notebooks.size()) {
+            nb = m_notebooks[index];
         }
+
+        setCurrentItemToNotebook(nb);
+    }
+
     qDebug() << "notebooks" << m_notebooks.size() << "current index" << index;
 }
 
-void VNotebookSelector::setCurrentIndexNotebook(int p_index)
+void VNotebookSelector::setCurrentItemToNotebook(const VNotebook *p_notebook)
 {
-    if (p_index > -1) {
+    setCurrentIndex(itemIndexOfNotebook(p_notebook));
-        p_index += c_notebookStartIdx;
 }
-    setCurrentIndex(p_index);
+
+int VNotebookSelector::itemIndexOfNotebook(const VNotebook *p_notebook) const
+{
+    if (!p_notebook) {
+        return -1;
+    }
+
+    qulonglong ptr = (qulonglong)p_notebook;
+    int cnt = m_listWidget->count();
+    for (int i = 0; i < cnt; ++i) {
+        QListWidgetItem *item = m_listWidget->item(i);
+        if (item->data(Qt::UserRole).toULongLong() == ptr) {
+            return i;
+        }
+    }
+
+    return -1;
 }
 
 void VNotebookSelector::insertAddNotebookItem()
@@ -199,49 +221,51 @@ void VNotebookSelector::insertAddNotebookItem()
     font.setItalic(true);
     item->setData(Qt::FontRole, font);
     item->setToolTip(tr("Create or import a notebook"));
+
     m_listWidget->insertItem(0, item);
 }
 
 void VNotebookSelector::handleCurIndexChanged(int p_index)
 {
-    qDebug() << "current index changed" << p_index << "startIdx" << c_notebookStartIdx;
+    if (m_muted) {
-    VNotebook *nb = NULL;
-    if (p_index > -1) {
-        if (p_index < c_notebookStartIdx) {
-            // Click a special action item.
-            if (m_listWidget->count() == c_notebookStartIdx) {
-                // There is no regular notebook item. Just let it be selected.
-                p_index = -1;
-            } else {
-                // handleItemActivated() will handle the logics.
         return;
     }
-        } else {
-            int nbIdx = p_index - c_notebookStartIdx;
-            Q_ASSERT(nbIdx >= 0);
-            nb = m_notebooks[nbIdx];
-        }
-    }
-    m_lastValidIndex = p_index;
-    QString tooltip;
-    if (p_index > -1) {
-        p_index -= c_notebookStartIdx;
-        tooltip = nb->getName();
-    }
-    setToolTip(tooltip);
-    g_config->setCurNotebookIndex(p_index);
-    emit curNotebookChanged(nb);
-}
 
-void VNotebookSelector::handleItemActivated(int p_index)
+    QString tooltip = tr("View and edit notebooks");
-{
+    VNotebook *nb = NULL;
-    if (p_index > -1 && p_index < c_notebookStartIdx) {
+    if (p_index > -1) {
-        // Click a special action item
+        nb = getNotebook(p_index);
-        if (m_lastValidIndex > -1) {
+        if (!nb) {
+            // Add notebook.
+            setToolTip(tooltip);
+
+            if (m_lastValidIndex != p_index && m_lastValidIndex > -1) {
                 setCurrentIndex(m_lastValidIndex);
             }
+
+            if (!m_notebooks.isEmpty()) {
                 newNotebook();
             }
+
+            return;
+        }
+    }
+
+    m_lastValidIndex = p_index;
+
+    int nbIdx = -1;
+    if (nb) {
+        tooltip = nb->getName();
+
+        nbIdx = m_notebooks.indexOf(nb);
+        Q_ASSERT(nbIdx > -1);
+    }
+
+    g_config->setCurNotebookIndex(nbIdx);
+
+    setToolTip(tooltip);
+
+    emit curNotebookChanged(nb);
 }
 
 void VNotebookSelector::update()
@@ -260,13 +284,14 @@ bool VNotebookSelector::newNotebook()
     info += tr("* A previously created notebook could be imported into VNote "
                "by choosing its root folder.");
 
-    QString defaultName;
-    QString defaultPath;
-
     // Use empty default name and path to let the dialog to auto generate a name
     // under the default VNote notebook folder.
-    VNewNotebookDialog dialog(tr("Add Notebook"), info, defaultName,
+    VNewNotebookDialog dialog(tr("Add Notebook"),
-                              defaultPath, m_notebooks, this);
+                              info,
+                              "",
+                              "",
+                              m_notebooks,
+                              this);
     if (dialog.exec() == QDialog::Accepted) {
         createNotebook(dialog.getNameInput(),
                        dialog.getPathInput(),
@@ -289,7 +314,7 @@ void VNotebookSelector::createNotebook(const QString &p_name,
 {
     VNotebook *nb = VNotebook::createNotebook(p_name, p_path, p_import,
                                               p_imageFolder, p_attachmentFolder,
-                                              m_vnote);
+                                              g_vnote);
     if (!nb) {
         VUtils::showMessage(QMessageBox::Warning, tr("Warning"),
                             tr("Fail to create notebook "
@@ -302,8 +327,8 @@ void VNotebookSelector::createNotebook(const QString &p_name,
     m_notebooks.append(nb);
     g_config->setNotebooks(m_notebooks);
 
-    addNotebookItem(nb->getName());
+    addNotebookItem(nb);
-    setCurrentIndexNotebook(m_notebooks.size() - 1);
+    setCurrentItemToNotebook(nb);
 }
 
 void VNotebookSelector::deleteNotebook()
@@ -312,62 +337,60 @@ void VNotebookSelector::deleteNotebook()
     if (items.isEmpty()) {
         return;
     }
-    Q_ASSERT(items.size() == 1);
-    QListWidgetItem *item = items[0];
-    int index = indexOfListItem(item);
 
-    VNotebook *notebook = getNotebookFromComboIndex(index);
+    Q_ASSERT(items.size() == 1);
+
+    VNotebook *notebook = getNotebook(items[0]);
     Q_ASSERT(notebook);
 
     VDeleteNotebookDialog dialog(tr("Delete Notebook"), notebook, this);
     if (dialog.exec() == QDialog::Accepted) {
         bool deleteFiles = dialog.getDeleteFiles();
-        m_editArea->closeFile(notebook, true);
+        g_mainWin->getEditArea()->closeFile(notebook, true);
         deleteNotebook(notebook, deleteFiles);
     }
 }
 
 void VNotebookSelector::deleteNotebook(VNotebook *p_notebook, bool p_deleteFiles)
 {
-    V_ASSERT(p_notebook);
+    Q_ASSERT(p_notebook);
 
-    int idx = indexOfNotebook(p_notebook);
+    m_notebooks.removeOne(p_notebook);
-
-    m_notebooks.remove(idx);
     g_config->setNotebooks(m_notebooks);
 
-    removeNotebookItem(idx);
+    int idx = itemIndexOfNotebook(p_notebook);
+    QListWidgetItem *item = m_listWidget->takeItem(idx);
+    Q_ASSERT(item);
+    delete item;
 
     QString name(p_notebook->getName());
     QString path(p_notebook->getPath());
     bool ret = VNotebook::deleteNotebook(p_notebook, p_deleteFiles);
     if (!ret) {
         // Notebook could not be deleted completely.
-        int cho = VUtils::showMessage(QMessageBox::Information, tr("Delete Notebook Folder From Disk"),
+        int cho = VUtils::showMessage(QMessageBox::Information,
+                                      tr("Delete Notebook Folder From Disk"),
                                       tr("Fail to delete the root folder of notebook "
                                          "<span style=\"%1\">%2</span> from disk. You may open "
                                          "the folder and check it manually.")
-                                        .arg(g_config->c_dataTextStyle).arg(name), "",
+                                        .arg(g_config->c_dataTextStyle).arg(name),
+                                      "",
                                       QMessageBox::Open | QMessageBox::Ok,
-                                      QMessageBox::Ok, this);
+                                      QMessageBox::Ok,
+                                      this);
         if (cho == QMessageBox::Open) {
             // Open the notebook location.
             QUrl url = QUrl::fromLocalFile(path);
             QDesktopServices::openUrl(url);
         }
     }
-}
 
-int VNotebookSelector::indexOfNotebook(const VNotebook *p_notebook)
+    if (m_notebooks.isEmpty()) {
-{
+        m_muted = true;
-    for (int i = 0; i < m_notebooks.size(); ++i) {
+        setCurrentIndex(0);
-        if (m_notebooks[i] == p_notebook) {
+        m_muted = false;
-            return i;
     }
 }
-    return -1;
-}
-
 
 void VNotebookSelector::editNotebookInfo()
 {
@@ -375,23 +398,22 @@ void VNotebookSelector::editNotebookInfo()
     if (items.isEmpty()) {
         return;
     }
+
     Q_ASSERT(items.size() == 1);
-    QListWidgetItem *item = items[0];
-    int index = indexOfListItem(item);
 
-    VNotebook *notebook = getNotebookFromComboIndex(index);
+    VNotebook *notebook = getNotebook(items[0]);
-    QString curName = notebook->getName();
+    VNotebookInfoDialog dialog(tr("Notebook Information"),
-
+                               "",
-    VNotebookInfoDialog dialog(tr("Notebook Information"), "", notebook,
+                               notebook,
-                               m_notebooks, this);
+                               m_notebooks,
+                               this);
     if (dialog.exec() == QDialog::Accepted) {
         bool updated = false;
         bool configUpdated = false;
         QString name = dialog.getName();
-        if (name != curName) {
+        if (name != notebook->getName()) {
             updated = true;
             notebook->rename(name);
-            updateComboBoxItem(index, name);
             g_config->setNotebooks(m_notebooks);
         }
 
@@ -407,54 +429,58 @@ void VNotebookSelector::editNotebookInfo()
         }
 
         if (updated) {
+            fillItem(items[0], notebook);
             emit notebookUpdated(notebook);
         }
     }
 }
 
-void VNotebookSelector::addNotebookItem(const QString &p_name)
+void VNotebookSelector::addNotebookItem(const VNotebook *p_notebook)
 {
     QListWidgetItem *item = new QListWidgetItem(m_listWidget);
-    item->setText(p_name);
+    fillItem(item, p_notebook);
-    item->setToolTip(p_name);
-    item->setIcon(QIcon(":/resources/icons/notebook_item.svg"));
 }
 
-void VNotebookSelector::removeNotebookItem(int p_index)
+void VNotebookSelector::fillItem(QListWidgetItem *p_item,
+                                 const VNotebook *p_notebook) const
 {
-    QListWidgetItem *item = m_listWidget->item(p_index + c_notebookStartIdx);
+    p_item->setText(p_notebook->getName());
-    m_listWidget->removeItemWidget(item);
+    p_item->setToolTip(p_notebook->getName());
-    delete item;
+    p_item->setIcon(QIcon(":/resources/icons/notebook_item.svg"));
+    p_item->setData(Qt::UserRole, (qulonglong)p_notebook);
 }
 
-void VNotebookSelector::updateComboBoxItem(int p_index, const QString &p_name)
-{
-    QListWidgetItem *item = m_listWidget->item(p_index);
-    item->setText(p_name);
-    item->setToolTip(p_name);
-}
 
-void VNotebookSelector::requestPopupListContextMenu(QPoint p_pos)
+void VNotebookSelector::popupListContextMenuRequested(QPoint p_pos)
 {
-    QModelIndex index = m_listWidget->indexAt(p_pos);
+    QListWidgetItem *item = m_listWidget->itemAt(p_pos);
-    if (!index.isValid() || index.row() < c_notebookStartIdx) {
+    if (!item) {
+        return;
+    }
+
+    const VNotebook *nb = getNotebook(item);
+    if (!nb) {
         return;
     }
 
-    QListWidgetItem *item = m_listWidget->itemAt(p_pos);
-    Q_ASSERT(item);
     m_listWidget->clearSelection();
     item->setSelected(true);
 
     QMenu menu(this);
     menu.setToolTipsVisible(true);
     menu.addAction(m_deleteNotebookAct);
+    if (nb->isValid()) {
         menu.addSeparator();
         menu.addAction(m_recycleBinAct);
         menu.addAction(m_emptyRecycleBinAct);
+    }
+
     menu.addSeparator();
     menu.addAction(m_openLocationAct);
+
+    if (nb->isValid()) {
         menu.addAction(m_notebookInfoAct);
+    }
 
     menu.exec(m_listWidget->mapToGlobal(p_pos));
 }
@@ -471,40 +497,30 @@ bool VNotebookSelector::eventFilter(QObject *watched, QEvent *event)
             return true;
         }
     }
-    return QComboBox::eventFilter(watched, event);
-}
 
-int VNotebookSelector::indexOfListItem(const QListWidgetItem *p_item)
+    return QComboBox::eventFilter(watched, event);
-{
-    int nrItems = m_listWidget->count();
-    for (int i = 0; i < nrItems; ++i) {
-        if (m_listWidget->item(i) == p_item) {
-            return i;
-        }
-    }
-    return -1;
 }
 
 bool VNotebookSelector::locateNotebook(const VNotebook *p_notebook)
 {
-    if (p_notebook) {
+    bool ret = false;
-        for (int i = 0; i < m_notebooks.size(); ++i) {
+    int index = itemIndexOfNotebook(p_notebook);
-            if (m_notebooks[i] == p_notebook) {
+    if (index > -1) {
-                setCurrentIndexNotebook(i);
+        setCurrentIndex(index);
-                return true;
+        ret = true;
     }
-        }
+
-    }
+    return ret;
-    return false;
 }
 
 void VNotebookSelector::showPopup()
 {
-    if (count() <= c_notebookStartIdx) {
+    if (m_notebooks.isEmpty()) {
         // No normal notebook items. Just add notebook.
         newNotebook();
         return;
     }
+
     resizeListWidgetToContent();
     QComboBox::showPopup();
 }
@@ -526,6 +542,7 @@ void VNotebookSelector::resizeListWidgetToContent()
         minHeight = m_listWidget->sizeHintForRow(0) * m_listWidget->count() + 10;
         minHeight = qMin(minHeight, maxMinHeight);
     }
+
     m_listWidget->setMinimumSize(minWidth, minHeight);
 }
 
@@ -616,3 +633,23 @@ bool VNotebookSelector::handlePopupKeyPress(QKeyEvent *p_event)
 
     return false;
 }
+
+VNotebook *VNotebookSelector::getNotebook(int p_itemIdx) const
+{
+    VNotebook *nb = NULL;
+    QListWidgetItem *item = m_listWidget->item(p_itemIdx);
+    if (item) {
+        nb = (VNotebook *)item->data(Qt::UserRole).toULongLong();
+    }
+
+    return nb;
+}
+
+VNotebook *VNotebookSelector::getNotebook(const QListWidgetItem *p_item) const
+{
+    if (p_item) {
+        return (VNotebook *)p_item->data(Qt::UserRole).toULongLong();
+    }
+
+    return NULL;
+}

src/vnotebookselector.h

@@ -7,8 +7,6 @@
 #include "vnavigationmode.h"
 
 class VNotebook;
-class VNote;
-class VEditArea;
 class QListWidget;
 class QAction;
 class QListWidgetItem;
@@ -18,11 +16,15 @@ class VNotebookSelector : public QComboBox, public VNavigationMode
 {
     Q_OBJECT
 public:
-    explicit VNotebookSelector(VNote *vnote, QWidget *p_parent = 0);
+    explicit VNotebookSelector(QWidget *p_parent = 0);
+
+    // Update Combox from m_notebooks.
     void update();
-    inline void setEditArea(VEditArea *p_editArea);
+
     // Select notebook @p_notebook.
     bool locateNotebook(const VNotebook *p_notebook);
+
+    // Add notebook on popup if no notebooks currently.
     void showPopup() Q_DECL_OVERRIDE;
 
     // Implementations for VNavigationMode.
@@ -41,24 +43,32 @@ signals:
     void notebookCreated(const QString &p_name, bool p_import);
 
 public slots:
+    // Popup a dialog to prompt user to create a notebook.
     bool newNotebook();
 
 protected:
     bool eventFilter(QObject *watched, QEvent *event) Q_DECL_OVERRIDE;
 
 private slots:
+    // Act to currentIndexChanged() signal if m_muted is false.
     void handleCurIndexChanged(int p_index);
-    void handleItemActivated(int p_index);
+
-    void requestPopupListContextMenu(QPoint p_pos);
+    void popupListContextMenuRequested(QPoint p_pos);
+
+    // Delete currently selected notebook.
     void deleteNotebook();
+
+    // View and edit notebook information of selected notebook.
     void editNotebookInfo();
 
 private:
     void initActions();
+
+    // Update Combox from m_notebooks.
     void updateComboBox();
 
-    // Return the index of @p_notebook in m_noteboks.
+    // Return the item index of @p_notebook.
-    int indexOfNotebook(const VNotebook *p_notebook);
+    int itemIndexOfNotebook(const VNotebook *p_notebook) const;
 
     // If @p_import is true, we will use the existing config file.
     // If @p_imageFolder is empty, we will use the global one.
@@ -68,26 +78,37 @@ private:
                         const QString &p_attachmentFolder);
 
     void deleteNotebook(VNotebook *p_notebook, bool p_deleteFiles);
-    void addNotebookItem(const QString &p_name);
+
-    // @p_index is the index of m_notebooks, NOT of QComboBox.
+    // Add an item corresponding to @p_notebook to combo box.
-    void removeNotebookItem(int p_index);
+    void addNotebookItem(const VNotebook *p_notebook);
-    // @p_index is the index of QComboBox.
+
-    void updateComboBoxItem(int p_index, const QString &p_name);
+    void fillItem(QListWidgetItem *p_item, const VNotebook *p_notebook) const;
+
+    // Insert "Add Notebook" item to combo box.
     void insertAddNotebookItem();
-    // @p_index is the index of m_notebooks.
+
-    void setCurrentIndexNotebook(int p_index);
+    // Set current item corresponding to @p_notebook.
-    int indexOfListItem(const QListWidgetItem *p_item);
+    void setCurrentItemToNotebook(const VNotebook *p_notebook);
-    // @p_index is the idnex of QComboBox.
+
-    inline VNotebook *getNotebookFromComboIndex(int p_index);
+    // Get VNotebook from @p_itemIdx, the index of m_listWidget.
+    VNotebook *getNotebook(int p_itemIdx) const;
+
+    VNotebook *getNotebook(const QListWidgetItem *p_item) const;
+
     void resizeListWidgetToContent();
+
     bool handlePopupKeyPress(QKeyEvent *p_event);
 
-    VNote *m_vnote;
     QVector<VNotebook *> &m_notebooks;
-    VEditArea *m_editArea;
+
     QListWidget *m_listWidget;
+
+    // Used to restore after clicking Add Notebook item.
     int m_lastValidIndex;
 
+    // Whether it is muted from currentIndexChanged().
+    bool m_muted;
+
     // Actions
     QAction *m_deleteNotebookAct;
     QAction *m_notebookInfoAct;
@@ -95,28 +116,7 @@ private:
     QAction *m_recycleBinAct;
     QAction *m_emptyRecycleBinAct;
 
-    // We will add several special action item in the combobox. This is the start index
-    // of the real notebook items related to m_notebooks.
-    static const int c_notebookStartIdx;
-
     QLabel *m_naviLabel;
 };
 
-inline void VNotebookSelector::setEditArea(VEditArea *p_editArea)
-{
-    m_editArea = p_editArea;
-}
-
-inline VNotebook *VNotebookSelector::getNotebookFromComboIndex(int p_index)
-{
-    if (p_index < c_notebookStartIdx) {
-        return NULL;
-    }
-    int nbIdx = p_index - c_notebookStartIdx;
-    if (nbIdx >= m_notebooks.size()) {
-        return NULL;
-    }
-    return m_notebooks[nbIdx];
-}
-
 #endif // VNOTEBOOKSELECTOR_H

src/vnotefile.cpp

@@ -233,7 +233,9 @@ bool VNoteFile::addAttachment(const QString &p_file)
     QString folderPath = fetchAttachmentFolderPath();
     QString name = VUtils::fileNameFromPath(p_file);
     Q_ASSERT(!name.isEmpty());
-    name = VUtils::getFileNameWithSequence(folderPath, name);
+    // For attachments, we do not use complete base name.
+    // abc.tar.gz should be abc_001.tar.gz instead of abc.tar_001.gz.
+    name = VUtils::getFileNameWithSequence(folderPath, name, false);
     QString destPath = QDir(folderPath).filePath(name);
     if (!VUtils::copyFile(p_file, destPath, false)) {
         return false;
@@ -543,7 +545,7 @@ bool VNoteFile::copyFile(VDirectory *p_destDir,
     if (!attaFolderPath.isEmpty()) {
         QDir dir(destFile->fetchBasePath());
         QString folderPath = dir.filePath(destFile->getNotebook()->getAttachmentFolder());
-        attaFolder = VUtils::getFileNameWithSequence(folderPath, attaFolder);
+        attaFolder = VUtils::getDirNameWithSequence(folderPath, attaFolder);
         folderPath = QDir(folderPath).filePath(attaFolder);
 
         // Copy attaFolderPath to folderPath.

src/voutline.cpp

@@ -1,44 +1,39 @@
-#include <QDebug>
 #include <QVector>
 #include <QString>
 #include <QKeyEvent>
 #include <QLabel>
 #include <QCoreApplication>
 #include "voutline.h"
-#include "vtoc.h"
 #include "utils/vutils.h"
 #include "vnote.h"
+#include "vfile.h"
 
 extern VNote *g_vnote;
 
 VOutline::VOutline(QWidget *parent)
-    : QTreeWidget(parent), VNavigationMode()
+    : QTreeWidget(parent),
+      VNavigationMode(),
+      m_muted(false)
 {
     setColumnCount(1);
     setHeaderHidden(true);
     setSelectionMode(QAbstractItemView::SingleSelection);
 
+    // TODO: jump to the header when user click the same item twice.
     connect(this, &VOutline::currentItemChanged,
-            this, &VOutline::handleCurItemChanged);
+            this, &VOutline::handleCurrentItemChanged);
 }
 
-void VOutline::checkOutline(const VToc &p_toc) const
+void VOutline::updateOutline(const VTableOfContent &p_outline)
 {
-    const QVector<VHeader> &headers = p_toc.headers;
+    if (p_outline == m_outline) {
-
+        return;
-    for (int i = 0; i < headers.size(); ++i) {
-        V_ASSERT(headers[i].index == i);
-    }
     }
 
-void VOutline::updateOutline(const VToc &toc)
-{
     // Clear current header
-    curHeader = VAnchor();
+    m_currentHeader.clear();
 
-    checkOutline(toc);
+    m_outline = p_outline;
-
-    outline = toc;
 
     updateTreeFromOutline();
 
@@ -49,22 +44,25 @@ void VOutline::updateTreeFromOutline()
 {
     clear();
 
-    if (!outline.valid) {
+    if (m_outline.isEmpty()) {
         return;
     }
 
-    const QVector<VHeader> &headers = outline.headers;
+    const QVector<VTableOfContentItem> &headers = m_outline.getTable();
     int idx = 0;
     updateTreeByLevel(headers, idx, NULL, NULL, 1);
 }
 
-void VOutline::updateTreeByLevel(const QVector<VHeader> &headers, int &index,
+void VOutline::updateTreeByLevel(const QVector<VTableOfContentItem> &headers,
-                                 QTreeWidgetItem *parent, QTreeWidgetItem *last, int level)
+                                 int &index,
+                                 QTreeWidgetItem *parent,
+                                 QTreeWidgetItem *last,
+                                 int level)
 {
     while (index < headers.size()) {
-        const VHeader &header = headers[index];
+        const VTableOfContentItem &header = headers[index];
         QTreeWidgetItem *item;
-        if (header.level == level) {
+        if (header.m_level == level) {
             if (parent) {
                 item = new QTreeWidgetItem(parent);
             } else {
@@ -75,7 +73,7 @@ void VOutline::updateTreeByLevel(const QVector<VHeader> &headers, int &index,
 
             last = item;
             ++index;
-        } else if (header.level < level) {
+        } else if (header.m_level < level) {
             return;
         } else {
             updateTreeByLevel(headers, index, last, NULL, level + 1);
@@ -83,11 +81,11 @@ void VOutline::updateTreeByLevel(const QVector<VHeader> &headers, int &index,
     }
 }
 
-void VOutline::fillItem(QTreeWidgetItem *p_item, const VHeader &p_header)
+void VOutline::fillItem(QTreeWidgetItem *p_item, const VTableOfContentItem &p_header)
 {
-    p_item->setData(0, Qt::UserRole, p_header.index);
+    p_item->setData(0, Qt::UserRole, p_header.m_index);
-    p_item->setText(0, p_header.name);
+    p_item->setText(0, p_header.m_name);
-    p_item->setToolTip(0, p_header.name);
+    p_item->setToolTip(0, p_header.m_name);
 
     if (p_header.isEmpty()) {
         p_item->setForeground(0, QColor("grey"));
@@ -99,127 +97,81 @@ void VOutline::expandTree()
     if (topLevelItemCount() == 0) {
         return;
     }
+
     expandAll();
 }
 
-void VOutline::handleCurItemChanged(QTreeWidgetItem *p_curItem, QTreeWidgetItem * /*p_preItem*/)
+void VOutline::handleCurrentItemChanged(QTreeWidgetItem *p_curItem,
+                                        QTreeWidgetItem * p_preItem)
 {
+    Q_UNUSED(p_preItem);
+
     if (!p_curItem) {
         return;
     }
 
-    const VHeader *header = getHeaderFromItem(p_curItem);
+    const VTableOfContentItem *header = getHeaderFromItem(p_curItem);
-    if (!header) {
+    Q_ASSERT(header);
-        return;
+    m_currentHeader.update(m_outline.getFile(), header->m_index);
-    }
 
-    VAnchor tmp(outline.m_file, header->anchor, header->lineNumber, header->index);
+    if (!header->isEmpty() && !m_muted) {
-    if (tmp == curHeader) {
+        emit outlineItemActivated(m_currentHeader);
-        return;
-    }
-
-    curHeader = tmp;
-
-    if (!header->isEmpty()) {
-        emit outlineItemActivated(curHeader);
     }
 }
 
-void VOutline::updateCurHeader(const VAnchor &anchor)
+void VOutline::updateCurrentHeader(const VHeaderPointer &p_header)
 {
-    if (anchor == curHeader) {
+    if (p_header == m_currentHeader
+        || !m_outline.isMatched(p_header)) {
         return;
     }
 
-    curHeader = anchor;
+    // Item change should not emit the signal.
-    if (outline.type == VHeaderType::Anchor) {
+    m_muted = true;
-        selectAnchor(anchor.anchor);
+    m_currentHeader = p_header;
-    } else {
+    selectHeader(m_currentHeader);
-        // Select by lineNumber.
+    m_muted = false;
-        selectLineNumber(anchor.lineNumber);
-    }
 }
 
-void VOutline::selectAnchor(const QString &anchor)
+void VOutline::selectHeader(const VHeaderPointer &p_header)
 {
     setCurrentItem(NULL);
 
-    if (anchor.isEmpty()) {
+    if (!m_outline.getItem(p_header)) {
         return;
     }
 
     int nrTop = topLevelItemCount();
     for (int i = 0; i < nrTop; ++i) {
-        if (selectAnchorOne(topLevelItem(i), anchor)) {
+        if (selectHeaderOne(topLevelItem(i), p_header)) {
             return;
         }
     }
 }
 
-bool VOutline::selectAnchorOne(QTreeWidgetItem *item, const QString &anchor)
+bool VOutline::selectHeaderOne(QTreeWidgetItem *p_item, const VHeaderPointer &p_header)
 {
-    if (!item) {
+    if (!p_item) {
         return false;
     }
 
-    const VHeader *header = getHeaderFromItem(item);
+    const VTableOfContentItem *header = getHeaderFromItem(p_item);
     if (!header) {
         return false;
     }
 
-    if (header->anchor == anchor) {
+    if (header->isMatched(p_header)) {
-        setCurrentItem(item);
+        setCurrentItem(p_item);
         return true;
     }
 
-    int nrChild = item->childCount();
+    int nrChild = p_item->childCount();
     for (int i = 0; i < nrChild; ++i) {
-        if (selectAnchorOne(item->child(i), anchor)) {
+        if (selectHeaderOne(p_item->child(i), p_header)) {
             return true;
         }
     }
-    return false;
-}
 
-void VOutline::selectLineNumber(int lineNumber)
-{
-    setCurrentItem(NULL);
-
-    if (lineNumber == -1) {
-        return;
-    }
-
-    int nrTop = topLevelItemCount();
-    for (int i = 0; i < nrTop; ++i) {
-        if (selectLineNumberOne(topLevelItem(i), lineNumber)) {
-            return;
-        }
-    }
-}
-
-bool VOutline::selectLineNumberOne(QTreeWidgetItem *item, int lineNumber)
-{
-    if (!item) {
-        return false;
-    }
-
-    const VHeader *header = getHeaderFromItem(item);
-    if (!header) {
-        return false;
-    }
-
-    if (header->lineNumber == lineNumber) {
-        // Select this item
-        setCurrentItem(item);
-        return true;
-    }
-
-    int nrChild = item->childCount();
-    for (int i = 0; i < nrChild; ++i) {
-        if (selectLineNumberOne(item->child(i), lineNumber)) {
-            return true;
-        }
-    }
     return false;
 }
 
@@ -373,17 +325,8 @@ QList<QTreeWidgetItem *> VOutline::getVisibleChildItems(const QTreeWidgetItem *p
     return items;
 }
 
-const VHeader *VOutline::getHeaderFromItem(QTreeWidgetItem *p_item) const
+const VTableOfContentItem *VOutline::getHeaderFromItem(QTreeWidgetItem *p_item) const
 {
-    const VHeader *header = NULL;
-
     int index = p_item->data(0, Qt::UserRole).toInt();
-    if (index < 0 || index >= outline.headers.size()) {
+    return m_outline.getItem(index);
-        return header;
-    }
-
-    header = &(outline.headers[index]);
-    Q_ASSERT(header->index == index);
-
-    return header;
 }

src/voutline.h

@@ -5,11 +5,13 @@
 #include <QVector>
 #include <QMap>
 #include <QChar>
-#include "vtoc.h"
+#include "vtableofcontent.h"
 #include "vnavigationmode.h"
 
 class QLabel;
 
+// Display table of content as a tree and enable user to click an item to
+// jump to that header.
 class VOutline : public QTreeWidget, public VNavigationMode
 {
     Q_OBJECT
@@ -23,45 +25,60 @@ public:
     bool handleKeyNavigation(int p_key, bool &p_succeed) Q_DECL_OVERRIDE;
 
 signals:
-    void outlineItemActivated(const VAnchor &anchor);
+    // Emit when current item changed by user and header of that item is not empty.
+    // Do not worry about infinite recursion.
+    void outlineItemActivated(const VHeaderPointer &p_header);
 
 public slots:
-    void updateOutline(const VToc &toc);
+    // Called to update outline and the tree.
-    void updateCurHeader(const VAnchor &anchor);
+    // Just clear the tree if @p_outline is empty.
+    void updateOutline(const VTableOfContent &p_outline);
+
+    // Called to update current header in the tree.
+    // Will not emit outlineItemActivated().
+    void updateCurrentHeader(const VHeaderPointer &p_header);
 
 protected:
     void keyPressEvent(QKeyEvent *event) Q_DECL_OVERRIDE;
 
 private slots:
-    void handleCurItemChanged(QTreeWidgetItem *p_curItem, QTreeWidgetItem *p_preItem);
+    // Handle current item change even of the tree.
+    // Do not response if m_muted is true.
+    void handleCurrentItemChanged(QTreeWidgetItem *p_curItem, QTreeWidgetItem *p_preItem);
 
 private:
     // Update tree according to outline.
     void updateTreeFromOutline();
 
     // @index: the index in @headers.
-    void updateTreeByLevel(const QVector<VHeader> &headers, int &index, QTreeWidgetItem *parent,
+    void updateTreeByLevel(const QVector<VTableOfContentItem> &headers,
-                           QTreeWidgetItem *last, int level);
+                           int &index,
+                           QTreeWidgetItem *parent,
+                           QTreeWidgetItem *last,
+                           int level);
 
     void expandTree();
-    void selectAnchor(const QString &anchor);
+
-    bool selectAnchorOne(QTreeWidgetItem *item, const QString &anchor);
+    // Set the item corresponding to @p_header as current item.
-    void selectLineNumber(int lineNumber);
+    void selectHeader(const VHeaderPointer &p_header);
-    bool selectLineNumberOne(QTreeWidgetItem *item, int lineNumber);
+
+    bool selectHeaderOne(QTreeWidgetItem *p_item, const VHeaderPointer &p_header);
+
     QList<QTreeWidgetItem *> getVisibleItems() const;
     QList<QTreeWidgetItem *> getVisibleChildItems(const QTreeWidgetItem *p_item) const;
 
     // Fill the info of @p_item.
-    void fillItem(QTreeWidgetItem *p_item, const VHeader &p_header);
+    void fillItem(QTreeWidgetItem *p_item, const VTableOfContentItem &p_header);
-
-    // Check if @p_toc is valid.
-    void checkOutline(const VToc &p_toc) const;
 
     // Return NULL if no corresponding header in outline.
-    const VHeader *getHeaderFromItem(QTreeWidgetItem *p_item) const;
+    const VTableOfContentItem *getHeaderFromItem(QTreeWidgetItem *p_item) const;
 
-    VToc outline;
+    VTableOfContent m_outline;
-    VAnchor curHeader;
+
+    VHeaderPointer m_currentHeader;
+
+    // When true, won't emit outlineItemActivated().
+    bool m_muted;
 
     // Navigation Mode.
     // Map second key to QTreeWidgetItem.

src/vpreviewpage.cpp

@@ -2,10 +2,9 @@
 
 #include <QDesktopServices>
 
-#include "vnote.h"
 #include "vmainwindow.h"
 
-extern VNote *g_vnote;
+extern VMainWindow *g_mainWin;
 
 VPreviewPage::VPreviewPage(QWidget *parent) : QWebEnginePage(parent)
 {
@@ -21,7 +20,7 @@ bool VPreviewPage::acceptNavigationRequest(const QUrl &p_url,
 
     if (p_url.isLocalFile()) {
         QString filePath = p_url.toLocalFile();
-        if (g_vnote->getMainWindow()->tryOpenInternalFile(filePath)) {
+        if (g_mainWin->tryOpenInternalFile(filePath)) {
             qDebug() << "internal notes jump" << filePath;
             return false;
         }